Thiols

2-Mercapto-5-nitropyridine 98.0+%, TCI America™

CAS: 2127-09-5 Molecular Formula: C5H4N2O2S Molecular Weight (g/mol): 156.16 MDL Number: MFCD00030890 InChI Key: BHQUBONFIYNJDA-UHFFFAOYSA-N Synonym: 5-Nitro-2-pyridinethiol, 5-Nitro-2-pyridyl Mercaptan PubChem CID: 2763652 IUPAC Name: 5-nitro-1H-pyridine-2-thione SMILES: C1=CC(=S)NC=C1[N+](=O)[O-]

  spinner