Borinic acids

Alfa Aesar™ Dimesitylborinic acid, 98%

CAS: 20631-84-9 Molecular Formula: C18H23BO Molecular Weight (g/mol): 266.191 MDL Number: MFCD01863507 InChI Key: OTYVTANMHIUXBQ-UHFFFAOYSA-N Synonym: bis 2,4,6-trimethylphenyl borinic acid PubChem CID: 5102928 IUPAC Name: bis(2,4,6-trimethylphenyl)borinic acid SMILES: B(C1=C(C=C(C=C1C)C)C)(C2=C(C=C(C=C2C)C)C)O

  spinner