Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Spectrum Chemical Manufacturing Corporation Diethylenetriaminepentaacetic Acid, Pentasodium Salt, 41% Solution in Water, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 140-01-2 Molecular Formula: C14H18N3Na5O10 Molecular Weight (g/mol): 503.26 MDL Number: MFCD00051016 InChI Key: LQPLDXQVILYOOL-UHFFFAOYSA-I IUPAC Name: pentasodium 2-[bis({2-[bis(carboxylatomethyl)amino]ethyl})amino]acetate SMILES: [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O
| CAS | 140-01-2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| MDL Number | MFCD00051016 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| IUPAC Name | pentasodium 2-[bis({2-[bis(carboxylatomethyl)amino]ethyl})amino]acetate |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Molecular Formula | C14H18N3Na5O10 |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Caffeic Acid 98.0+%, TCI America™
CAS: 331-39-5 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.159 MDL Number: MFCD00004392 InChI Key: QAIPRVGONGVQAS-DUXPYHPUSA-N Synonym: caffeic acid,3,4-dihydroxycinnamic acid,3-3,4-dihydroxyphenyl acrylic acid,trans-caffeate,3,4-dihydroxy-trans-cinnamate,2e-3-3,4-dihydroxyphenyl prop-2-enoic acid,3,4-dihydroxybenzeneacrylic acid,e-3-3,4-dihydroxyphenyl acrylic acid,trans-caffeic acid,3-3,4-dihydroxyphenyl propenoic acid PubChem CID: 689043 ChEBI: CHEBI:16433 IUPAC Name: (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid SMILES: C1=CC(=C(C=C1C=CC(=O)O)O)O
| PubChem CID | 689043 |
|---|---|
| CAS | 331-39-5 |
| Molecular Weight (g/mol) | 180.159 |
| ChEBI | CHEBI:16433 |
| MDL Number | MFCD00004392 |
| SMILES | C1=CC(=C(C=C1C=CC(=O)O)O)O |
| Synonym | caffeic acid,3,4-dihydroxycinnamic acid,3-3,4-dihydroxyphenyl acrylic acid,trans-caffeate,3,4-dihydroxy-trans-cinnamate,2e-3-3,4-dihydroxyphenyl prop-2-enoic acid,3,4-dihydroxybenzeneacrylic acid,e-3-3,4-dihydroxyphenyl acrylic acid,trans-caffeic acid,3-3,4-dihydroxyphenyl propenoic acid |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| InChI Key | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| Molecular Formula | C9H8O4 |
3,4-Dimethylbenzophenone 98.0+%, TCI America™
CAS: 2571-39-3 Molecular Formula: C15H14O Molecular Weight (g/mol): 210.28 MDL Number: MFCD00008525 InChI Key: JENOLWCGNVWTJN-UHFFFAOYSA-N Synonym: 3,4-dimethylbenzophenone,3,4-dimethylphenyl phenyl methanone,methanone, 3,4-dimethylphenyl phenyl,3,4-dimethylphenyl-phenylmethanone,3,4-dimethylphenyl phenyl ketone,acmc-1cbaf,3,4-dimethyl-benzophenone,ksc490c7t,benzophenone, 3,4-dimethyl PubChem CID: 75730 IUPAC Name: (3,4-dimethylphenyl)(phenyl)methanone SMILES: CC1=CC=C(C=C1C)C(=O)C1=CC=CC=C1
| PubChem CID | 75730 |
|---|---|
| CAS | 2571-39-3 |
| Molecular Weight (g/mol) | 210.28 |
| MDL Number | MFCD00008525 |
| SMILES | CC1=CC=C(C=C1C)C(=O)C1=CC=CC=C1 |
| Synonym | 3,4-dimethylbenzophenone,3,4-dimethylphenyl phenyl methanone,methanone, 3,4-dimethylphenyl phenyl,3,4-dimethylphenyl-phenylmethanone,3,4-dimethylphenyl phenyl ketone,acmc-1cbaf,3,4-dimethyl-benzophenone,ksc490c7t,benzophenone, 3,4-dimethyl |
| IUPAC Name | (3,4-dimethylphenyl)(phenyl)methanone |
| InChI Key | JENOLWCGNVWTJN-UHFFFAOYSA-N |
| Molecular Formula | C15H14O |
Decafluorobenzophenone 98.0+%, TCI America™
