Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
10-Bromo-10'-(2-naphthyl)-9,9'-bianthracene 98.0+%, TCI America™
CAS: 1172087-81-8 Molecular Formula: C38H23Br Molecular Weight (g/mol): 559.506 MDL Number: MFCD22987563 InChI Key: OUMDUWOVDLPNDY-UHFFFAOYSA-N PubChem CID: 91972118 IUPAC Name: 9-bromo-10-(10-naphthalen-2-ylanthracen-9-yl)anthracene SMILES: C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=C7C=CC=CC7=C(C8=CC=CC=C86)Br
| PubChem CID | 91972118 |
|---|---|
| CAS | 1172087-81-8 |
| Molecular Weight (g/mol) | 559.506 |
| MDL Number | MFCD22987563 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=C7C=CC=CC7=C(C8=CC=CC=C86)Br |
| IUPAC Name | 9-bromo-10-(10-naphthalen-2-ylanthracen-9-yl)anthracene |
| InChI Key | OUMDUWOVDLPNDY-UHFFFAOYSA-N |
| Molecular Formula | C38H23Br |
Graphene, nanoplatelets 2-10 nm
CAS: 1034343-98-0 Molecular Formula: Cx Molecular Weight (g/mol): 16.04 MDL Number: MFCD00144065 InChI Key: VNWKTOKETHGBQD-UHFFFAOYSA-N Synonym: methyl hydride,marsh gas,biogas,fire damp,r 50 refrigerant,methan,metano,hsdb 167,in gaseus state,tetrahydridocarbon PubChem CID: 297 ChEBI: CHEBI:16183 IUPAC Name: methane SMILES: C
| PubChem CID | 297 |
|---|---|
| CAS | 1034343-98-0 |
| Molecular Weight (g/mol) | 16.04 |
| ChEBI | CHEBI:16183 |
| MDL Number | MFCD00144065 |
| SMILES | C |
| Synonym | methyl hydride,marsh gas,biogas,fire damp,r 50 refrigerant,methan,metano,hsdb 167,in gaseus state,tetrahydridocarbon |
| IUPAC Name | methane |
| InChI Key | VNWKTOKETHGBQD-UHFFFAOYSA-N |
| Molecular Formula | Cx |
| MDL Number | MFCD00133992 |
|---|
2-(1-Cyclohexenyl)cyclohexanone, 85+%, cont. ca 10% 2-cyclohexylidenecyclohexanone
CAS: 1502-22-3 Molecular Formula: C12H18O Molecular Weight (g/mol): 178.28 MDL Number: MFCD00013796 InChI Key: GVNVAWHJIKLAGL-UHFFFAOYNA-N Synonym: 2-1-cyclohexenyl cyclohexanone,chch,2-cyclohexenylcyclohexanone,2-1-cyclohexen-1-yl cyclohexan-1-one,1,1'-bi cyclohexan-1-en-2-one,cyclohexanone, 2-1-cyclohexen-1-yl,2-cyclohex-1-enyl cyclohexanone,2-cyclohex-1-en-1-yl cyclohexan-1-one,2-1-cyclohexen-1-yl cyclohexanone,cyclohexanone, 2-cyclohexenyl PubChem CID: 101175 SMILES: O=C1CCCCC1C1=CCCCC1
| PubChem CID | 101175 |
|---|---|
| CAS | 1502-22-3 |
| Molecular Weight (g/mol) | 178.28 |
| MDL Number | MFCD00013796 |
| SMILES | O=C1CCCCC1C1=CCCCC1 |
| Synonym | 2-1-cyclohexenyl cyclohexanone,chch,2-cyclohexenylcyclohexanone,2-1-cyclohexen-1-yl cyclohexan-1-one,1,1'-bi cyclohexan-1-en-2-one,cyclohexanone, 2-1-cyclohexen-1-yl,2-cyclohex-1-enyl cyclohexanone,2-cyclohex-1-en-1-yl cyclohexan-1-one,2-1-cyclohexen-1-yl cyclohexanone,cyclohexanone, 2-cyclohexenyl |
| InChI Key | GVNVAWHJIKLAGL-UHFFFAOYNA-N |
| Molecular Formula | C12H18O |
Poly(2-acrylamido-2-methyl-1-propanesulfonic acid), 10 wt% aq.sol.; ca. MW 800,000
