Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Oxalic acid, anhydrous, 98%
CAS: 144-62-7 Molecular Formula: C2H2O4 Molecular Weight (g/mol): 90.034 MDL Number: MFCD00002573 InChI Key: MUBZPKHOEPUJKR-UHFFFAOYSA-N Synonym: ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico PubChem CID: 971 ChEBI: CHEBI:16995 IUPAC Name: oxalic acid SMILES: C(=O)(C(=O)O)O
| PubChem CID | 971 |
|---|---|
| CAS | 144-62-7 |
| Molecular Weight (g/mol) | 90.034 |
| ChEBI | CHEBI:16995 |
| MDL Number | MFCD00002573 |
| SMILES | C(=O)(C(=O)O)O |
| Synonym | ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico |
| IUPAC Name | oxalic acid |
| InChI Key | MUBZPKHOEPUJKR-UHFFFAOYSA-N |
| Molecular Formula | C2H2O4 |
Phosphotungstic acid hydrate
CAS: 12067-99-1 MDL Number: MFCD00041964 Synonym: Tungstophosphoric acid
| CAS | 12067-99-1 |
|---|---|
| MDL Number | MFCD00041964 |
| Synonym | Tungstophosphoric acid |
Hydrochloric acid, for analysis, fuming, 37% solution in water
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Acetic acid, ammonium salt, 98+%, for analysis
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 MDL Number: MFCD00013066 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| MDL Number | MFCD00013066 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
p-Toluenesulfonic Acid Monohydrate 98.0+%, TCI America™
CAS: 6192-52-5 Molecular Formula: C7H10O4S Molecular Weight (g/mol): 190.213 MDL Number: MFCD00064387 InChI Key: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC Name: 4-methylbenzenesulfonic acid;hydrate SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O
| PubChem CID | 521998 |
|---|---|
| CAS | 6192-52-5 |
| Molecular Weight (g/mol) | 190.213 |
| MDL Number | MFCD00064387 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
| Synonym | p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate |
| IUPAC Name | 4-methylbenzenesulfonic acid;hydrate |
| InChI Key | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| Molecular Formula | C7H10O4S |
L(+)-Tartaric acid, disodium salt, dihydrate, 99+%, ACS reagent
CAS: 6106-24-7 Molecular Formula: C4H8Na2O8 Molecular Weight (g/mol): 230.08 MDL Number: MFCD00150035 InChI Key: FGJLAJMGHXGFDE-UDMGOBQRNA-L Synonym: unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi PubChem CID: 131855972 SMILES: O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| PubChem CID | 131855972 |
|---|---|
| CAS | 6106-24-7 |
| Molecular Weight (g/mol) | 230.08 |
| MDL Number | MFCD00150035 |
| SMILES | O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| Synonym | unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi |
| InChI Key | FGJLAJMGHXGFDE-UDMGOBQRNA-L |
| Molecular Formula | C4H8Na2O8 |
Hydrochloric Acid,OmniPure™ MilliporeSigma™
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Butyric Acid 99.0+%, TCI America™
CAS: 107-92-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 MDL Number: MFCD00002814 InChI Key: FERIUCNNQQJTOY-UHFFFAOYSA-N Synonym: butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure PubChem CID: 264 ChEBI: CHEBI:30772 IUPAC Name: butanoic acid SMILES: CCCC(O)=O
| PubChem CID | 264 |
|---|---|
| CAS | 107-92-6 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:30772 |
| MDL Number | MFCD00002814 |
| SMILES | CCCC(O)=O |
| Synonym | butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure |
| IUPAC Name | butanoic acid |
| InChI Key | FERIUCNNQQJTOY-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Acetic Acid, 1% (v/v), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: C2H4O2 Molecular Weight (g/mol): Mixture MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
