Arylsulfates

Alfa Aesar™ 3-Indoxyl sulfate potassium salt, 97%

CAS: 2642-37-7 Molecular Formula: C8H6KNO4S Molecular Weight (g/mol): 251.297 MDL Number: MFCD00037931 InChI Key: MDAWATNFDJIBBD-UHFFFAOYSA-M Synonym: indican urinary PubChem CID: 5177095 IUPAC Name: potassium;1H-indol-3-yl sulfate SMILES: C1=CC=C2C(=C1)C(=CN2)OS(=O)(=O)[O-].[K+]

  spinner