Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Iron(III) oxide, alpha-phase, nanopowder, 98% (metals basis), Thermo Scientific Chemicals
CAS: 1309-37-1 Molecular Formula: Fe2O3 Molecular Weight (g/mol): 159.69 MDL Number: MFCD00011008 InChI Key: JEIPFZHSYJVQDO-UHFFFAOYSA-N IUPAC Name: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| CAS | 1309-37-1 |
|---|---|
| Molecular Weight (g/mol) | 159.69 |
| MDL Number | MFCD00011008 |
| SMILES | [Fe][Fe](=O)(=O)=O |
| IUPAC Name | trioxodiiron |
| InChI Key | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| Molecular Formula | Fe2O3 |
Nitrosonium hexafluorophosphate, 96%
CAS: 16921-91-8 Molecular Formula: F6NOP Molecular Weight (g/mol): 174.97 MDL Number: MFCD00040324 InChI Key: SAKPNYRUBHJGAR-UHFFFAOYSA-N Synonym: nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium PubChem CID: 10910083 IUPAC Name: azanylidyneoxidanium;hexafluorophosphate SMILES: N#[O+].F[P-](F)(F)(F)(F)F
| PubChem CID | 10910083 |
|---|---|
| CAS | 16921-91-8 |
| Molecular Weight (g/mol) | 174.97 |
| MDL Number | MFCD00040324 |
| SMILES | N#[O+].F[P-](F)(F)(F)(F)F |
| Synonym | nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium |
| IUPAC Name | azanylidyneoxidanium;hexafluorophosphate |
| InChI Key | SAKPNYRUBHJGAR-UHFFFAOYSA-N |
| Molecular Formula | F6NOP |
Samarium(III) chloride hydrate, REacton™, 99.99% (REO)
CAS: 10361-82-7 Molecular Formula: Cl3Sm Molecular Weight (g/mol): 256.71 MDL Number: MFCD00011235 InChI Key: BHXBZLPMVFUQBQ-UHFFFAOYSA-K IUPAC Name: samarium(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Sm+3]
| CAS | 10361-82-7 |
|---|---|
| Molecular Weight (g/mol) | 256.71 |
| MDL Number | MFCD00011235 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sm+3] |
| IUPAC Name | samarium(3+) trichloride |
| InChI Key | BHXBZLPMVFUQBQ-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sm |
Silver nitrate, 99+%, ACS reagent
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Sodium dichromate dihydrate, Reagent Grade
CAS: 7789-12-0 Molecular Formula: Cr2H4Na2O9 Molecular Weight (g/mol): 297.995 MDL Number: MFCD00149166 InChI Key: JYDRNIYTFCBIFC-UHFFFAOYSA-N Synonym: sodium dichromate dihydrate,unii-52125xyy2a,ccris 6344,disodium chromate dihydrate,sodium dichromate vi dihydrate,sodium dichromate dihydrate vi,chromic acid h2cr2o7 , disodium salt, dihydrate,dichromic acid h2cr2o7 , disodium salt, dihydrate,dsstox_cid_12061,dsstox_rid_78903 PubChem CID: 108005 IUPAC Name: disodium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium;dihydrate SMILES: O.O.[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 108005 |
|---|---|
| CAS | 7789-12-0 |
| Molecular Weight (g/mol) | 297.995 |
| MDL Number | MFCD00149166 |
| SMILES | O.O.[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium dichromate dihydrate,unii-52125xyy2a,ccris 6344,disodium chromate dihydrate,sodium dichromate vi dihydrate,sodium dichromate dihydrate vi,chromic acid h2cr2o7 , disodium salt, dihydrate,dichromic acid h2cr2o7 , disodium salt, dihydrate,dsstox_cid_12061,dsstox_rid_78903 |
| IUPAC Name | disodium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium;dihydrate |
| InChI Key | JYDRNIYTFCBIFC-UHFFFAOYSA-N |
| Molecular Formula | Cr2H4Na2O9 |
Ytterbium powder, -40 mesh, 99.9% (REO)
CAS: 7440-64-4 Molecular Formula: Yb Molecular Weight (g/mol): 173.05 MDL Number: MFCD00011286 InChI Key: NAWDYIZEMPQZHO-UHFFFAOYSA-N Synonym: unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n PubChem CID: 23992 ChEBI: CHEBI:33381 IUPAC Name: ytterbium SMILES: [Yb]
| PubChem CID | 23992 |
|---|---|
| CAS | 7440-64-4 |
| Molecular Weight (g/mol) | 173.05 |
| ChEBI | CHEBI:33381 |
| MDL Number | MFCD00011286 |
| SMILES | [Yb] |
| Synonym | unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n |
| IUPAC Name | ytterbium |
| InChI Key | NAWDYIZEMPQZHO-UHFFFAOYSA-N |
| Molecular Formula | Yb |
Europium(III) chloride hydrate, REacton™, 99.99% (REO)
Molecular Formula: EuCl3·xH2O MDL Number: MFCD00010994
| MDL Number | MFCD00010994 |
|---|---|
| Molecular Formula | EuCl3·xH2O |
Bismuth(III) nitrate pentahydrate, 99.999%, (trace metal basis)
CAS: 10035-06-0 Molecular Formula: BiH10N3O14 Molecular Weight (g/mol): 485.07 MDL Number: MFCD00149157 InChI Key: FBXVOTBTGXARNA-UHFFFAOYSA-N Synonym: bismuth nitrate pentahydrate,bismuth trinitrate pentahydrate,bismuth nitrate, hydrate 1:5,bismuth iii nitrate pentahydrate,unii-fo2icy167b,fo2icy167b,nitric acid, bismuth 3+ salt, pentahydrate,acmc-20alle,bismuthnitratepentahydrate PubChem CID: 160911 IUPAC Name: bismuth;trinitrate;pentahydrate SMILES: O.O.O.O.O.[Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 160911 |
|---|---|
| CAS | 10035-06-0 |
| Molecular Weight (g/mol) | 485.07 |
| MDL Number | MFCD00149157 |
| SMILES | O.O.O.O.O.[Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | bismuth nitrate pentahydrate,bismuth trinitrate pentahydrate,bismuth nitrate, hydrate 1:5,bismuth iii nitrate pentahydrate,unii-fo2icy167b,fo2icy167b,nitric acid, bismuth 3+ salt, pentahydrate,acmc-20alle,bismuthnitratepentahydrate |
| IUPAC Name | bismuth;trinitrate;pentahydrate |
| InChI Key | FBXVOTBTGXARNA-UHFFFAOYSA-N |
| Molecular Formula | BiH10N3O14 |
Silicon(IV) oxide, 99.95% (metals basis)
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Magnesium foil, 1.0mm (0.04in) thick, hard, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7439-95-4 Molecular Formula: Mg Molecular Weight (g/mol): 24.30 MDL Number: MFCD00085308 InChI Key: JLVVSXFLKOJNIY-UHFFFAOYSA-N Synonym: magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs PubChem CID: 5462224 ChEBI: CHEBI:25107 IUPAC Name: magnesium SMILES: [Mg]
| PubChem CID | 5462224 |
|---|---|
| CAS | 7439-95-4 |
| Molecular Weight (g/mol) | 24.30 |
| ChEBI | CHEBI:25107 |
| MDL Number | MFCD00085308 |
| SMILES | [Mg] |
| Synonym | magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs |
| IUPAC Name | magnesium |
| InChI Key | JLVVSXFLKOJNIY-UHFFFAOYSA-N |
| Molecular Formula | Mg |
Holmium(III) oxide, REacton™, 99.9% (REO)
CAS: 12055-62-8 Molecular Formula: Ho2O3 Molecular Weight (g/mol): 377.86 MDL Number: MFCD00011053 InChI Key: OWCYYNSBGXMRQN-UHFFFAOYSA-N IUPAC Name: diholmium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ho+3].[Ho+3]
| CAS | 12055-62-8 |
|---|---|
| Molecular Weight (g/mol) | 377.86 |
| MDL Number | MFCD00011053 |
| SMILES | [O--].[O--].[O--].[Ho+3].[Ho+3] |
| IUPAC Name | diholmium(3+) trioxidandiide |
| InChI Key | OWCYYNSBGXMRQN-UHFFFAOYSA-N |
| Molecular Formula | Ho2O3 |
Thulium(III) oxide, REacton™, 99.997% (REO)
CAS: 12036-44-1 Molecular Formula: O3Tm2 Molecular Weight (g/mol): 385.87 MDL Number: MFCD00011285 InChI Key: ZIKATJAYWZUJPY-UHFFFAOYSA-N IUPAC Name: dithulium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Tm+3].[Tm+3]
| CAS | 12036-44-1 |
|---|---|
| Molecular Weight (g/mol) | 385.87 |
| MDL Number | MFCD00011285 |
| SMILES | [O--].[O--].[O--].[Tm+3].[Tm+3] |
| IUPAC Name | dithulium(3+) trioxidandiide |
| InChI Key | ZIKATJAYWZUJPY-UHFFFAOYSA-N |
| Molecular Formula | O3Tm2 |
Erbium(III) oxide, REacton™, 99.99% (REO)
CAS: 12061-16-4 Molecular Formula: Er2O3 Molecular Weight (g/mol): 382.52 MDL Number: MFCD00010991 InChI Key: ZXGIFJXRQHZCGJ-UHFFFAOYSA-N IUPAC Name: dierbium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Er+3].[Er+3]
| CAS | 12061-16-4 |
|---|---|
| Molecular Weight (g/mol) | 382.52 |
| MDL Number | MFCD00010991 |
| SMILES | [O--].[O--].[O--].[Er+3].[Er+3] |
| IUPAC Name | dierbium(3+) trioxidandiide |
| InChI Key | ZXGIFJXRQHZCGJ-UHFFFAOYSA-N |
| Molecular Formula | Er2O3 |
Praseodymium(III, IV) oxide, REacton™, 99.996% (REO)
CAS: 12037-29-5 Molecular Formula: O11Pr6 Molecular Weight (g/mol): 1021.44 MDL Number: MFCD00011178 InChI Key: HPZIIFVSYNLWNX-UHFFFAOYSA-N IUPAC Name: hexapraseodymium(3+) undecaoxidandiide SMILES: [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Pr+3].[Pr+3].[Pr+3].[Pr+3].[Pr+3].[Pr+3]
| CAS | 12037-29-5 |
|---|---|
| Molecular Weight (g/mol) | 1021.44 |
| MDL Number | MFCD00011178 |
| SMILES | [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Pr+3].[Pr+3].[Pr+3].[Pr+3].[Pr+3].[Pr+3] |
| IUPAC Name | hexapraseodymium(3+) undecaoxidandiide |
| InChI Key | HPZIIFVSYNLWNX-UHFFFAOYSA-N |
| Molecular Formula | O11Pr6 |
Neodymium(III) oxide, REacton™, 99.99% (REO)
CAS: 1313-97-9 Molecular Formula: Nd2O3 Molecular Weight (g/mol): 336.48 MDL Number: MFCD00011134 InChI Key: PLDDOISOJJCEMH-UHFFFAOYSA-N IUPAC Name: dineodymium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Nd+3].[Nd+3]
| CAS | 1313-97-9 |
|---|---|
| Molecular Weight (g/mol) | 336.48 |
| MDL Number | MFCD00011134 |
| SMILES | [O--].[O--].[O--].[Nd+3].[Nd+3] |
| IUPAC Name | dineodymium(3+) trioxidandiide |
| InChI Key | PLDDOISOJJCEMH-UHFFFAOYSA-N |
| Molecular Formula | Nd2O3 |