Pyrimidine 3'-deoxyribonucleosides

Alfa Aesar™ 3'-Deoxyuridine

CAS: 7057-27-4 Molecular Formula: C9H12N2O5 Molecular Weight (g/mol): 228.204 MDL Number: MFCD00079153 InChI Key: QOXJRLADYHZRGC-SHYZEUOFSA-N Synonym: 1-2r,3r,5s-3-hydroxy-5-hydroxymethyl oxolan-2-yl pyrimidine-2,4-dione PubChem CID: 145984 IUPAC Name: 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione SMILES: C1C(OC(C1O)N2C=CC(=O)NC2=O)CO

  spinner