Angucyclines

1,2-Benzanthraquinone 95.0+%, TCI America™

CAS: 2498-66-0 Molecular Formula: C18H10O2 Molecular Weight (g/mol): 258.276 MDL Number: MFCD00003596 InChI Key: LHMRXAIRPKSGDE-UHFFFAOYSA-N Synonym: 1,2-benzanthraquinone PubChem CID: 17253 IUPAC Name: benzo[a]anthracene-7,12-dione SMILES: C1=CC=C2C(=C1)C=CC3=C2C(=O)C4=CC=CC=C4C3=O

  spinner