Organometallic Compounds
Medchemexpress LLC TFP-PEG3-TFP 50mg
TFP-PEG3-TFP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]
eMolecules 867062-95-1 | Fmoc-NH-PEG3-CH2CH2COOH | ChemScene | MFCD06656471 | 443.496 | C24H29NO7 | 96.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 572245282
Fmoc-NH-PEG3-CH2CH2COOH | ChemScene | 867062-95-1 | MFCD06656471 | 443.496 | C24H29NO7 | 96.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 572245282
Medchemexpress LLC Azido-peg3-dykddddk tfa | 1242.20 | 5 MG
Azido-PEG3-DYKDDDDK (azide-PEG3-FLAG) TFA is a multifunctional fusion tag used for the purification of recombinant proteins. This click chemistry reagent contains an azide group, enabling it to undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with molecules containing alkyne groups. It can also participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
- Multifunctional fusion tag for the purification of recombinant proteins
- Contains an azide group
- Enables copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with molecules containing alkyne groups
- Participates in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups
Medchemexpress LLC 5,8,11-Trioxa-2-azatetradecanedioic acid, 1-(4-cycloocten-1-yl) ester | 2141981-86-2 | MFCD31811538 | 96.0% | 373.44 | 25 MG
TCO-PEG3-acid is a click chemistry reagent that contains a TCO group, which can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. It is also a click chemistry PEG linker with a terminal carboxylic acid group. The terminal carboxylic acid is reactive with primary amine groups in the presence of activators to form a stable amide bond.
- Contains a TCO group for inverse electron demand Diels-Alder reaction (iEDDA)
- Reacts with molecules containing Tetrazine groups
- Functions as a click chemistry PEG linker
- Terminal carboxylic acid group
- Forms stable amide bonds with primary amine groups in the presence of activators
Medchemexpress LLC N-(acid-PEG3)-N-bis(PEG3-azide) | 2182602-17-9 | 98.07% | C25H49N7O11 | 250 MG
N-(acid-PEG3)-N-bis(PEG3-azide) is a PEG-based PROTAC linker utilized in the synthesis of PROTACs. It functions as a click chemistry reagent, containing an Azide group. This allows it to participate in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules that contain Alkyne groups, or in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
- Composed of two different ligands connected by a linker
- One ligand targets an E3 ubiquitin ligase
- The other targets the protein of interest
- Operates by harnessing the intracellular ubiquitin-proteasome system
- Facilitates the selective degradation of target proteins
- Intended for research use only
Medchemexpress LLC 4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid, 1,25-bis(1,1-dimethylethyl) ester | 1814901-03-5 | 98.0% | C26H51NO10 | 250 MG
NH-bis(PEG3-Boc) is a PEG-based PROTAC linker. It can be used in the synthesis of PROTACs, which are molecules designed to selectively degrade target proteins by utilizing the intracellular ubiquitin-proteasome system.
- Used in the synthesis of PROTACs.
- PROTACs contain two different ligands connected by a linker; one targets an E3 ubiquitin ligase, and the other targets the protein of interest.
- PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
Medchemexpress LLC N-(Azido-PEG3)-N-Boc-PEG4-Boc | 2112731-94-7 | C28H54N4O11 | 100 MG
N-(Azido-PEG3)-N-Boc-PEG4-Boc is a PEG-based PROTAC linker. It is a click chemistry reagent that contains an Azide group.
- Can be used in the synthesis of PROTACs.
- Undergoes copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing alkyne groups.
- Undergoes strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
Medchemexpress LLC N-(acid-PEG3)-N-bis(PEG3-azide) | 2182602-17-9 | 98.1% | C25H49N7O11 | 100 MG
N-(acid-PEG3)-N-bis(PEG3-azide) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. It is also a click chemistry reagent, containing an Azide group that can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
- PEG-based PROTAC linker for PROTAC synthesis
- Click chemistry reagent with an azide group
- Undergoes copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with alkyne groups
- Undergoes strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN groups