Pyrazolopyrimidines

5-(2-Ethoxyphenyl)-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]-7-pyrimidinone 98.0+%, TCI America™

CAS: 139756-21-1 Molecular Formula: C17H20N4O2 Molecular Weight (g/mol): 312.373 MDL Number: MFCD04088989 InChI Key: MXQUEDUMKWBYHI-UHFFFAOYSA-N PubChem CID: 899745 IUPAC Name: 5-(2-ethoxyphenyl)-1-methyl-3-propyl-4H-pyrazolo[4,3-d]pyrimidin-7-one SMILES: CCCC1=NN(C2=C1NC(=NC2=O)C3=CC=CC=C3OCC)C

  spinner