Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Platinum foil, 0.025mm (0.001in) thick, 99.9% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Sodium perborate tetrahydrate, 97%, pure
CAS: 10486-00-7 Molecular Formula: BNaO3·4H2O Molecular Weight (g/mol): 153.86
| CAS | 10486-00-7 |
|---|---|
| Molecular Weight (g/mol) | 153.86 |
| Molecular Formula | BNaO3·4H2O |
Ammonium hexafluorophosphate, 99.5%
CAS: 16941-11-0 Molecular Formula: F6H4NP Molecular Weight (g/mol): 163.003 MDL Number: MFCD00064642 InChI Key: NIZXKAYXSNUDOU-UHFFFAOYSA-O Synonym: ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride PubChem CID: 9793912 IUPAC Name: azanium;hexafluorophosphate SMILES: [NH4+].F[P-](F)(F)(F)(F)F
| PubChem CID | 9793912 |
|---|---|
| CAS | 16941-11-0 |
| Molecular Weight (g/mol) | 163.003 |
| MDL Number | MFCD00064642 |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
| Synonym | ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride |
| IUPAC Name | azanium;hexafluorophosphate |
| InChI Key | NIZXKAYXSNUDOU-UHFFFAOYSA-O |
| Molecular Formula | F6H4NP |
beta-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate, 97+%
CAS: 698999-85-8 Molecular Formula: C21H27N7NaO17P3 Molecular Weight (g/mol): 765.39 MDL Number: MFCD00036973 InChI Key: JNUMDLCHLVUHFS-QYZPTAICSA-M Synonym: nadp sodium salt,beta-nicotinamide adenine dinucleotide phosphate sodium PubChem CID: 131845262 SMILES: [Na+].NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131845262 |
|---|---|
| CAS | 698999-85-8 |
| Molecular Weight (g/mol) | 765.39 |
| MDL Number | MFCD00036973 |
| SMILES | [Na+].NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nadp sodium salt,beta-nicotinamide adenine dinucleotide phosphate sodium |
| InChI Key | JNUMDLCHLVUHFS-QYZPTAICSA-M |
| Molecular Formula | C21H27N7NaO17P3 |
Hydrogen bromide, pure, 33 wt% solution in glacial acetic acid
CAS: 10035-10-6 Molecular Formula: BrH Molecular Weight (g/mol): 80.91 MDL Number: MFCD00011323 InChI Key: CPELXLSAUQHCOX-UHFFFAOYSA-N Synonym: hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide PubChem CID: 260 ChEBI: CHEBI:47266 SMILES: Br
| PubChem CID | 260 |
|---|---|
| CAS | 10035-10-6 |
| Molecular Weight (g/mol) | 80.91 |
| ChEBI | CHEBI:47266 |
| MDL Number | MFCD00011323 |
| SMILES | Br |
| Synonym | hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide |
| InChI Key | CPELXLSAUQHCOX-UHFFFAOYSA-N |
| Molecular Formula | BrH |
Tetra-n-butylammonium hexafluorophosphate, 98%
CAS: 3109-63-5 Molecular Formula: C16H36F6NP Molecular Weight (g/mol): 387.44 MDL Number: MFCD00011748 InChI Key: BKBKEFQIOUYLBC-UHFFFAOYSA-N Synonym: tetrabutylammonium hexafluorophosphate,tetra-n-butylammonium hexafluorophosphate,tetrabutylammonium hexafluorophosphate v,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-1:1,acmc-1ahjo,n,n,n-tributyl-1-butanaminium hexafluorophosphate,ksc225q6r,tetrabutylammoniumhexafluorophosphate,tetrabutylazanium hexafluorophosphate PubChem CID: 165075 IUPAC Name: tetrabutylazanium;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 165075 |
|---|---|
| CAS | 3109-63-5 |
| Molecular Weight (g/mol) | 387.44 |
| MDL Number | MFCD00011748 |
| SMILES | F[P-](F)(F)(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hexafluorophosphate,tetra-n-butylammonium hexafluorophosphate,tetrabutylammonium hexafluorophosphate v,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-1:1,acmc-1ahjo,n,n,n-tributyl-1-butanaminium hexafluorophosphate,ksc225q6r,tetrabutylammoniumhexafluorophosphate,tetrabutylazanium hexafluorophosphate |
| IUPAC Name | tetrabutylazanium;hexafluorophosphate |
