Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Acetic Acid, Glacial (USP/FCC), Fisher Chemical
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Trichloroacetic Acid (Crystalline/Certified ACS), Fisher Chemical™
CAS: 76-03-9 Molecular Formula: C2HCl3O2 Molecular Weight (g/mol): 163.378 MDL Number: MFCD00004177 InChI Key: YNJBWRMUSHSURL-UHFFFAOYSA-N Synonym: trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer PubChem CID: 6421 ChEBI: CHEBI:30956 IUPAC Name: 2,2,2-trichloroacetic acid SMILES: C(=O)(C(Cl)(Cl)Cl)O
| PubChem CID | 6421 |
|---|---|
| CAS | 76-03-9 |
| Molecular Weight (g/mol) | 163.378 |
| ChEBI | CHEBI:30956 |
| MDL Number | MFCD00004177 |
| SMILES | C(=O)(C(Cl)(Cl)Cl)O |
| Synonym | trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer |
| IUPAC Name | 2,2,2-trichloroacetic acid |
| InChI Key | YNJBWRMUSHSURL-UHFFFAOYSA-N |
| Molecular Formula | C2HCl3O2 |
Fisher Scientific Nitric Acid (NF), Fisher Chemical
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Fisher Scientific Picric Acid, Saturated (AOAC), Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7732-18-5 Molecular Formula: C6H3N3O7 Molecular Weight (g/mol): Mixture InChI Key: OXNIZHLAWKMVMX-UHFFFAOYSA-N Synonym: picric acid,trinitrophenol,carbazotic acid,picronitric acid,melinite,acide picrique,phenol trinitrate,picral,nitroxanthic acid,pikrinsaeure PubChem CID: 6954 ChEBI: CHEBI:46149 IUPAC Name: 2,4,6-trinitrophenol SMILES: C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]
| PubChem CID | 6954 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:46149 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-] |
| Synonym | picric acid,trinitrophenol,carbazotic acid,picronitric acid,melinite,acide picrique,phenol trinitrate,picral,nitroxanthic acid,pikrinsaeure |
| IUPAC Name | 2,4,6-trinitrophenol |
| InChI Key | OXNIZHLAWKMVMX-UHFFFAOYSA-N |
| Molecular Formula | C6H3N3O7 |
Ricca Chemical Company Acetic Acid, 10% v/v (1+9) (For AOAC Methods 925.24, 927.03), Fisher Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7732-18-5 Molecular Formula: C2H4O2 Molecular Weight (g/mol): Mixture MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Sulfurous Acid (Certified ACS), Fisher Chemical
CAS: 7782-99-2 Molecular Formula: H2O3S Molecular Weight (g/mol): 82.073 MDL Number: MFCD00011335 InChI Key: LSNNMFCWUKXFEE-UHFFFAOYSA-N Synonym: sulphurous acid,sulfur dioxide solution,schweflige saure german,h2so3,unii-j1p7893f4j,schweflige saure,acide sulfureux,acido sulfuroso,schweflige saeure,trioxosulfuric acid PubChem CID: 1100 ChEBI: CHEBI:48854 IUPAC Name: sulfurous acid SMILES: OS(=O)O
| PubChem CID | 1100 |
|---|---|
| CAS | 7782-99-2 |
| Molecular Weight (g/mol) | 82.073 |
| ChEBI | CHEBI:48854 |
| MDL Number | MFCD00011335 |
| SMILES | OS(=O)O |
| Synonym | sulphurous acid,sulfur dioxide solution,schweflige saure german,h2so3,unii-j1p7893f4j,schweflige saure,acide sulfureux,acido sulfuroso,schweflige saeure,trioxosulfuric acid |
| IUPAC Name | sulfurous acid |
| InChI Key | LSNNMFCWUKXFEE-UHFFFAOYSA-N |
| Molecular Formula | H2O3S |
DL-Malic acid, 99+%
CAS: 6915-15-7 Molecular Formula: C4H6O5 Molecular Weight (g/mol): 134.087 MDL Number: MFCD00064212 InChI Key: BJEPYKJPYRNKOW-UHFFFAOYSA-N Synonym: malic acid,dl-malic acid,2-hydroxysuccinic acid,malate,hydroxysuccinic acid,butanedioic acid, hydroxy,kyselina jablecna,pomalus acid,hydroxybutanedioic acid,deoxytetraric acid PubChem CID: 525 ChEBI: CHEBI:6650 IUPAC Name: 2-hydroxybutanedioic acid SMILES: C(C(C(=O)O)O)C(=O)O
| PubChem CID | 525 |
|---|---|
| CAS | 6915-15-7 |
| Molecular Weight (g/mol) | 134.087 |
| ChEBI | CHEBI:6650 |
| MDL Number | MFCD00064212 |
| SMILES | C(C(C(=O)O)O)C(=O)O |
| Synonym | malic acid,dl-malic acid,2-hydroxysuccinic acid,malate,hydroxysuccinic acid,butanedioic acid, hydroxy,kyselina jablecna,pomalus acid,hydroxybutanedioic acid,deoxytetraric acid |
| IUPAC Name | 2-hydroxybutanedioic acid |
| InChI Key | BJEPYKJPYRNKOW-UHFFFAOYSA-N |
| Molecular Formula | C4H6O5 |
Acetic Acid (100%, Glacial), Anhydrous, EMSURE™ MilliporeSigma™
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Hydrochloric Acid, c(HCl)=0.1 mol/L (0.1N) Titripur™, MilliporeSigma™
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: Hydrogen chloride solution,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | Hydrogen chloride solution,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Benzoic acid, ACS, 99.5% min
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00002398 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC Name: benzoic acid SMILES: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| CAS | 65-85-0 |
| Molecular Weight (g/mol) | 122.123 |
| ChEBI | CHEBI:30746 |
| MDL Number | MFCD00002398 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Hydrochloric acid, 99.999% (metals basis), 36.5% min
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: chlorane SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | chlorane |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Tannic acid, ACS reagent
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Reserpine, 99%, Thermo Scientific Chemicals
CAS: 50-55-5 Molecular Formula: C33H40N2O9 Molecular Weight (g/mol): 608.688 MDL Number: MFCD00005091 InChI Key: QEVHRUUCFGRFIF-MDEJGZGSSA-N Synonym: reserpine,serpalan,serpasil,serpivite,apoplon,deserpine,elserpine,hiserpia,hypersil,raunervil PubChem CID: 5770 ChEBI: CHEBI:28487 IUPAC Name: methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate SMILES: COC1C(CC2CN3CCC4=C(C3CC2C1C(=O)OC)NC5=C4C=CC(=C5)OC)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC
| PubChem CID | 5770 |
|---|---|
| CAS | 50-55-5 |
| Molecular Weight (g/mol) | 608.688 |
| ChEBI | CHEBI:28487 |
| MDL Number | MFCD00005091 |
| SMILES | COC1C(CC2CN3CCC4=C(C3CC2C1C(=O)OC)NC5=C4C=CC(=C5)OC)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC |
| Synonym | reserpine,serpalan,serpasil,serpivite,apoplon,deserpine,elserpine,hiserpia,hypersil,raunervil |
| IUPAC Name | methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate |
| InChI Key | QEVHRUUCFGRFIF-MDEJGZGSSA-N |
| Molecular Formula | C33H40N2O9 |
Ricca Chemical Company Acetic Acid, 1% (v/v), Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7732-18-5 Molecular Formula: C2H4O2 Molecular Weight (g/mol): Mixture MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Sulfuric acid, ACS reagent, 95% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |