Perylenequinones

Calphostin C, Tocris Bioscience™ Available on GSA/VA Contract for Federal Government customers only.

CAS: 121263-19-2 Molecular Formula: C44H38O14 Molecular Weight (g/mol): 790.774 InChI Key: LSUTUUOITDQYNO-UHFFFAOYSA-N Synonym: 1-3,10-dihydroxy-12-2-4-hydroxyphenoxy carbonyl oxy propyl-2,6,7,11-tetramethoxy-4,9-dioxo-4,9-dihydroperylen-1-yl propan-2-yl benzoate PubChem CID: 2533 IUPAC Name: 1-[3,10-dihydroxy-12-[2-(4-hydroxyphenoxy)carbonyloxypropyl]-2,6,7,11-tetramethoxy-4,9-dioxoperylen-1-yl]propan-2-yl benzoate SMILES: CC(CC1=C(C(=C2C(=O)C=C(C3=C4C(=CC(=O)C5=C(C(=C(C(=C45)C1=C32)CC(C)OC(=O)OC6=CC=C(C=C6)O)OC)O)OC)OC)O)OC)OC(=O)C7=CC=CC=C7

  spinner