CAS: 853-39-4 Molecular Formula: C13F10O Molecular Weight (g/mol): 362.126 MDL Number: MFCD00000295 InChI Key: WWQLXRAKBJVNCC-UHFFFAOYSA-N Synonym: decafluorobenzophenone,benzophenone, decafluoro,perfluorobenzophenone,methanone, bis pentafluorophenyl,bis perfluorophenyl methanone,bis pentafluorophenyl methanone,bis 2,3,4,5,6-pentafluorophenyl methanone,di2,3,4,5,6-pentafluorophenyl ketone,acmc-209q5n PubChem CID: 70068 IUPAC Name: bis(2,3,4,5,6-pentafluorophenyl)methanone SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C2=C(C(=C(C(=C2F)F)F)F)F
| PubChem CID | 70068 |
|---|---|
| CAS | 853-39-4 |
| Molecular Weight (g/mol) | 362.126 |
| MDL Number | MFCD00000295 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C2=C(C(=C(C(=C2F)F)F)F)F |
| Synonym | decafluorobenzophenone,benzophenone, decafluoro,perfluorobenzophenone,methanone, bis pentafluorophenyl,bis perfluorophenyl methanone,bis pentafluorophenyl methanone,bis 2,3,4,5,6-pentafluorophenyl methanone,di2,3,4,5,6-pentafluorophenyl ketone,acmc-209q5n |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)methanone |
| InChI Key | WWQLXRAKBJVNCC-UHFFFAOYSA-N |
| Molecular Formula | C13F10O |
4-Hydroxyphenylpyruvic Acid 95.0+%, TCI America™
CAS: 156-39-8 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.159 MDL Number: MFCD00002591 InChI Key: KKADPXVIOXHVKN-UHFFFAOYSA-N Synonym: 4-hydroxyphenylpyruvic acid,testacid,3-4-hydroxyphenyl-2-oxopropanoic acid,p-hydroxyphenylpyruvic acid,testacide,4-hydroxyphenylpyruvate,3-4-hydroxyphenyl pyruvic acid,p-hydroxyphenyl pyruvic acid,3-p-hydroxyphenyl pyruvic acid,3-p-hydroxyphenyl-2-oxopropanoic acid PubChem CID: 979 ChEBI: CHEBI:15999 IUPAC Name: 3-(4-hydroxyphenyl)-2-oxopropanoic acid SMILES: C1=CC(=CC=C1CC(=O)C(=O)O)O
| PubChem CID | 979 |
|---|---|
| CAS | 156-39-8 |
| Molecular Weight (g/mol) | 180.159 |
| ChEBI | CHEBI:15999 |
| MDL Number | MFCD00002591 |
| SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)O |
| Synonym | 4-hydroxyphenylpyruvic acid,testacid,3-4-hydroxyphenyl-2-oxopropanoic acid,p-hydroxyphenylpyruvic acid,testacide,4-hydroxyphenylpyruvate,3-4-hydroxyphenyl pyruvic acid,p-hydroxyphenyl pyruvic acid,3-p-hydroxyphenyl pyruvic acid,3-p-hydroxyphenyl-2-oxopropanoic acid |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid |
| InChI Key | KKADPXVIOXHVKN-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
4-Methylcinnamic Acid 98.0+%, TCI America™
CAS: 1866-39-3 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.188 MDL Number: MFCD00002697 InChI Key: RURHILYUWQEGOS-VOTSOKGWSA-N Synonym: 4-methylcinnamic acid,3-p-tolyl acrylic acid,e-3-p-tolyl acrylic acid,p-methylcinnamic acid,p-methyl cinnamic acid,2e-3-4-methylphenyl acrylic acid,2e-3-4-methylphenyl prop-2-enoic acid,4-methyl-cinnamic acid,e-3-4-methylphenyl-2-propenoic acid,3-4-methylphenyl-2-propenoic acid PubChem CID: 731767 IUPAC Name: (E)-3-(4-methylphenyl)prop-2-enoic acid SMILES: CC1=CC=C(C=C1)C=CC(=O)O
| PubChem CID | 731767 |
|---|---|
| CAS | 1866-39-3 |
| Molecular Weight (g/mol) | 162.188 |
| MDL Number | MFCD00002697 |
| SMILES | CC1=CC=C(C=C1)C=CC(=O)O |
| Synonym | 4-methylcinnamic acid,3-p-tolyl acrylic acid,e-3-p-tolyl acrylic acid,p-methylcinnamic acid,p-methyl cinnamic acid,2e-3-4-methylphenyl acrylic acid,2e-3-4-methylphenyl prop-2-enoic acid,4-methyl-cinnamic acid,e-3-4-methylphenyl-2-propenoic acid,3-4-methylphenyl-2-propenoic acid |
