Environmental Testing Standards
![eMolecules 1180-71-8 | Limonin | Ambeed | MFCD00075922 | 470.518 | C26H30O8 | 98.000 | CC1(C)O[C@H]2CC(=O)OC[C@@]22[C@H]1CC(=O)[C@]1(C)[C@@H]2CC[C@@]2(C)[C@@H](OC(=O)[C@H]3O[C@@]123)c1ccoc1 | 100mg | 525052649](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502427505.JPG-250.jpg)
eMolecules 1180-71-8 | Limonin | Ambeed | MFCD00075922 | 470.518 | C26H30O8 | 98.000 | CC1(C)O[C@H]2CC(=O)OC[C@@]22[C@H]1CC(=O)[C@]1(C)[C@@H]2CC[C@@]2(C)[C@@H](OC(=O)[C@H]3O[C@@]123)c1ccoc1 | 100mg | 525052649
Limonin | Ambeed | 1180-71-8 | MFCD00075922 | 470.518 | C26H30O8 | 98.000 | CC1(C)O[C@H]2CC(=O)OC[C@@]22[C@H]1CC(=O)[C@]1(C)[C@@H]2CC[C@@]2(C)[C@@H](OC(=O)[C@H]3O[C@@]123)c1ccoc1 | 100mg | 525052649
eMolecules 126937-43-7 | ChemScene | 1-Benzyl 2-methyl piperazine-12-dicarboxylate | 1g | 632316122 | CS-0041205 | MFCD04115344 | 278.308 | C14H18N2O4
Ambeed | 4-Nitrophenyl stearate | 1g | 552599236 | A158930 | 14617-86-8 | MFCD00047733 | 405.579 | C24H39NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 850411-14-2 | Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl)piperidine-3-carboxylate | Ambeed | MFCD06657751 | 387.280 | C21H30BNO5 | 98.000 | CCOC(=O)C1CCCN(C1)C(=O)c1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 250mg | 714088916
Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl)piperidine-3-carboxylate | Ambeed | 850411-14-2 | MFCD06657751 | 387.280 | C21H30BNO5 | 98.000 | CCOC(=O)C1CCCN(C1)C(=O)c1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 250mg | 714088916
eMolecules 39514-19-7 | Ethyl 1-benzyl-3-oxo-piperidine-4-carboxylate | Ambeed | MFCD00044512 | 261.321 | C15H19NO3 | 95.000 | CCOC(=O)C1CCN(Cc2ccccc2)CC1=O | 1g | 527374857
Ethyl 1-benzyl-3-oxo-piperidine-4-carboxylate | Ambeed | 39514-19-7 | MFCD00044512 | 261.321 | C15H19NO3 | 95.000 | CCOC(=O)C1CCN(Cc2ccccc2)CC1=O | 1g | 527374857
eMolecules 1082503-77-2 | 2-Methyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propan-2-ol | Ambeed | MFCD22378011 | 266.150 | C13H23BN2O3 | 97.000 | CC(C)(O)Cn1cc(cn1)B1OC(C)(C)C(C)(C)O1 | 100mg | 552662088
2-Methyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propan-2-ol | Ambeed | 1082503-77-2 | MFCD22378011 | 266.150 | C13H23BN2O3 | 97.000 | CC(C)(O)Cn1cc(cn1)B1OC(C)(C)C(C)(C)O1 | 100mg | 552662088
eMolecules 670254-71-4 | Ambeed | (4S5R)-3-tert-Butyl 5-methyl 2-(4-methoxyphenyl)-4-phenyloxazolidine-35-dicarboxylate | 1g | 649269885 | A250950 | MFCD30475633 | 413.47 | C23H27NO6
Ambeed | (4S5R)-3-tert-Butyl 5-methyl 2-(4-methoxyphenyl)-4-phenyloxazolidine-35-dicarboxylate | 1g | 649269885 | A250950 | 670254-71-4 | MFCD30475633 | 413.470 | C23H27NO6
N[C@H]1CCc2ccccc2N(CC(O)=O)C1=O | 50mg | 552729483](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502425291.JPG-250.jpg)
eMolecules 86541-74-4 | Benazepril HCl | Ambeed | MFCD00895734 | 460.960 | C24H29ClN2O5 | 98.000 | Cl.CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCc2ccccc2N(CC(O)=O)C1=O | 50mg | 552729483
Benazepril HCl | Ambeed | 86541-74-4 | MFCD00895734 | 460.960 | C24H29ClN2O5 | 98.000 | Cl.CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCc2ccccc2N(CC(O)=O)C1=O | 50mg | 552729483
eMolecules 3939-01-3 | Methyl 1-Benzyl-4-oxo-3-piperidinecarboxylate HCl | Ambeed | MFCD00012799 | 283.750 | C14H18ClNO3 | 95.000 | Cl.COC(=O)C1CN(Cc2ccccc2)CCC1=O | 5g | 525022663
Methyl 1-Benzyl-4-oxo-3-piperidinecarboxylate HCl | Ambeed | 3939-01-3 | MFCD00012799 | 283.750 | C14H18ClNO3 | 95.000 | Cl.COC(=O)C1CN(Cc2ccccc2)CCC1=O | 5g | 525022663
AccuStandard, Inc BASE/NEUTRALS MIX 1 1X1ML
Base/Neutrals - Mix 1. 100 mL. 5000 �g/mL in 2-5% Nitric Acid.