CAS: 27119-07-9 Molecular Formula: (C7H13NO4S)n Molecular Weight (g/mol): 207.24 MDL Number: MFCD00084369 InChI Key: XHZPRMZZQOIPDS-UHFFFAOYSA-N Synonym: 2-acrylamido-2-methylpropanesulfonic acid,2-acrylamido-2-methyl-1-propanesulfonic acid,2-acrylamide-2-methylpropanesulfonic acid,1-propanesulfonic acid, 2-methyl-2-1-oxo-2-propenyl amino,polyacrylamidomethylpropane sulfonic acid,unii-490hqe5ki5,2-acrylamido-2-methylpropanesulfonate,2-acrylamido-2-methylpropanesulphonic acid,2-acrylamido-2-methylpropane sulfonic acid,2-acrylamido-2-methylpropane-1-sulfonic acid PubChem CID: 65360 IUPAC Name: 2-methyl-2-(prop-2-enamido)propane-1-sulfonic acid SMILES: CC(C)(CS(O)(=O)=O)NC(=O)C(-*)C-*
| PubChem CID | 65360 |
|---|---|
| CAS | 27119-07-9 |
| Molecular Weight (g/mol) | 207.24 |
| MDL Number | MFCD00084369 |
| SMILES | CC(C)(CS(O)(=O)=O)NC(=O)C(-*)C-* |
| Synonym | 2-acrylamido-2-methylpropanesulfonic acid,2-acrylamido-2-methyl-1-propanesulfonic acid,2-acrylamide-2-methylpropanesulfonic acid,1-propanesulfonic acid, 2-methyl-2-1-oxo-2-propenyl amino,polyacrylamidomethylpropane sulfonic acid,unii-490hqe5ki5,2-acrylamido-2-methylpropanesulfonate,2-acrylamido-2-methylpropanesulphonic acid,2-acrylamido-2-methylpropane sulfonic acid,2-acrylamido-2-methylpropane-1-sulfonic acid |
| IUPAC Name | 2-methyl-2-(prop-2-enamido)propane-1-sulfonic acid |
| InChI Key | XHZPRMZZQOIPDS-UHFFFAOYSA-N |
| Molecular Formula | (C7H13NO4S)n |
trans-10-Hydroxy-2-decenoic Acid 97.0+%, TCI America™
CAS: 14113-05-4 Molecular Formula: C10H18O3 Molecular Weight (g/mol): 186.25 MDL Number: MFCD00204506 InChI Key: QHBZHVUGQROELI-SOFGYWHQSA-N PubChem CID: 5312738 ChEBI: CHEBI:78668 IUPAC Name: (2E)-10-hydroxydec-2-enoic acid SMILES: OCCCCCCC\C=C\C(O)=O
| PubChem CID | 5312738 |
|---|---|
| CAS | 14113-05-4 |
| Molecular Weight (g/mol) | 186.25 |
| ChEBI | CHEBI:78668 |
| MDL Number | MFCD00204506 |
| SMILES | OCCCCCCC\C=C\C(O)=O |
| IUPAC Name | (2E)-10-hydroxydec-2-enoic acid |
| InChI Key | QHBZHVUGQROELI-SOFGYWHQSA-N |
| Molecular Formula | C10H18O3 |
9-(2-Biphenylyl)-10-bromoanthracene 98.0+%, TCI America™
CAS: 400607-16-1 Molecular Formula: C26H17Br Molecular Weight (g/mol): 409.33 MDL Number: MFCD28138083 InChI Key: NANUBXRTTQXXDS-UHFFFAOYSA-N PubChem CID: 22138280 IUPAC Name: 9-{[1,1'-biphenyl]-2-yl}-10-bromoanthracene SMILES: BrC1=C2C=CC=CC2=C(C2=CC=CC=C12)C1=CC=CC=C1C1=CC=CC=C1
| PubChem CID | 22138280 |
|---|---|
| CAS | 400607-16-1 |
| Molecular Weight (g/mol) | 409.33 |
| MDL Number | MFCD28138083 |
| SMILES | BrC1=C2C=CC=CC2=C(C2=CC=CC=C12)C1=CC=CC=C1C1=CC=CC=C1 |
| IUPAC Name | 9-{[1,1'-biphenyl]-2-yl}-10-bromoanthracene |
| InChI Key | NANUBXRTTQXXDS-UHFFFAOYSA-N |
| Molecular Formula | C26H17Br |
9-Bromo-10-(2-naphthyl)anthracene 98.0+%, TCI America™
CAS: 474688-73-8 Molecular Formula: C24H15Br Molecular Weight (g/mol): 383.288 MDL Number: MFCD09832882 InChI Key: FKIFDWYMWOJKTQ-UHFFFAOYSA-N Synonym: 9-bromo-10-2-naphthyl anthracene,9-bromo-10-naphthalen-2-yl anthracene,10-bromo-9-naphthalen-2-yl anthracene,anthracene, 9-bromo-10-2-naphthalenyl,ksc235k9l,10-2-naphthyl-9-anthryl bromide,9-bromo-10-2-naphthyl-anthracene,10-bromo-9-phthalen-2-yl anthracene,9-bromo-10-naphthyl-2-yl anthracene PubChem CID: 16116263 IUPAC Name: 9-bromo-10-naphthalen-2-ylanthracene SMILES: C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)Br
