Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
p-Toluenesulfonic acid monohydrate, 97%
CAS: 6192-52-5 Molecular Formula: C7H10O4S Molecular Weight (g/mol): 190.213 MDL Number: MFCD00142137 InChI Key: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC Name: 4-methylbenzenesulfonic acid;hydrate SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O
| PubChem CID | 521998 |
|---|---|
| CAS | 6192-52-5 |
| Molecular Weight (g/mol) | 190.213 |
| MDL Number | MFCD00142137 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
| Synonym | p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate |
| IUPAC Name | 4-methylbenzenesulfonic acid;hydrate |
| InChI Key | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| Molecular Formula | C7H10O4S |
| CAS | 1415-93-6 |
|---|---|
| MDL Number | MFCD00147177 |
Boric acid, Electrophoresis Grade, 99.5% min
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Phosphorous acid, 98%, extra pure
CAS: 13598-36-2 Molecular Formula: H3O3P MDL Number: MFCD00137258 Synonym: Orthophosphorous acid
| CAS | 13598-36-2 |
|---|---|
| MDL Number | MFCD00137258 |
| Synonym | Orthophosphorous acid |
| Molecular Formula | H3O3P |
Sulfuric acid, 95-97%, EMSURE™ MilliporeSigma™
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Sulfuric acid, 5% v/v aq. soln.
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Formic acid, ACS, 88+%
CAS: 64-18-6 Molecular Formula: CH2O2 Molecular Weight (g/mol): 46.025 MDL Number: MFCD00003297 InChI Key: BDAGIHXWWSANSR-UHFFFAOYSA-N Synonym: methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt PubChem CID: 284 ChEBI: CHEBI:30751 IUPAC Name: formic acid SMILES: C(=O)O
| PubChem CID | 284 |
|---|---|
| CAS | 64-18-6 |
| Molecular Weight (g/mol) | 46.025 |
| ChEBI | CHEBI:30751 |
| MDL Number | MFCD00003297 |
| SMILES | C(=O)O |
| Synonym | methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt |
| IUPAC Name | formic acid |
| InChI Key | BDAGIHXWWSANSR-UHFFFAOYSA-N |
| Molecular Formula | CH2O2 |
Acetic acid, sodium salt, 99+%, for molecular biology, anhydrous, DNAse, RNAse and Protease free
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Acetic acid, ammonium salt, 98+%, for analysis
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 MDL Number: MFCD00013066 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| MDL Number | MFCD00013066 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Nitric acid, extra pure, 60% solution in water, Thermo Scientific Chemicals
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
| Linear Formula | H3[P(Mo3O10)4] |
|---|---|
| Molecular Weight (g/mol) | 1825.40 |
| Color | Green to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Phosphomolybdic acid |
| SMILES | [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].OP(O)(O)=O |
| Merck Index | 13, 7428 |
| InChI Key | FEFSFHGZSNHJEL-UHFFFAOYSA-N |
| Density | 0.9400 g/mL |
| Name Note | 20 wt% solution in ethanol |
| Percent Purity | 19 to 21% |
| CAS | 64-17-5 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00149913 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Highly flammable liquid and vapor. |
| Flash Point | 5°C |
| Packaging | Plastic Bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Molybdophosphoric acid |
| IUPAC Name | phosphoric acid dodecamolybdenum hexatriacontaoxidandiide |
| Molecular Formula | H3Mo12O40P |
| Formula Weight | 1825.25 |
| Specific Gravity | 94% |
Hydrobromic acid, 99.9999% (metals basis), 48% w/w aq. soln.
CAS: 10035-10-6 Molecular Formula: BrH Molecular Weight (g/mol): 80.91 MDL Number: MFCD00011323 InChI Key: CPELXLSAUQHCOX-UHFFFAOYSA-N Synonym: hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide PubChem CID: 260 ChEBI: CHEBI:47266 SMILES: Br
| PubChem CID | 260 |
|---|---|
| CAS | 10035-10-6 |
| Molecular Weight (g/mol) | 80.91 |
| ChEBI | CHEBI:47266 |
| MDL Number | MFCD00011323 |
| SMILES | Br |
| Synonym | hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide |
| InChI Key | CPELXLSAUQHCOX-UHFFFAOYSA-N |
| Molecular Formula | BrH |
Thermo Scientific Chemicals Trifluoroacetic acid, biochemical grade, 99.5+%
CAS: 76-05-1 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 114.02 MDL Number: MFCD00004169 InChI Key: DTQVDTLACAAQTR-UHFFFAOYSA-N Synonym: trifluoroacetic acid,perfluoroacetic acid,trifluoroethanoic acid,trifluoroacetic acid,acetic acid, trifluoro,trifluoroaceticacid,cf3cooh,trifluoro acetic acid,trifluoro-acetic acid,kyselina trifluoroctova PubChem CID: 6422 ChEBI: CHEBI:45892 IUPAC Name: trifluoroacetic acid SMILES: OC(=O)C(F)(F)F
| PubChem CID | 6422 |
|---|---|
| CAS | 76-05-1 |
| Molecular Weight (g/mol) | 114.02 |
| ChEBI | CHEBI:45892 |
| MDL Number | MFCD00004169 |
| SMILES | OC(=O)C(F)(F)F |
| Synonym | trifluoroacetic acid,perfluoroacetic acid,trifluoroethanoic acid,trifluoroacetic acid,acetic acid, trifluoro,trifluoroaceticacid,cf3cooh,trifluoro acetic acid,trifluoro-acetic acid,kyselina trifluoroctova |
| IUPAC Name | trifluoroacetic acid |
| InChI Key | DTQVDTLACAAQTR-UHFFFAOYSA-N |
| Molecular Formula | C2HF3O2 |
Abietic acid, 85%
CAS: 514-10-3 Molecular Formula: C20H30O2 Molecular Weight (g/mol): 302.46 MDL Number: MFCD03423567 InChI Key: RSWGJHLUYNHPMX-ONCXSQPRSA-N Synonym: abietic acid,sylvic acid,abietate,l-abietic acid,rosin acid,7,13-abietadien-18-oic acid,kyselina abietova,kyselina abietova czech,unii-v3dhx33184,ccris 3183 PubChem CID: 10569 ChEBI: CHEBI:28987 IUPAC Name: (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid SMILES: CC(C)C1=CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(O)=O)[C@H]2CC1
| PubChem CID | 10569 |
|---|---|
| CAS | 514-10-3 |
| Molecular Weight (g/mol) | 302.46 |
| ChEBI | CHEBI:28987 |
| MDL Number | MFCD03423567 |
| SMILES | CC(C)C1=CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(O)=O)[C@H]2CC1 |
| Synonym | abietic acid,sylvic acid,abietate,l-abietic acid,rosin acid,7,13-abietadien-18-oic acid,kyselina abietova,kyselina abietova czech,unii-v3dhx33184,ccris 3183 |
| IUPAC Name | (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid |
| InChI Key | RSWGJHLUYNHPMX-ONCXSQPRSA-N |
| Molecular Formula | C20H30O2 |
| CAS | 7664-38-2 |
|---|---|
| Molecular Weight (g/mol) | 98 g/mol |