Organic azides

Alfa Aesar™ Azidotri-n-butyltin(IV), 95%

CAS: 17846-68-3 Molecular Formula: C12H27N3Sn Molecular Weight (g/mol): 332.079 MDL Number: MFCD00216557 InChI Key: JKVRTUCVPZTEQZ-UHFFFAOYSA-N Synonym: azido tributyl stannane PubChem CID: 4984872 IUPAC Name: azido(tributyl)stannane SMILES: CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-]

  spinner