| PubChem CID | 16116263 |
|---|---|
| CAS | 474688-73-8 |
| Molecular Weight (g/mol) | 383.288 |
| MDL Number | MFCD09832882 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)Br |
| Synonym | 9-bromo-10-2-naphthyl anthracene,9-bromo-10-naphthalen-2-yl anthracene,10-bromo-9-naphthalen-2-yl anthracene,anthracene, 9-bromo-10-2-naphthalenyl,ksc235k9l,10-2-naphthyl-9-anthryl bromide,9-bromo-10-2-naphthyl-anthracene,10-bromo-9-phthalen-2-yl anthracene,9-bromo-10-naphthyl-2-yl anthracene |
| IUPAC Name | 9-bromo-10-naphthalen-2-ylanthracene |
| InChI Key | FKIFDWYMWOJKTQ-UHFFFAOYSA-N |
| Molecular Formula | C24H15Br |
Sodium 2-chloroethanesulfonate hydrate, 98+% (dry wt.), water <10%
CAS: 15484-44-3 Molecular Formula: C2H4ClNaO3S Molecular Weight (g/mol): 166.55 MDL Number: MFCD00149546 MFCD00007531 InChI Key: BVIXLMYIFZGRBH-UHFFFAOYSA-M Synonym: sodium 2-chloroethylsulfonate,2-chloroethane sulfonic acid sodium salt,sodium .beta.-chloroethanesulfonate,sodium 2-chloroethane-1-sulfonic acid,sodium 2-chloroethanesulfonic acid PubChem CID: 54611855 SMILES: [Na+].[O-]S(=O)(=O)CCCl
| PubChem CID | 54611855 |
|---|---|
| CAS | 15484-44-3 |
| Molecular Weight (g/mol) | 166.55 |
| MDL Number | MFCD00149546 MFCD00007531 |
| SMILES | [Na+].[O-]S(=O)(=O)CCCl |
| Synonym | sodium 2-chloroethylsulfonate,2-chloroethane sulfonic acid sodium salt,sodium .beta.-chloroethanesulfonate,sodium 2-chloroethane-1-sulfonic acid,sodium 2-chloroethanesulfonic acid |
| InChI Key | BVIXLMYIFZGRBH-UHFFFAOYSA-M |
| Molecular Formula | C2H4ClNaO3S |
10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine 98.0+%, TCI America™
CAS: 2098786-35-5 Molecular Formula: C17H19NO2S Synonym: MEEPT
| CAS | 2098786-35-5 |
|---|---|
| Synonym | MEEPT |
| Molecular Formula | C17H19NO2S |
9-Bromo-10-[4-(2-naphthyl)phenyl]anthracene 98.0+%, TCI America™
CAS: 866611-29-2 Molecular Formula: C30H19Br Molecular Weight (g/mol): 459.386 MDL Number: MFCD20486476 InChI Key: PIGVQJMWWHSAEZ-UHFFFAOYSA-N PubChem CID: 23148608 IUPAC Name: 9-bromo-10-(4-naphthalen-2-ylphenyl)anthracene SMILES: C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C4=C5C=CC=CC5=C(C6=CC=CC=C64)Br
| PubChem CID | 23148608 |
|---|---|
| CAS | 866611-29-2 |
| Molecular Weight (g/mol) | 459.386 |
| MDL Number | MFCD20486476 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C4=C5C=CC=CC5=C(C6=CC=CC=C64)Br |
| IUPAC Name | 9-bromo-10-(4-naphthalen-2-ylphenyl)anthracene |
| InChI Key | PIGVQJMWWHSAEZ-UHFFFAOYSA-N |
| Molecular Formula | C30H19Br |
2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid hydrate, tech. 85%, may cont. up to 10% 2-propanol
