Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Sulfuric Acid, ACS Reagent Grade, Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Nitric acid, ACS, 68.0-70.0%, Thermo Scientific Chemicals
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Phosphorous acid, 98+%
CAS: 13598-36-2 Molecular Formula: H3PO3 MDL Number: MFCD00137258 Synonym: Phosphonic acid
| CAS | 13598-36-2 |
|---|---|
| MDL Number | MFCD00137258 |
| Synonym | Phosphonic acid |
| Molecular Formula | H3PO3 |
LabChem, Inc. Hydrochloric Acid, in Isopropanol, Certified, 0.1000N ±0.0010N (0.1M), LabChem™
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Sulfurous acid, ACS, 6.0% SO{2} min
CAS: 7782-99-2 Molecular Formula: H2O3S Molecular Weight (g/mol): 82.073 MDL Number: MFCD00011335 InChI Key: LSNNMFCWUKXFEE-UHFFFAOYSA-N Synonym: sulphurous acid,sulfur dioxide solution,schweflige saure german,h2so3,unii-j1p7893f4j,schweflige saure,acide sulfureux,acido sulfuroso,schweflige saeure,trioxosulfuric acid PubChem CID: 1100 ChEBI: CHEBI:48854 IUPAC Name: sulfurous acid SMILES: OS(=O)O
| PubChem CID | 1100 |
|---|---|
| CAS | 7782-99-2 |
| Molecular Weight (g/mol) | 82.073 |
| ChEBI | CHEBI:48854 |
| MDL Number | MFCD00011335 |
| SMILES | OS(=O)O |
| Synonym | sulphurous acid,sulfur dioxide solution,schweflige saure german,h2so3,unii-j1p7893f4j,schweflige saure,acide sulfureux,acido sulfuroso,schweflige saeure,trioxosulfuric acid |
| IUPAC Name | sulfurous acid |
| InChI Key | LSNNMFCWUKXFEE-UHFFFAOYSA-N |
| Molecular Formula | H2O3S |
Hydrochloric Acid, 5.00 N, Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7732-18-5 Molecular Formula: ClH MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7732-18-5 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Thermo Scientific Chemicals Valeric Acid, 99%
CAS: 109-52-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00004413 InChI Key: NQPDZGIKBAWPEJ-UHFFFAOYSA-N Synonym: valeric acid,n-valeric acid,n-pentanoic acid,valerianic acid,1-butanecarboxylic acid,propylacetic acid,butanecarboxylic acid,pentoic acid,kyselina valerova,valeric acid, n PubChem CID: 7991 ChEBI: CHEBI:17418 IUPAC Name: pentanoic acid SMILES: CCCCC(=O)O
| PubChem CID | 7991 |
|---|---|
| CAS | 109-52-4 |
| Molecular Weight (g/mol) | 102.133 |
| ChEBI | CHEBI:17418 |
| MDL Number | MFCD00004413 |
| SMILES | CCCCC(=O)O |
| Synonym | valeric acid,n-valeric acid,n-pentanoic acid,valerianic acid,1-butanecarboxylic acid,propylacetic acid,butanecarboxylic acid,pentoic acid,kyselina valerova,valeric acid, n |
| IUPAC Name | pentanoic acid |
| InChI Key | NQPDZGIKBAWPEJ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Trichloroacetic acid, 99+%, ACS reagent
CAS: 76-03-9 Molecular Formula: C2HCl3O2 Molecular Weight (g/mol): 163.378 MDL Number: MFCD00004177 InChI Key: YNJBWRMUSHSURL-UHFFFAOYSA-N Synonym: trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer PubChem CID: 6421 ChEBI: CHEBI:30956 IUPAC Name: 2,2,2-trichloroacetic acid SMILES: C(=O)(C(Cl)(Cl)Cl)O
| PubChem CID | 6421 |
|---|---|
| CAS | 76-03-9 |
| Molecular Weight (g/mol) | 163.378 |
| ChEBI | CHEBI:30956 |
| MDL Number | MFCD00004177 |
| SMILES | C(=O)(C(Cl)(Cl)Cl)O |
| Synonym | trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer |
| IUPAC Name | 2,2,2-trichloroacetic acid |
| InChI Key | YNJBWRMUSHSURL-UHFFFAOYSA-N |
| Molecular Formula | C2HCl3O2 |
Tannic acid, 95%
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
p-Toluenesulfonic acid monohydrate, 99%, extra pure
