Seleninic acids and derivatives

Benzeneseleninic anhydride, 98%, ACROS Organics™

CAS: 17697-12-0 Molecular Formula: C12H10O3Se2 Molecular Weight (g/mol): 360.13 MDL Number: MFCD00001991 InChI Key: FHPZOWOEILXXBD-UHFFFAOYSA-N Synonym: 1,3-diphenyldiselenoxane 1,3-dioxide # PubChem CID: 87253 IUPAC Name: phenylseleninyl benzeneseleninate SMILES: C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2

  spinner