Buffers and Standards
Hydrogen ion buffers comprising a mixture of a weak acid and its conjugate base or vice-versa and used to stabilize pH; also diluents, washing solutions, and standard-value solutions used for a broad array of scientific calibration purposes.
The buffers used to calibrate pH meters may be certified and/or traceable to the National Institute of Standards and Technology (NIST). These buffers may also be color-coded for easy identification:
- Red: pH 4.0
- Yellow: pH 7.0
- Blue: pH 10.0
Filtered Search Results
Hyamine Solution, 0.004 M (0.004 N), Ricca Chemical
CAS: 121-54-0 Molecular Formula: C27H42ClNO2 Molecular Weight (g/mol): 448.088 InChI Key: UREZNYTWGJKWBI-UHFFFAOYSA-M Synonym: benzethonium chloride,quatrachlor,hyamine,phemeride,phemerol chloride,benzethoniumchloride,phemithyn,disilyn,kylacol,solamin PubChem CID: 8478 ChEBI: CHEBI:31264 IUPAC Name: benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride SMILES: CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-]
| PubChem CID | 8478 |
|---|---|
| CAS | 121-54-0 |
| Molecular Weight (g/mol) | 448.088 |
| ChEBI | CHEBI:31264 |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
| Synonym | benzethonium chloride,quatrachlor,hyamine,phemeride,phemerol chloride,benzethoniumchloride,phemithyn,disilyn,kylacol,solamin |
| IUPAC Name | benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |
| InChI Key | UREZNYTWGJKWBI-UHFFFAOYSA-M |
| Molecular Formula | C27H42ClNO2 |
Phosphate Buffered Saline, 1X - Non-sterile, Ricca Chemical
Phosphate Buffered Saline, 1X is non-sterile.
Lithium aluminum hydride, 4.0M solution in diethyl ether, AcroSeal™
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| Linear Formula | LiAIH4 |
|---|---|
| Molecular Weight (g/mol) | 37.95 |
| InChI Key | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Density | 0.7100g/mL |
| PubChem CID | 21226445 |
| Name Note | 4.0M Solution in Diethyl Ether |
| Percent Purity | 18.0 to 22.0% (as LiAlH4) |
| Fieser | 01,581; 02,242; 03,176; 04,291; 05,382; 06,325; 07,196; 08,286; 09,274; 10,236; 11,289; 12,272; 13,61; 14,190; 15,184; 16,133; 17,162 |
| Formula Weight | 37.95 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Lithium Aluminum hydride |
| SMILES | [Li+].[AlH4-] |
| Merck Index | 15, 344 |
| CAS | 60-29-7 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep away from any possible contact with water, because of violent reaction and possible flash fire. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Do not breathe dust/fume/gas/mist/vapors/spray. |
| MDL Number | MFCD00011075 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause drowsiness or dizziness. In contact with water releases flammable gases which may ignite spontaneously. Extremely flammable liquid and vapor. May form explosive peroxides. Repeated exposure may cause skin dryness or cracking. |
| Flash Point | −017°C |
| Solubility Information | Solubility in water: vigorous reaction. |
| Health Hazard 1 | Danger |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Recommended Storage | Product may develop some turbidity or precipitate |
| IUPAC Name | lithium(1+) alumanuide |
| Molecular Formula | AlH4Li |
| Specific Gravity | 0.71 |
Ethidium bromide soln., 10mg/ml
CAS: 1239-45-8 Molecular Formula: C21H20BrN3 Molecular Weight (g/mol): 394.32 MDL Number: MFCD00011724 InChI Key: ZMMJGEGLRURXTF-UHFFFAOYSA-N Synonym: ethidium bromide,homidium bromide,dromilac,3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide,ethydium bromide,3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide,etbr,2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide,2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide,unii-059nuo2z1l PubChem CID: 14710 ChEBI: CHEBI:4883 IUPAC Name: 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide SMILES: [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12
| PubChem CID | 14710 |
|---|---|
| CAS | 1239-45-8 |
| Molecular Weight (g/mol) | 394.32 |
| ChEBI | CHEBI:4883 |
| MDL Number | MFCD00011724 |
| SMILES | [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
| Synonym | ethidium bromide,homidium bromide,dromilac,3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide,ethydium bromide,3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide,etbr,2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide,2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide,unii-059nuo2z1l |
| IUPAC Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| InChI Key | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| Molecular Formula | C21H20BrN3 |