L-Lactic Acid (Free Acid), MP Biomedicals™
CAS: 79-33-4 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.078 MDL Number: MFCD00064266 InChI Key: JVTAAEKCZFNVCJ-REOHCLBHSA-N Synonym: l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,+-lactic acid,espiritin,tisulac PubChem CID: 107689 ChEBI: CHEBI:422 IUPAC Name: (2S)-2-hydroxypropanoic acid SMILES: CC(C(=O)O)O
| PubChem CID | 107689 |
|---|---|
| CAS | 79-33-4 |
| Molecular Weight (g/mol) | 90.078 |
| ChEBI | CHEBI:422 |
| MDL Number | MFCD00064266 |
| SMILES | CC(C(=O)O)O |
| Synonym | l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,+-lactic acid,espiritin,tisulac |
| IUPAC Name | (2S)-2-hydroxypropanoic acid |
| InChI Key | JVTAAEKCZFNVCJ-REOHCLBHSA-N |
| Molecular Formula | C3H6O3 |
Polyphosphoric acid, ca 84% (as phosphorus pentoxide)
CAS: 8017-16-1 Molecular Formula: (HO3P)n MDL Number: MFCD00084480 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N IUPAC Name: Polyphosphoric acid SMILES: [H]OP(O)(O)=O
| CAS | 8017-16-1 |
|---|---|
| MDL Number | MFCD00084480 |
| SMILES | [H]OP(O)(O)=O |
| IUPAC Name | Polyphosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | (HO3P)n |
Tannic acid, 95%
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Phosphotungstic acid hydrate
CAS: 12501-23-4 Molecular Formula: H5O41PW12 Molecular Weight (g/mol): 2880.20 MDL Number: MFCD00011342 InChI Key: AVFBYUADVDVJQL-UHFFFAOYSA-N Synonym: phosphotungstic acid hydrate,tungstophosphoric acid,12-tungstophosphoric acid hydrate,phosphoric acid dodecakis tungsten trioxide hydrate,iuaxea,aronis24073,phosphotungstic acid hydrate, reagent grade,phosphotungstic acid hydrate, for microscopy,phosphotungstic acid hydrate, p.a,phosphotungstic acid hydrate, saj special grade PubChem CID: 16212977 SMILES: O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O
| PubChem CID | 16212977 |
|---|---|
| CAS | 12501-23-4 |
| Molecular Weight (g/mol) | 2880.20 |
| MDL Number | MFCD00011342 |
| SMILES | O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O |
| Synonym | phosphotungstic acid hydrate,tungstophosphoric acid,12-tungstophosphoric acid hydrate,phosphoric acid dodecakis tungsten trioxide hydrate,iuaxea,aronis24073,phosphotungstic acid hydrate, reagent grade,phosphotungstic acid hydrate, for microscopy,phosphotungstic acid hydrate, p.a,phosphotungstic acid hydrate, saj special grade |
| InChI Key | AVFBYUADVDVJQL-UHFFFAOYSA-N |
| Molecular Formula | H5O41PW12 |
| Molecular Weight (g/mol) | 100.45 |
|---|---|
| ChEBI | CHEBI:29221 |
| UN Number | 2920 |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Density | 1.0600g/mL |
| PubChem CID | 24247 |
| Name Note | 0.1 M Solution in Acetic Acid |
| Fieser | 01,796; 02,309; 03,220; 06,453; 09,279; 11,402 |
| Formula Weight | 100.46 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Perchloric acid |
| Grade | Pure |
| SMILES | O[Cl](=O)(=O)=O |
| Merck Index | 15, 7267 |
| CAS | 64-19-7 |
| Health Hazard 3 | GHS P Statement: Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. IF ON SKIN: Wash with plenty of soap and water. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011325 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Flammable liquid and vapor. |
| Solubility Information | Solubility in water: insoluble. |
| Flash Point | 40°C |
| Packaging | Plastic Bottle |
| Health Hazard 1 | Danger |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| Molecular Formula | ClHO4 |
| Specific Gravity | 1.06 |