Aminoxides

4-Acetamido-2,2,6,6-tetramethyl-1-oxopiperidinium Tetrafluoroborate 95.0+%, TCI America™

CAS: 219543-09-6 Molecular Formula: C11H21BF4N2O2 Molecular Weight (g/mol): 300.105 InChI Key: HTMHEICBCHCWAU-UHFFFAOYSA-O PubChem CID: 2753331 IUPAC Name: N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide;tetrafluoroborate SMILES: [B-](F)(F)(F)F.CC(=O)NC1CC([N+](=O)C(C1)(C)C)(C)C

  spinner