Apexbio Technology LLC Aminothiazole 96-50-4 10g
Aminothiazole (96-50-4) is a small-molecule inhibitor targeting thyroid peroxidase It is designed to interfere with thyroid hormone biosynthesis thereby regulating thyroid hormone levels Aminothiazole exerts its biological activity primarily through inhibition of the thyroid peroxidase enzyme In in vitro studies aminothiazole demonstrates inhibitory activity with an IC50 value typically ranging from 1 to 10 M Based on these pharmacological properties aminothiazole holds research potential in the investigation of thyroid hormone regulatory mechanisms and pathologies such as hyperthyroidism as well as in antimicrobial screening assays
Apexbio Technology LLC Diclofenac 15307-86-5 10g
Diclofenac (CAS 15307-86-5) is a phenylacetic acid derivative classified as a non-steroidal anti-inflammatory drug (NSAID) It exerts its biological activity by inhibiting cyclooxygenase (COX)-1 and COX-2 enzymes thereby suppressing prostaglandin synthesis that mediates inflammation and pain signaling Structurally the incorporation of two ortho chlorine atoms on the phenyl ring increases molecular rigidity which has been associated with enhanced potency Diclofenac is widely used in research to study inflammatory pathways pain mechanisms and as a reference compound in the evaluation of cyclooxygenase inhibition and potential gastrointestinal protective strategies in combination therapies
Apexbio Technology LLC Clofibrate 637-07-0 10g
Clofibrate (CAS 637-07-0) is a small-molecule agonist targeting peroxisome proliferator-activated receptor alpha (PPAR-alpha) It is designed to activate PPAR-alpha thereby regulating lipid and lipoprotein metabolism pathways Clofibrate exerts its biological activity primarily through PPAR-alpha activation leading to enhanced peroxisome proliferation and fatty acid oxidation In both human and mouse models Clofibrate demonstrates agonist activity with EC50 values of 55 M and 500 M respectively Based on these pharmacological properties Clofibrate holds research potential in investigating lipid metabolism triglyceride regulation and the roles of PPAR-alpha signaling in hyperlipidemia and related metabolic disorders
Apexbio Technology LLC HYPERSCRIPT IV RTASE-10000mg
HyperScript IV Reverse Transcriptase is a pivotal enzyme in molecular biology research primarily used in the synthesis of complementary DNA (cDNA) from RNA templates Originating from retroviral sources this enzyme is crucial for studies involving gene expression analysis cloning and RNA sequencing It operates through a mechanism that reverses the transcription process effectively converting single-stranded RNA into stable cDNA Its activity is measured in the nanomolar to low micromolar range demonstrating high efficiency and reliability under in vitro conditions This enzyme is extensively applied in various experimental settings including cell models animal studies and high-throughput drug screening assays Experimental concentrations typically depend on the specific research design Using this advanced reverse transcriptase researchers can achieve precise and reproducible amplification of genetic material facilitating significant advancements in biomedical research
Cambridge Isotope Laboratories Fortified Cod Liver Oil Reference Material 10 g
Fortified Cod Liver Oil Reference Material 10 g