Biochemical Reagents
Filtered Search Results
L-Isoleucine (White Crystals or Crystalline Powder), Fisher BioReagents™
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
Thermo Scientific Chemicals L-Isoleucine, 99%
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
Thermo Scientific Chemicals L-Isoleucine, 99%
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
Thermo Scientific Chemicals D-Isoleucine, 98%
CAS: 319-78-8 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064221 InChI Key: AGPKZVBTJJNPAG-LXDRQGDMNA-N Synonym: d-isoleucine,2r,3r-2-amino-3-methylpentanoic acid,h-d-ile-oh,isoleucine, d,unii-v87gja0g54,r-isoleucine,2r,3r-2-amino-3-methylvaleric acid,alloisoleucin,d-ile,ambotzhaa1186 PubChem CID: 76551 ChEBI: CHEBI:27730 IUPAC Name: (2R,3R)-2-amino-3-methylpentanoic acid SMILES: CC[C@@H](C)[C@@H](N)C(O)=O
| PubChem CID | 76551 |
|---|---|
| CAS | 319-78-8 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:27730 |
| MDL Number | MFCD00064221 |
| SMILES | CC[C@@H](C)[C@@H](N)C(O)=O |
| Synonym | d-isoleucine,2r,3r-2-amino-3-methylpentanoic acid,h-d-ile-oh,isoleucine, d,unii-v87gja0g54,r-isoleucine,2r,3r-2-amino-3-methylvaleric acid,alloisoleucin,d-ile,ambotzhaa1186 |
| IUPAC Name | (2R,3R)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-LXDRQGDMNA-N |
| Molecular Formula | C6H13NO2 |
DL-Isoleucine, 99%
CAS: 443-79-8 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N PubChem CID: 94206 ChEBI: CHEBI:20899 SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 94206 |
|---|---|
| CAS | 443-79-8 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:20899 |
| MDL Number | MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
D-allo-Isoleucine, 97%
CAS: 1509-35-9 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00066445 InChI Key: AGPKZVBTJJNPAG-CRCLSJGQSA-N Synonym: d-alloisoleucine,d-allo-isoleucine,2r,3s-2-amino-3-methylpentanoic acid,allo-d-isoleucine,alloisoleucine, d,h-d-allo-ile-oh,threo-d-isoleucine,dl-allo-isoleucine,hile,h-dl-allo-ile-oh PubChem CID: 94206 ChEBI: CHEBI:20899 IUPAC Name: (2R,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@@H](N)C(O)=O
| PubChem CID | 94206 |
|---|---|
| CAS | 1509-35-9 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:20899 |
| MDL Number | MFCD00066445 |
| SMILES | CC[C@H](C)[C@@H](N)C(O)=O |
| Synonym | d-alloisoleucine,d-allo-isoleucine,2r,3s-2-amino-3-methylpentanoic acid,allo-d-isoleucine,alloisoleucine, d,h-d-allo-ile-oh,threo-d-isoleucine,dl-allo-isoleucine,hile,h-dl-allo-ile-oh |
| IUPAC Name | (2R,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-CRCLSJGQSA-N |
| Molecular Formula | C6H13NO2 |
N-Acetyl-L-isoleucine, 98%
CAS: 3077-46-1 Molecular Formula: C8H15NO3 Molecular Weight (g/mol): 173.21 MDL Number: MFCD00066072 InChI Key: JDTWZSUNGHMMJM-IFSCUNPJNA-N Synonym: n-acetyl-l-isoleucine,2s,3s-2-acetamido-3-methylpentanoic acid,ac-ile-oh,l-isoleucine, n-acetyl,unii-p9cl0y0bvz,p9cl0y0bvz,isoleucine, n-acetyl-, l,acetyl isoleucine,n-acetyl-isoleucine,acetyl-l-isoleucine PubChem CID: 7036275 ChEBI: CHEBI:21555 SMILES: CC[C@H](C)[C@H](NC(C)=O)C(O)=O
| PubChem CID | 7036275 |
|---|---|
| CAS | 3077-46-1 |
| Molecular Weight (g/mol) | 173.21 |
| ChEBI | CHEBI:21555 |
| MDL Number | MFCD00066072 |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(O)=O |
| Synonym | n-acetyl-l-isoleucine,2s,3s-2-acetamido-3-methylpentanoic acid,ac-ile-oh,l-isoleucine, n-acetyl,unii-p9cl0y0bvz,p9cl0y0bvz,isoleucine, n-acetyl-, l,acetyl isoleucine,n-acetyl-isoleucine,acetyl-l-isoleucine |
| InChI Key | JDTWZSUNGHMMJM-IFSCUNPJNA-N |
| Molecular Formula | C8H15NO3 |
L-Isoleucine, 99%, MP Biomedicals
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
Thermo Scientific Chemicals L-Isoleucine, Cell Culture Reagent
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
MilliporeSigma™ L-Isoleucine, Calbiochem™,
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
L-Isoleucine 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 73-32-5 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00064222 MFCD00004268 InChI Key: AGPKZVBTJJNPAG-WHFBIAKZSA-N Synonym: l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile PubChem CID: 6306 ChEBI: CHEBI:17191 IUPAC Name: (2S,3S)-2-amino-3-methylpentanoic acid SMILES: CC[C@H](C)[C@H](N)C(O)=O
| PubChem CID | 6306 |
|---|---|
| CAS | 73-32-5 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:17191 |
| MDL Number | MFCD00064222 MFCD00004268 |
| SMILES | CC[C@H](C)[C@H](N)C(O)=O |
| Synonym | l-isoleucine,isoleucine,2s,3s-2-amino-3-methylpentanoic acid,s-isoleucine,s,s-isoleucine,2s,3s-isoleucine,2-amino-3-methylvaleric acid,erythro-l-isoleucine,l-+-isoleucine,l-ile |
| IUPAC Name | (2S,3S)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Molecular Formula | C6H13NO2 |
L-Isoleucine ethyl ester hydrochloride, 98%
CAS: 56782-52-6 Molecular Formula: C8H18ClNO2 Molecular Weight (g/mol): 195.69 MDL Number: MFCD09953729 InChI Key: QQGRWNMNWONMOO-LEUCUCNGSA-N Synonym: l-isoleucine ethyl ester hydrochloride,h-ile-oet.hcl,ethyl l-isoleucinate hydrochloride,l-isoleucine ethyl ester hcl,2s,3s-ethyl 2-amino-3-methylpentanoate hydrochloride,isoleucine, ethyl ester, hydrochloride,ethyl 2s,3s-2-amino-3-methylpentanoate hydrochloride,l-isoleucine ethylester hcl,ksc497o6p,l-isoleucineethylesterhydrochloride PubChem CID: 6453390 SMILES: Cl.CCOC(=O)[C@@H](N)[C@@H](C)CC
| PubChem CID | 6453390 |
|---|---|
| CAS | 56782-52-6 |
| Molecular Weight (g/mol) | 195.69 |
| MDL Number | MFCD09953729 |
| SMILES | Cl.CCOC(=O)[C@@H](N)[C@@H](C)CC |
| Synonym | l-isoleucine ethyl ester hydrochloride,h-ile-oet.hcl,ethyl l-isoleucinate hydrochloride,l-isoleucine ethyl ester hcl,2s,3s-ethyl 2-amino-3-methylpentanoate hydrochloride,isoleucine, ethyl ester, hydrochloride,ethyl 2s,3s-2-amino-3-methylpentanoate hydrochloride,l-isoleucine ethylester hcl,ksc497o6p,l-isoleucineethylesterhydrochloride |
| InChI Key | QQGRWNMNWONMOO-LEUCUCNGSA-N |
| Molecular Formula | C8H18ClNO2 |
L-allo-Isoleucine, 99%, 99% ee
CAS: 1509-34-8 Molecular Formula: C6H13NO2 Molecular Weight (g/mol): 131.18 MDL Number: MFCD00066446 InChI Key: AGPKZVBTJJNPAG-BJNJOQLTNA-N Synonym: l-allo-isoleucine,l-alloisoleucine,alloisoleucine,2s,3r-2-amino-3-methylpentanoic acid,allo-isoleucine,allo-l-isoleucine,h-allo-ile-oh,3r-ls-isoleucine,isoleucine, allo,isoleucine, threo PubChem CID: 99288 ChEBI: CHEBI:43433 IUPAC Name: (2S,3R)-2-amino-3-methylpentanoic acid SMILES: CC[C@@H](C)[C@H](N)C(O)=O
