Naphthylisoquinolines

1-(2-Amino-1-naphthyl)isoquinoline 98.0+%, TCI America™

CAS: 664302-70-9 Molecular Formula: C19H14N2 Molecular Weight (g/mol): 270.335 InChI Key: OYLNFFGFQUEPML-UHFFFAOYSA-N Synonym: 1-(Isoquinolinyl)-2-naphthylamine PubChem CID: 24938303 IUPAC Name: 1-isoquinolin-1-ylnaphthalen-2-amine SMILES: C1=CC=C2C(=C1)C=CC(=C2C3=NC=CC4=CC=CC=C43)N

  spinner