Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Yttrium powder, -40 mesh, 99.6% (REO)
CAS: 7440-65-5 Molecular Formula: Y Molecular Weight (g/mol): 88.91 MDL Number: MFCD00011468 InChI Key: VWQVUPCCIRVNHF-UHFFFAOYSA-N Synonym: yttrium, elemental,yttrium-89,ion,ytrio,hydride,unii-58784xqc3y,yttrium, metal and compounds,ingot,foil,element PubChem CID: 23993 ChEBI: CHEBI:33331 IUPAC Name: yttrium SMILES: [Y]
| PubChem CID | 23993 |
|---|---|
| CAS | 7440-65-5 |
| Molecular Weight (g/mol) | 88.91 |
| ChEBI | CHEBI:33331 |
| MDL Number | MFCD00011468 |
| SMILES | [Y] |
| Synonym | yttrium, elemental,yttrium-89,ion,ytrio,hydride,unii-58784xqc3y,yttrium, metal and compounds,ingot,foil,element |
| IUPAC Name | yttrium |
| InChI Key | VWQVUPCCIRVNHF-UHFFFAOYSA-N |
| Molecular Formula | Y |
Yttrium(III) oxide, REacton™, nanopowder, 99.995% (REO)
CAS: 1314-36-9 Molecular Formula: O3Y2 Molecular Weight (g/mol): 225.81 MDL Number: MFCD00011473 InChI Key: RUDFQVOCFDJEEF-UHFFFAOYSA-N IUPAC Name: diyttrium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Y+3].[Y+3]
| CAS | 1314-36-9 |
|---|---|
| Molecular Weight (g/mol) | 225.81 |
| MDL Number | MFCD00011473 |
| SMILES | [O--].[O--].[O--].[Y+3].[Y+3] |
| IUPAC Name | diyttrium(3+) trioxidandiide |
| InChI Key | RUDFQVOCFDJEEF-UHFFFAOYSA-N |
| Molecular Formula | O3Y2 |
Sodium bismuthate(V), 85%
CAS: 12232-99-4 Molecular Formula: BiNaO3 Molecular Weight (g/mol): 279.96 InChI Key: PNYYBUOBTVHFDN-UHFFFAOYSA-N Synonym: sodium bismuthate,bismuth sodium oxide,sodium bismuthate v,bismuth sodium trioxide,bismuthate bio31-, sodium,sodium oxido dioxo bismuth,sodium bismuth oxide,bio3.na,bismuthate bio31#-, sodium PubChem CID: 4063671 IUPAC Name: sodium;oxido(dioxo)bismuth SMILES: [O-][Bi](=O)=O.[Na+]
| PubChem CID | 4063671 |
|---|---|
| CAS | 12232-99-4 |
| Molecular Weight (g/mol) | 279.96 |
| SMILES | [O-][Bi](=O)=O.[Na+] |
| Synonym | sodium bismuthate,bismuth sodium oxide,sodium bismuthate v,bismuth sodium trioxide,bismuthate bio31-, sodium,sodium oxido dioxo bismuth,sodium bismuth oxide,bio3.na,bismuthate bio31#-, sodium |
| IUPAC Name | sodium;oxido(dioxo)bismuth |
| InChI Key | PNYYBUOBTVHFDN-UHFFFAOYSA-N |
| Molecular Formula | BiNaO3 |
Sodium Carbonate, Certified, 1.00N ±0.02N (0.5M), LabChem™
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 IUPAC Name: disodium carbonate SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| IUPAC Name | disodium carbonate |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Silicon(IV) nitride, alpha-phase, 99.9% (metals basis)
CAS: 12033-89-5 Molecular Formula: N4Si3 Molecular Weight (g/mol): 140.28 MDL Number: MFCD00011230 InChI Key: HQVNEWCFYHHQES-UHFFFAOYSA-N Synonym: silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous PubChem CID: 3084099 IUPAC Name: Silicon nitride SMILES: N12[Si]34N5[Si]11N3[Si]25N41
| PubChem CID | 3084099 |
|---|---|
| CAS | 12033-89-5 |
| Molecular Weight (g/mol) | 140.28 |
| MDL Number | MFCD00011230 |
| SMILES | N12[Si]34N5[Si]11N3[Si]25N41 |
| Synonym | silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous |
| IUPAC Name | Silicon nitride |
| InChI Key | HQVNEWCFYHHQES-UHFFFAOYSA-N |
| Molecular Formula | N4Si3 |
Ammonium iron(III) sulfate dodecahydrate, 99+%, for analysis
CAS: 7783-83-7 Molecular Formula: H4FeNO8S2·12H2O Molecular Weight (g/mol): 482.19 MDL Number: MFCD00150004 InChI Key: LCPUDZUWZDSKMX-UHFFFAOYSA-K Synonym: ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g PubChem CID: 197097 IUPAC Name: azanium;iron(3+);disulfate;dodecahydrate SMILES: [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3]
| PubChem CID | 197097 |
|---|---|
| CAS | 7783-83-7 |
| Molecular Weight (g/mol) | 482.19 |
| MDL Number | MFCD00150004 |
| SMILES | [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3] |
| Synonym | ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g |
| IUPAC Name | azanium;iron(3+);disulfate;dodecahydrate |
| InChI Key | LCPUDZUWZDSKMX-UHFFFAOYSA-K |
| Molecular Formula | H4FeNO8S2·12H2O |
Lead(II) nitrate, ACS, 99.0% min
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Thallium(I) ethoxide, 95%, Thermo Scientific Chemicals
CAS: 20398-06-5 Molecular Formula: C2H5OTl Molecular Weight (g/mol): 249.441 MDL Number: MFCD00009072 InChI Key: DZFYOYRNBGNPJW-UHFFFAOYSA-N Synonym: thallous ethoxide,thallium i ethanolate,ethoxythallium i,ethanol, thallium 1+ salt,ethyl alcohol, thallium i,ethanol, thallium 1+ salt 1:1,thallium ethoxide,ethanolate; thallium 1+,thallium i ethoxide 5g PubChem CID: 30143 IUPAC Name: ethanolate;thallium(1+) SMILES: CC[O-].[Tl+]
| PubChem CID | 30143 |
|---|---|
| CAS | 20398-06-5 |
| Molecular Weight (g/mol) | 249.441 |
| MDL Number | MFCD00009072 |
| SMILES | CC[O-].[Tl+] |
| Synonym | thallous ethoxide,thallium i ethanolate,ethoxythallium i,ethanol, thallium 1+ salt,ethyl alcohol, thallium i,ethanol, thallium 1+ salt 1:1,thallium ethoxide,ethanolate; thallium 1+,thallium i ethoxide 5g |
| IUPAC Name | ethanolate;thallium(1+) |
| InChI Key | DZFYOYRNBGNPJW-UHFFFAOYSA-N |
| Molecular Formula | C2H5OTl |
Cobalt slug, 6.35mm (0.25in) dia x 12.7mm (0.50in) length, 99.95% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
Phosphorus oxybromide, 95%
CAS: 7789-59-5 Molecular Formula: Br3OP Molecular Weight (g/mol): 286.69 InChI Key: UXCDUFKZSUBXGM-UHFFFAOYSA-N Synonym: phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 PubChem CID: 24613 SMILES: O=P(Br)(Br)Br
| PubChem CID | 24613 |
|---|---|
| CAS | 7789-59-5 |
| Molecular Weight (g/mol) | 286.69 |
| SMILES | O=P(Br)(Br)Br |
| Synonym | phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 |
| InChI Key | UXCDUFKZSUBXGM-UHFFFAOYSA-N |
| Molecular Formula | Br3OP |
Sodium borohydride, 98%, pellets (1-2 cm)
CAS: 16940-66-2 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003518 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: Sodium tetrahydroborate,SBH IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
Manganese Dioxide, MP Biomedicals
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Sodium chlorate, 99%, ACS reagent
CAS: 7775-09-9 Molecular Formula: ClNaO3 Molecular Weight (g/mol): 106.44 InChI Key: YZHUMGUJCQRKBT-UHFFFAOYSA-M Synonym: sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal PubChem CID: 516902 ChEBI: CHEBI:65242 SMILES: [Na+].[O-][Cl](=O)=O
| PubChem CID | 516902 |
|---|---|
| CAS | 7775-09-9 |
| Molecular Weight (g/mol) | 106.44 |
| ChEBI | CHEBI:65242 |
| SMILES | [Na+].[O-][Cl](=O)=O |
| Synonym | sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal |
| InChI Key | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
| Molecular Formula | ClNaO3 |
Palladium nitrate, Matrix Modifier Solution, Specpure™
Molecular Formula: 1% Pd in 10% HNO3 MDL Number: MFCD00011169
| MDL Number | MFCD00011169 |
|---|---|
| Molecular Formula | 1% Pd in 10% HNO3 |