Cabozantinib (S)-malate, Thermo Scientific™
CAS: 1140909-48-3 Molecular Formula: C32H30FN3O10 Molecular Weight (g/mol): 635.60 MDL Number: MFCD20923480 InChI Key: HFCFMRYTXDINDK-UHFFFAOYNA-N IUPAC Name: 2-hydroxybutanedioic acid; N'1-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide SMILES: OC(CC(O)=O)C(O)=O.COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1
| CAS | 1140909-48-3 |
|---|---|
| Molecular Weight (g/mol) | 635.60 |
| MDL Number | MFCD20923480 |
| SMILES | OC(CC(O)=O)C(O)=O.COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1 |
| IUPAC Name | 2-hydroxybutanedioic acid; N'1-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| InChI Key | HFCFMRYTXDINDK-UHFFFAOYNA-N |
| Molecular Formula | C32H30FN3O10 |
Thermo Scientific Chemicals PIPES, 98.5+%, for biochemistry
CAS: 5625-37-6 Molecular Formula: C8H18N2O6S2 Molecular Weight (g/mol): 302.36 InChI Key: IHPYMWDTONKSCO-UHFFFAOYSA-N Synonym: 1, 4-Piperazinebis(ethanesulfonic acid) PubChem CID: 79723 ChEBI: CHEBI:44933 IUPAC Name: 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid SMILES: C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)O
| PubChem CID | 79723 |
|---|---|
| CAS | 5625-37-6 |
| Molecular Weight (g/mol) | 302.36 |
| ChEBI | CHEBI:44933 |
| SMILES | C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)O |
| Synonym | 1, 4-Piperazinebis(ethanesulfonic acid) |
| IUPAC Name | 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid |
| InChI Key | IHPYMWDTONKSCO-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O6S2 |
Potassium Dichromate TS, 7.5% (w/v), Ricca Chemical
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.182 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.182 |
| ChEBI | CHEBI:53444 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Thermo Scientific Chemicals HEPES sodium salt, 99%
CAS: 75277-39-3 Molecular Formula: C8H17N2NaO4S Molecular Weight (g/mol): 260.28 MDL Number: MFCD00036463 InChI Key: RDZTWEVXRGYCFV-UHFFFAOYSA-M Synonym: 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt PubChem CID: 2724248 ChEBI: CHEBI:46758 IUPAC Name: sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate SMILES: [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1
| PubChem CID | 2724248 |
|---|---|
| CAS | 75277-39-3 |
| Molecular Weight (g/mol) | 260.28 |
| ChEBI | CHEBI:46758 |
| MDL Number | MFCD00036463 |
| SMILES | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| Synonym | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt |
| IUPAC Name | sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| InChI Key | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Molecular Formula | C8H17N2NaO4S |
VeriSpec™ Sulphate - SO42- Standard for Ion Chromatography 1000 ppm in H2O, Ricca Chemical
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N PubChem CID: 6097028 ChEBI: CHEBI:62946 IUPAC Name: sulfuric acid diamine SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| IUPAC Name | sulfuric acid diamine |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Potassium Chloride Conductivity Standard, 5000 μS/cm at 25°C, Ricca Chemical
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Buffer solution pH 4.01 (+/-0.022 @ 25oC) No Color Specpure NIST Traceable
CAS: 1336-21-6 | H5NO | 35.05 g/mol
| Molecular Weight (g/mol) | 35.05 |
|---|---|
| ChEBI | CHEBI:18219 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Buffer solution |
| SMILES | N.O |
| InChI Key | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| PubChem CID | 14923 |
| MDL Number | MFCD00066650 |
| Solubility Information | Miscible with water. |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| IUPAC Name | azanium;hydroxide |
| Molecular Formula | H5NO |
| Odor | Odorless |
Potassium Chloride Conductivity Standard, 50,000 μS/cm (50 mS/cm) at 25°C, Ricca Chemical
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Potassium chloride, 0.010M, Conductivity Standard
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Ethylenediaminetetraacetic Acid, in PBS, MP Biomedicals
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals Potassium phosphate, 0.2M buffer soln., pH 7.4
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M IUPAC Name: potassium dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| CAS | 7778-77-0 |
|---|---|
| Molecular Weight (g/mol) | 136.08 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| IUPAC Name | potassium dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |