Monohydroxyflavonoids

Alfa Aesar™ 4'-Hydroxy-6-methylflavone, 97%

CAS: 288401-04-7 Molecular Formula: C16H12O3 Molecular Weight (g/mol): 252.269 MDL Number: MFCD03424432 InChI Key: YAACYYNCHMHECD-UHFFFAOYSA-N Synonym: 2-4-hydroxyphenyl-6-methyl-4h-chromen-4-one PubChem CID: 1659442 IUPAC Name: 2-(4-hydroxyphenyl)-6-methylchromen-4-one SMILES: CC1=CC2=C(C=C1)OC(=CC2=O)C3=CC=C(C=C3)O

  spinner