CAS: 6192-52-5 Molecular Formula: C7H10O4S Molecular Weight (g/mol): 190.213 MDL Number: MFCD00142137 InChI Key: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC Name: 4-methylbenzenesulfonic acid;hydrate SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O
| PubChem CID | 521998 |
|---|---|
| CAS | 6192-52-5 |
| Molecular Weight (g/mol) | 190.213 |
| MDL Number | MFCD00142137 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
| Synonym | p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate |
| IUPAC Name | 4-methylbenzenesulfonic acid;hydrate |
| InChI Key | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| Molecular Formula | C7H10O4S |
Ricca Chemical Company Phosphoric Acid, ACS Reagent Grade, Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7664-38-2 Molecular Formula: H3O4P InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| ChEBI | CHEBI:26078 |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Succinic acid, ACS reagent
CAS: 110-15-6 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00002789 InChI Key: KDYFGRWQOYBRFD-UHFFFAOYSA-N Synonym: succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid PubChem CID: 1110 ChEBI: CHEBI:15741 IUPAC Name: butanedioic acid SMILES: OC(=O)CCC(O)=O
| PubChem CID | 1110 |
|---|---|
| CAS | 110-15-6 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:15741 |
| MDL Number | MFCD00002789 |
| SMILES | OC(=O)CCC(O)=O |
| Synonym | succinic acid,amber acid,asuccin,dihydrofumaric acid,bernsteinsaure,katasuccin,wormwood acid,succinate,ethylenesuccinic acid,1,2-ethanedicarboxylic acid |
| IUPAC Name | butanedioic acid |
| InChI Key | KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
| CAS | 2217-02-9 |
|---|---|
| MDL Number | MFCD00003760 |
L-(+)-Lactic acid, ca 85-90% aq. soln.
CAS: 79-33-4 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.078 MDL Number: MFCD00064266 InChI Key: JVTAAEKCZFNVCJ-REOHCLBHSA-N Synonym: l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,#NAME?,espiritin,tisulac PubChem CID: 107689 ChEBI: CHEBI:422 IUPAC Name: (2S)-2-hydroxypropanoic acid SMILES: CC(C(=O)O)O
| PubChem CID | 107689 |
|---|---|
| CAS | 79-33-4 |
| Molecular Weight (g/mol) | 90.078 |
| ChEBI | CHEBI:422 |
| MDL Number | MFCD00064266 |
| SMILES | CC(C(=O)O)O |
| Synonym | l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,#NAME?,espiritin,tisulac |
| IUPAC Name | (2S)-2-hydroxypropanoic acid |
| InChI Key | JVTAAEKCZFNVCJ-REOHCLBHSA-N |
| Molecular Formula | C3H6O3 |
Trifluoroacetic Acid, HPLC, 99.9% min., MilliporeSigma™
CAS: 76-05-1 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 114.02 MDL Number: MFCD00004169 InChI Key: DTQVDTLACAAQTR-UHFFFAOYSA-N Synonym: trifluoroacetic acid,perfluoroacetic acid,trifluoroethanoic acid,trifluoroacetic acid,acetic acid, trifluoro,trifluoroaceticacid,cf3cooh,trifluoro acetic acid,trifluoro-acetic acid,kyselina trifluoroctova PubChem CID: 6422 ChEBI: CHEBI:45892 IUPAC Name: trifluoroacetic acid SMILES: OC(=O)C(F)(F)F
| PubChem CID | 6422 |
|---|---|
| CAS | 76-05-1 |
| Molecular Weight (g/mol) | 114.02 |
| ChEBI | CHEBI:45892 |
| MDL Number | MFCD00004169 |
| SMILES | OC(=O)C(F)(F)F |
| Synonym | trifluoroacetic acid,perfluoroacetic acid,trifluoroethanoic acid,trifluoroacetic acid,acetic acid, trifluoro,trifluoroaceticacid,cf3cooh,trifluoro acetic acid,trifluoro-acetic acid,kyselina trifluoroctova |
| IUPAC Name | trifluoroacetic acid |
| InChI Key | DTQVDTLACAAQTR-UHFFFAOYSA-N |
| Molecular Formula | C2HF3O2 |