Stilbene glycosides

Piceid 95.0+%, TCI America™

CAS: 27208-80-6 Molecular Formula: C20H22O8 Molecular Weight (g/mol): 390.388 MDL Number: MFCD00210592 InChI Key: HSTZMXCBWJGKHG-CUYWLFDKSA-N Synonym: Resveratrol 3-Glucoside, 4′C,5-Dihydroxystilben-3-yl beta-D-Glucopyranoside, Polydatin PubChem CID: 5281718 ChEBI: CHEBI:8198 IUPAC Name: (2S,3R,4S,5S,6R)-2-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol SMILES: C1=CC(=CC=C1C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O

  spinner