CAS: 4065-45-6 Molecular Formula: C14H12O6S Molecular Weight (g/mol): 308.30 MDL Number: MFCD00024962 InChI Key: CXVGEDCSTKKODG-UHFFFAOYSA-N Synonym: sulisobenzone,benzophenone-4,sungard,2-hydroxy-4-methoxybenzophenone-5-sulfonic acid,benzophenone 4,uval,uvinul,benzenesulfonic acid, 5-benzoyl-4-hydroxy-2-methoxy,sulisobenzona,sulisobenzonum PubChem CID: 19988 IUPAC Name: 5-benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid SMILES: COC1=CC(O)=C(C=C1S(O)(=O)=O)C(=O)C1=CC=CC=C1
| PubChem CID | 19988 |
|---|---|
| CAS | 4065-45-6 |
| Molecular Weight (g/mol) | 308.30 |
| MDL Number | MFCD00024962 |
| SMILES | COC1=CC(O)=C(C=C1S(O)(=O)=O)C(=O)C1=CC=CC=C1 |
| Synonym | sulisobenzone,benzophenone-4,sungard,2-hydroxy-4-methoxybenzophenone-5-sulfonic acid,benzophenone 4,uval,uvinul,benzenesulfonic acid, 5-benzoyl-4-hydroxy-2-methoxy,sulisobenzona,sulisobenzonum |
| IUPAC Name | 5-benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid |
| InChI Key | CXVGEDCSTKKODG-UHFFFAOYSA-N |
| Molecular Formula | C14H12O6S |
Polystyrene latex microsphere, 2 micron, 10 wt% dispersion in water
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |
Lanthanum(III) 2-ethylhexanoate, 10% w/v in hexane, Thermo Scientific Chemicals
CAS: 67816-09-5 Molecular Formula: C24H45LaO6 Molecular Weight (g/mol): 568.523 MDL Number: MFCD00798555 InChI Key: PPNFILUQDVDXDA-UHFFFAOYSA-K Synonym: lanthanum tris 2-ethylhexanoate,lanthanum 2-ethylhexoate,lanthanum 3+ 2-ethylhexanoate,lanthanum 2-ethylhexanoate,hexanoic acid, 2-ethyl-, lanthanum 3+ salt,hexanoic acid, 2-ethyl-, lanthanum 3+ salt 3:1,2-ethylhexanoate; lanthanum 3+,tris 2-ethylhexanoic acid lanthanum salt,lanthanum 3+ tris 2-ethylhexanoate PubChem CID: 171899 IUPAC Name: 2-ethylhexanoate;lanthanum(3+) SMILES: CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[La+3]
| PubChem CID | 171899 |
|---|---|
| CAS | 67816-09-5 |
| Molecular Weight (g/mol) | 568.523 |
| MDL Number | MFCD00798555 |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[La+3] |
| Synonym | lanthanum tris 2-ethylhexanoate,lanthanum 2-ethylhexoate,lanthanum 3+ 2-ethylhexanoate,lanthanum 2-ethylhexanoate,hexanoic acid, 2-ethyl-, lanthanum 3+ salt,hexanoic acid, 2-ethyl-, lanthanum 3+ salt 3:1,2-ethylhexanoate; lanthanum 3+,tris 2-ethylhexanoic acid lanthanum salt,lanthanum 3+ tris 2-ethylhexanoate |
| IUPAC Name | 2-ethylhexanoate;lanthanum(3+) |
| InChI Key | PPNFILUQDVDXDA-UHFFFAOYSA-K |
| Molecular Formula | C24H45LaO6 |
Perfluoro(4-methyl-2-pentene), [(E):(Z) 9:1], 90+%, cont 5-10% perfluoro(2-methyl-2-pentene)
CAS: 2070-70-4 Molecular Formula: C6F12 Molecular Weight (g/mol): 300.05 MDL Number: MFCD00153253 InChI Key: SAPOZTRFWJZUFT-UHFFFAOYSA-N Synonym: 2z-1,1,1,2,3,4,5,5,5-nonafluoro-4-trifluoromethyl pent-2-ene PubChem CID: 11012007 SMILES: FC(=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F
| PubChem CID | 11012007 |
|---|---|
| CAS | 2070-70-4 |
| Molecular Weight (g/mol) | 300.05 |
| MDL Number | MFCD00153253 |
| SMILES | FC(=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Synonym | 2z-1,1,1,2,3,4,5,5,5-nonafluoro-4-trifluoromethyl pent-2-ene |
| InChI Key | SAPOZTRFWJZUFT-UHFFFAOYSA-N |
| Molecular Formula | C6F12 |