| IUPAC Name | (E)-3-(4-methylphenyl)prop-2-enoic acid |
| InChI Key | RURHILYUWQEGOS-VOTSOKGWSA-N |
| Molecular Formula | C10H10O2 |
3,5-Difluoroaniline 98.0+%, TCI America™
CAS: 372-39-4 Molecular Formula: C6H5F2N Molecular Weight (g/mol): 129.11 MDL Number: MFCD00007763 InChI Key: KQOIBXZRCYFZSO-UHFFFAOYSA-N Synonym: benzenamine, 3,5-difluoro,3,5-difluorobenzenamine,3,5-difluorophenylamine,5an,3,5-difluoranilin,3,5-difluoroanilin,3,5 difluoroaniline,3.5-difluoroaniline,pubchem2296,3, 5-difluoroaniline PubChem CID: 96595 IUPAC Name: 3,5-difluoroaniline SMILES: C1=C(C=C(C=C1F)F)N
| PubChem CID | 96595 |
|---|---|
| CAS | 372-39-4 |
| Molecular Weight (g/mol) | 129.11 |
| MDL Number | MFCD00007763 |
| SMILES | C1=C(C=C(C=C1F)F)N |
| Synonym | benzenamine, 3,5-difluoro,3,5-difluorobenzenamine,3,5-difluorophenylamine,5an,3,5-difluoranilin,3,5-difluoroanilin,3,5 difluoroaniline,3.5-difluoroaniline,pubchem2296,3, 5-difluoroaniline |
| IUPAC Name | 3,5-difluoroaniline |
| InChI Key | KQOIBXZRCYFZSO-UHFFFAOYSA-N |
| Molecular Formula | C6H5F2N |
m-Cresol 98.0+%, TCI America™
CAS: 108-39-4 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00002302 InChI Key: RLSSMJSEOOYNOY-UHFFFAOYSA-N Synonym: m-cresol,metacresol,meta-cresol,phenol, 3-methyl,3-hydroxytoluene,m-methylphenol,3-cresol,m-kresol,m-oxytoluene,m-toluol PubChem CID: 342 ChEBI: CHEBI:17231 IUPAC Name: 3-methylphenol SMILES: CC1=CC(=CC=C1)O
| PubChem CID | 342 |
|---|---|
| CAS | 108-39-4 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17231 |
| MDL Number | MFCD00002302 |
| SMILES | CC1=CC(=CC=C1)O |
| Synonym | m-cresol,metacresol,meta-cresol,phenol, 3-methyl,3-hydroxytoluene,m-methylphenol,3-cresol,m-kresol,m-oxytoluene,m-toluol |
| IUPAC Name | 3-methylphenol |
| InChI Key | RLSSMJSEOOYNOY-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
5-Hydroxy-1,4-naphthoquinone 96.0+%, TCI America™
CAS: 481-39-0 Molecular Formula: C10H6O3 Molecular Weight (g/mol): 174.16 MDL Number: MFCD00001684 InChI Key: KQPYUDDGWXQXHS-UHFFFAOYSA-N Synonym: juglone,5-hydroxy-1,4-naphthoquinone,5-hydroxy-1,4-naphthalenedione,regianin,walnut extract,juglon,nucin,5-hydroxynaphthoquinone,akhnot,yuglon PubChem CID: 3806 ChEBI: CHEBI:15794 IUPAC Name: 5-hydroxy-1,4-dihydronaphthalene-1,4-dione SMILES: OC1=CC=CC2=C1C(=O)C=CC2=O
| PubChem CID | 3806 |
|---|---|
| CAS | 481-39-0 |
| Molecular Weight (g/mol) | 174.16 |
| ChEBI | CHEBI:15794 |
| MDL Number | MFCD00001684 |
| SMILES | OC1=CC=CC2=C1C(=O)C=CC2=O |
| Synonym | juglone,5-hydroxy-1,4-naphthoquinone,5-hydroxy-1,4-naphthalenedione,regianin,walnut extract,juglon,nucin,5-hydroxynaphthoquinone,akhnot,yuglon |
| IUPAC Name | 5-hydroxy-1,4-dihydronaphthalene-1,4-dione |
| InChI Key | KQPYUDDGWXQXHS-UHFFFAOYSA-N |
| Molecular Formula | C10H6O3 |
4-Methylthio-2-butanone 97.0+%, TCI America™
CAS: 34047-39-7 Molecular Formula: C5H10OS Molecular Weight (g/mol): 118.194 MDL Number: MFCD00040029 InChI Key: DRGHCRKOWMAZAO-UHFFFAOYSA-N Synonym: 4-methylthio-2-butanone,2-butanone, 4-methylthio,4-methylthio butan-2-one,unii-5703w1o1ab,4-methylsulfanyl butan-2-one,potato butanone,fema no. 3375,5-thiahexane-2-one,acmc-1afub PubChem CID: 61922 IUPAC Name: 4-methylsulfanylbutan-2-one SMILES: CC(=O)CCSC
| PubChem CID | 61922 |
