Chemicals
Filtered Search Results
Manganese(II) nitrate tetrahydrate, 98%
CAS: 20694-39-7 Molecular Formula: H8MnN2O10 Molecular Weight (g/mol): 251.006 MDL Number: MFCD00149789 InChI Key: ALIMWUQMDCBYFM-UHFFFAOYSA-N Synonym: manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate PubChem CID: 182616 IUPAC Name: manganese(2+);dinitrate;tetrahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2]
| PubChem CID | 182616 |
|---|---|
| CAS | 20694-39-7 |
| Molecular Weight (g/mol) | 251.006 |
| MDL Number | MFCD00149789 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2] |
| Synonym | manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate |
| IUPAC Name | manganese(2+);dinitrate;tetrahydrate |
| InChI Key | ALIMWUQMDCBYFM-UHFFFAOYSA-N |
| Molecular Formula | H8MnN2O10 |
Manganese(II) chloride, 1M aq. soln.
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 IUPAC Name: manganese(2+) dichloride SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| IUPAC Name | manganese(2+) dichloride |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Manganese Chloride Tetrahydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L Synonym: Manganese (II) Chloride IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| Synonym | Manganese (II) Chloride |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Manganese(II) Chloride Tetrahydrate 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Manganese(II) sulfate monohydrate, 99%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Manganese(II) chloride, 97%
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Manganese(II) chloride tetrahydrate, ACS reagent
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Manganese(II) acetate, 98+%, anhydrous
CAS: 638-38-0 Molecular Formula: C4H6MnO4 Molecular Weight (g/mol): 173.03 MDL Number: MFCD00013039 InChI Key: UOGMEBQRZBEZQT-UHFFFAOYSA-L Synonym: manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y PubChem CID: 12525 IUPAC Name: manganese(2+);diacetate SMILES: [Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 12525 |
|---|---|
| CAS | 638-38-0 |
| Molecular Weight (g/mol) | 173.03 |
| MDL Number | MFCD00013039 |
| SMILES | [Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y |
| IUPAC Name | manganese(2+);diacetate |
| InChI Key | UOGMEBQRZBEZQT-UHFFFAOYSA-L |
| Molecular Formula | C4H6MnO4 |
Manganese(II) methoxide
CAS: 7245-20-7 Molecular Formula: C2H6MnO2 Molecular Weight (g/mol): 117.006 MDL Number: MFCD00061476 InChI Key: UQIRCVPINUNHQY-UHFFFAOYSA-N Synonym: manganese ii methoxide,acmc-20akkm,dimethoxymanganese ii,manganese ii bis methoxide,manganese 2+ bis methoxide,manganese 2+ ion bis methoxide PubChem CID: 10219413 IUPAC Name: manganese(2+);methanolate SMILES: C[O-].C[O-].[Mn+2]
| PubChem CID | 10219413 |
|---|---|
| CAS | 7245-20-7 |
| Molecular Weight (g/mol) | 117.006 |
| MDL Number | MFCD00061476 |
| SMILES | C[O-].C[O-].[Mn+2] |
| Synonym | manganese ii methoxide,acmc-20akkm,dimethoxymanganese ii,manganese ii bis methoxide,manganese 2+ bis methoxide,manganese 2+ ion bis methoxide |
| IUPAC Name | manganese(2+);methanolate |
| InChI Key | UQIRCVPINUNHQY-UHFFFAOYSA-N |
| Molecular Formula | C2H6MnO2 |
Manganese(II) phthalocyanine
CAS: 14325-24-7 Molecular Formula: C32H16MnN8 Molecular Weight (g/mol): 567.474 MDL Number: MFCD00049821 InChI Key: ICIFYHOILPYQKB-UHFFFAOYSA-N PubChem CID: 6508743 SMILES: C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C([N-]4)N=C6C7=CC=CC=C7C(=N6)N=C8C9=CC=CC=C9C(=N8)N=C2[N-]3.[Mn+2]
| PubChem CID | 6508743 |
|---|---|
| CAS | 14325-24-7 |
| Molecular Weight (g/mol) | 567.474 |
| MDL Number | MFCD00049821 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C([N-]4)N=C6C7=CC=CC=C7C(=N6)N=C8C9=CC=CC=C9C(=N8)N=C2[N-]3.[Mn+2] |
| InChI Key | ICIFYHOILPYQKB-UHFFFAOYSA-N |
| Molecular Formula | C32H16MnN8 |
Manganese(III) oxide, 98%
CAS: 1317-34-6 Molecular Formula: Mn2O3 Molecular Weight (g/mol): 157.873 MDL Number: MFCD00016217 InChI Key: GEYXPJBPASPPLI-UHFFFAOYSA-N Synonym: manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese PubChem CID: 14824 IUPAC Name: oxo(oxomanganiooxy)manganese SMILES: O=[Mn]O[Mn]=O
| PubChem CID | 14824 |
|---|---|
| CAS | 1317-34-6 |
| Molecular Weight (g/mol) | 157.873 |
| MDL Number | MFCD00016217 |
| SMILES | O=[Mn]O[Mn]=O |
| Synonym | manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese |
| IUPAC Name | oxo(oxomanganiooxy)manganese |
| InChI Key | GEYXPJBPASPPLI-UHFFFAOYSA-N |
| Molecular Formula | Mn2O3 |
Manganese(II) bromide, 99%, anhydrous
CAS: 13446-03-2 Molecular Formula: Br2Mn Molecular Weight (g/mol): 214.76 MDL Number: MFCD00011113
| CAS | 13446-03-2 |
|---|---|
| Molecular Weight (g/mol) | 214.76 |
| MDL Number | MFCD00011113 |
| Molecular Formula | Br2Mn |
Manganese(IV) oxide, 97%
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Manganese(III)acetylacetonate, 97%
CAS: 14284-89-0 Molecular Formula: C15H21MnO6 Molecular Weight (g/mol): 352.27 MDL Number: MFCD00000023 InChI Key: HYZQBNDRDQEWAN-LNTINUHCSA-K Synonym: mn iii acetylacetonate,tris acetylacetonato manganese iii PubChem CID: 122130696 IUPAC Name: manganese(3+);(E)-4-oxopent-2-en-2-olate SMILES: [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 122130696 |
|---|---|
| CAS | 14284-89-0 |
| Molecular Weight (g/mol) | 352.27 |
| MDL Number | MFCD00000023 |
| SMILES | [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | mn iii acetylacetonate,tris acetylacetonato manganese iii |
| IUPAC Name | manganese(3+);(E)-4-oxopent-2-en-2-olate |
| InChI Key | HYZQBNDRDQEWAN-LNTINUHCSA-K |
| Molecular Formula | C15H21MnO6 |
Manganese(II) sulfate monohydrate, 97%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |