Pyrroloazepines

10Z-Hymenialdisine, Tocris Bioscience™

CAS: 82005-12-7 Molecular Formula: C11H10BrN5O2 Molecular Weight (g/mol): 324.138 InChI Key: ATBAETXFFCOZOY-QPJJXVBHSA-N Synonym: 10e-hymenialdisine PubChem CID: 3036831 IUPAC Name: (4E)-4-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2-bromo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-8-one SMILES: C1CNC(=O)C2=C(C1=C3C(=O)N=C(N3)N)C=C(N2)Br

  spinner