|---|---|
| CAS | 34047-39-7 |
| Molecular Weight (g/mol) | 118.194 |
| MDL Number | MFCD00040029 |
| SMILES | CC(=O)CCSC |
| Synonym | 4-methylthio-2-butanone,2-butanone, 4-methylthio,4-methylthio butan-2-one,unii-5703w1o1ab,4-methylsulfanyl butan-2-one,potato butanone,fema no. 3375,5-thiahexane-2-one,acmc-1afub |
| IUPAC Name | 4-methylsulfanylbutan-2-one |
| InChI Key | DRGHCRKOWMAZAO-UHFFFAOYSA-N |
| Molecular Formula | C5H10OS |
4-Bromobenz[a]anthracene 97.0+%, TCI America™
CAS: 61921-39-9 Molecular Formula: C18H11Br Molecular Weight (g/mol): 307.19 MDL Number: MFCD25371993 InChI Key: ILVKEMDEUCXCAB-UHFFFAOYSA-N Synonym: 4-Bromotetraphene PubChem CID: 182324 IUPAC Name: 4-bromobenzo[a]anthracene SMILES: C1=CC=C2C=C3C(=CC2=C1)C=CC4=C3C=CC=C4Br
| PubChem CID | 182324 |
|---|---|
| CAS | 61921-39-9 |
| Molecular Weight (g/mol) | 307.19 |
| MDL Number | MFCD25371993 |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC4=C3C=CC=C4Br |
| Synonym | 4-Bromotetraphene |
| IUPAC Name | 4-bromobenzo[a]anthracene |
| InChI Key | ILVKEMDEUCXCAB-UHFFFAOYSA-N |
| Molecular Formula | C18H11Br |
(4-Chlorobenzyl)triphenylphosphonium Chloride 98.0+%, TCI America™
CAS: 1530-39-8 Molecular Formula: C25H21Cl2P Molecular Weight (g/mol): 423.32 MDL Number: MFCD00041533 InChI Key: RAHOAHBOOHXRDY-UHFFFAOYSA-M Synonym: 4-chlorobenzyl triphenylphosphonium chloride,4-chlorobenzyl triphenylphosphoniumchloride,4-chlorophenyl methyl triphenylphosphanium chloride,acmc-1bpq8,4-chlorobenzyltriphenylphosphonium chloride,4-chlorobenzyltriphenyl-phosphonium chloride,4-chlorophenyl methyl-triphenylphosphanium chloride,4-chlorophenyl methyl-triphenylphosphonium chloride,4-chlorophenyl methyl triphenylphosphine, chloride,4-chlorobenzyl triphenyl phosphonium chloride PubChem CID: 2733546 IUPAC Name: [(4-chlorophenyl)methyl]triphenylphosphanium chloride SMILES: [Cl-].ClC1=CC=C(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1
| PubChem CID | 2733546 |
|---|---|
| CAS | 1530-39-8 |
| Molecular Weight (g/mol) | 423.32 |
| MDL Number | MFCD00041533 |
| SMILES | [Cl-].ClC1=CC=C(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 |
| Synonym | 4-chlorobenzyl triphenylphosphonium chloride,4-chlorobenzyl triphenylphosphoniumchloride,4-chlorophenyl methyl triphenylphosphanium chloride,acmc-1bpq8,4-chlorobenzyltriphenylphosphonium chloride,4-chlorobenzyltriphenyl-phosphonium chloride,4-chlorophenyl methyl-triphenylphosphanium chloride,4-chlorophenyl methyl-triphenylphosphonium chloride,4-chlorophenyl methyl triphenylphosphine, chloride,4-chlorobenzyl triphenyl phosphonium chloride |
| IUPAC Name | [(4-chlorophenyl)methyl]triphenylphosphanium chloride |
| InChI Key | RAHOAHBOOHXRDY-UHFFFAOYSA-M |
| Molecular Formula | C25H21Cl2P |
4-Bromo-2-tert-butylphenol 95.0+%, TCI America™
CAS: 10323-39-4 Molecular Formula: C10H13BrO Molecular Weight (g/mol): 229.12 MDL Number: MFCD00192645 InChI Key: IKMJSWBFODAWTC-UHFFFAOYSA-N PubChem CID: 97068 IUPAC Name: 4-bromo-2-tert-butylphenol SMILES: CC(C)(C)C1=CC(Br)=CC=C1O
| PubChem CID | 97068 |
|---|---|
| CAS | 10323-39-4 |
| Molecular Weight (g/mol) | 229.12 |
| MDL Number | MFCD00192645 |
| SMILES | CC(C)(C)C1=CC(Br)=CC=C1O |
| IUPAC Name | 4-bromo-2-tert-butylphenol |
| InChI Key | IKMJSWBFODAWTC-UHFFFAOYSA-N |
| Molecular Formula | C10H13BrO |