| PubChem CID | 99288 |
|---|---|
| CAS | 1509-34-8 |
| Molecular Weight (g/mol) | 131.18 |
| ChEBI | CHEBI:43433 |
| MDL Number | MFCD00066446 |
| SMILES | CC[C@@H](C)[C@H](N)C(O)=O |
| Synonym | l-allo-isoleucine,l-alloisoleucine,alloisoleucine,2s,3r-2-amino-3-methylpentanoic acid,allo-isoleucine,allo-l-isoleucine,h-allo-ile-oh,3r-ls-isoleucine,isoleucine, allo,isoleucine, threo |
| IUPAC Name | (2S,3R)-2-amino-3-methylpentanoic acid |
| InChI Key | AGPKZVBTJJNPAG-BJNJOQLTNA-N |
| Molecular Formula | C6H13NO2 |
N-Fmoc-D-allo-isoleucine, 98%
CAS: 118904-37-3 Molecular Formula: C21H23NO4 Molecular Weight (g/mol): 353.42 MDL Number: MFCD00077062 InChI Key: QXVFEIPAZSXRGM-KINVLMLONA-N Synonym: fmoc-d-allo-ile-oh,fmoc-d-allo-isoleucine,fmoc-d-allo-lle-oh,2r,3s-n-fmoc-2-amino-3-methylpentanoic acid,2r,3s-2-9h-fluoren-9-yl methoxy carbonyl amino-3-methylpentanoic acid,d-alloisoleucine, n-9h-fluoren-9-ylmethoxy carbonyl,2r,3s-2-9h-fluoren-9-ylmethoxy carbonyl amino-3-methylpentanoic acid,ambotzfaa1328,pubchem15619 PubChem CID: 6992517 IUPAC Name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid SMILES: CC[C@H](C)[C@@H](NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(O)=O
| PubChem CID | 6992517 |
|---|---|
| CAS | 118904-37-3 |
| Molecular Weight (g/mol) | 353.42 |
| MDL Number | MFCD00077062 |
| SMILES | CC[C@H](C)[C@@H](NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(O)=O |
| Synonym | fmoc-d-allo-ile-oh,fmoc-d-allo-isoleucine,fmoc-d-allo-lle-oh,2r,3s-n-fmoc-2-amino-3-methylpentanoic acid,2r,3s-2-9h-fluoren-9-yl methoxy carbonyl amino-3-methylpentanoic acid,d-alloisoleucine, n-9h-fluoren-9-ylmethoxy carbonyl,2r,3s-2-9h-fluoren-9-ylmethoxy carbonyl amino-3-methylpentanoic acid,ambotzfaa1328,pubchem15619 |
| IUPAC Name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid |
| InChI Key | QXVFEIPAZSXRGM-KINVLMLONA-N |
| Molecular Formula | C21H23NO4 |
L-Isoleucine tert-butyl ester hydrochloride, 98%
CAS: 69320-89-4 Molecular Formula: C10H22ClNO2 Molecular Weight (g/mol): 223.74 MDL Number: MFCD00058015 InChI Key: IFRYMHOZFAPYPJ-HAGKNZRZNA-N Synonym: h-ile-otbu.hcl,l-isoleucine tert-butyl ester hydrochloride,h-ile-otbu hcl,l-isoleucine t-butyl ester hydrochloride,h-ile-otbu hydrochloride,l-isoleucine t-butyl ester hcl,tert-butyl 2s,3s-2-amino-3-methylpentanoate hydrochloride,l-isoleucine, 1,1-dimethylethyl ester, hydrochloride,h-ile-obut.hcl,h-ile-otbu??hcl PubChem CID: 11687228 IUPAC Name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride SMILES: Cl.CC[C@H](C)[C@H](N)C(=O)OC(C)(C)C
| PubChem CID | 11687228 |
|---|---|
| CAS | 69320-89-4 |
| Molecular Weight (g/mol) | 223.74 |
| MDL Number | MFCD00058015 |
| SMILES | Cl.CC[C@H](C)[C@H](N)C(=O)OC(C)(C)C |
| Synonym | h-ile-otbu.hcl,l-isoleucine tert-butyl ester hydrochloride,h-ile-otbu hcl,l-isoleucine t-butyl ester hydrochloride,h-ile-otbu hydrochloride,l-isoleucine t-butyl ester hcl,tert-butyl 2s,3s-2-amino-3-methylpentanoate hydrochloride,l-isoleucine, 1,1-dimethylethyl ester, hydrochloride,h-ile-obut.hcl,h-ile-otbu??hcl |
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChI Key | IFRYMHOZFAPYPJ-HAGKNZRZNA-N |
| Molecular Formula | C10H22ClNO2 |