| InChI Key | BKBKEFQIOUYLBC-UHFFFAOYSA-N |
| Molecular Formula | C16H36F6NP |
Iron(III) sulfate pentahydrate, 97%
CAS: 142906-29-4 Molecular Formula: Fe2O12S3·5H2O Molecular Weight (g/mol): 489.96 MDL Number: MFCD00149714 InChI Key: YHGPYBQVSJBGHH-UHFFFAOYSA-H Synonym: unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate PubChem CID: 23443659 IUPAC Name: iron(3+);trisulfate;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3]
| PubChem CID | 23443659 |
|---|---|
| CAS | 142906-29-4 |
| Molecular Weight (g/mol) | 489.96 |
| MDL Number | MFCD00149714 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3] |
| Synonym | unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate |
| IUPAC Name | iron(3+);trisulfate;pentahydrate |
| InChI Key | YHGPYBQVSJBGHH-UHFFFAOYSA-H |
| Molecular Formula | Fe2O12S3·5H2O |
Palladium wire, 1.0mm (0.04in) dia, 99.98+% (metals basis)
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Lithium metaborate, ACS, 98.0-102.0%
CAS: 13453-69-5 Molecular Formula: B4H14Li2O7 Molecular Weight (g/mol): 183.23 MDL Number: MFCD00011089 InChI Key: DPYKRXYVXDYLEY-UHFFFAOYSA-N Synonym: lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs PubChem CID: 123308 SMILES: [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O
| PubChem CID | 123308 |
|---|---|
| CAS | 13453-69-5 |
| Molecular Weight (g/mol) | 183.23 |
| MDL Number | MFCD00011089 |
| SMILES | [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O |
| Synonym | lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs |
| InChI Key | DPYKRXYVXDYLEY-UHFFFAOYSA-N |
| Molecular Formula | B4H14Li2O7 |
| CAS | 1317-39-1 |
|---|---|
| MDL Number | MFCD00010974 |
| Molecular Formula | Cu2O |
Lead(II) perchlorate trihydrate, ACS, 97.0-102.0%
CAS: 13453-62-8 Molecular Formula: Cl2H6O11Pb Molecular Weight (g/mol): 460.10 MDL Number: MFCD00149817 InChI Key: KKGGEAQRICYXNM-UHFFFAOYSA-L Synonym: lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent PubChem CID: 25021834 IUPAC Name: lead(2+);diperchlorate;trihydrate SMILES: O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O
| PubChem CID | 25021834 |
|---|---|
| CAS | 13453-62-8 |
| Molecular Weight (g/mol) | 460.10 |
| MDL Number | MFCD00149817 |
| SMILES | O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
| Synonym | lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent |
| IUPAC Name | lead(2+);diperchlorate;trihydrate |
| InChI Key | KKGGEAQRICYXNM-UHFFFAOYSA-L |
| Molecular Formula | Cl2H6O11Pb |
Cobalt(II) chloride, 97%, anhydrous
CAS: 7646-79-9 Molecular Formula: Cl2Co Molecular Weight (g/mol): 129.83 MDL Number: MFCD00010938 InChI Key: GVPFVAHMJGGAJG-UHFFFAOYSA-L Synonym: cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride IUPAC Name: λ²-cobalt(2+) dichloride SMILES: [Cl-].[Cl-].[Co++]
| CAS | 7646-79-9 |
|---|---|
| Molecular Weight (g/mol) | 129.83 |
| MDL Number | MFCD00010938 |
| SMILES | [Cl-].[Cl-].[Co++] |
| Synonym | cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride |
| IUPAC Name | λ²-cobalt(2+) dichloride |
| InChI Key | GVPFVAHMJGGAJG-UHFFFAOYSA-L |
| Molecular Formula | Cl2Co |
Niobium(V) ethoxide, 99.9% (metals basis)
CAS: 3236-82-6 Molecular Formula: C10H25NbO5 Molecular Weight (g/mol): 318.21 MDL Number: MFCD00015122 InChI Key: ZTILUDNICMILKJ-UHFFFAOYSA-N Synonym: niobium ethoxide,niobium 5+ ethanolate,ethanol, niobium 5+ salt,niobium 5+ ion pentakis ethoxide,pentaethoxyniobium,niobium pentaethoxide,ethanol, niobium 5+ salt 5:1,acmc-1cmht,niobium v pentaethoxide,ethanolate; niobium 5+ PubChem CID: 160675 SMILES: CCO[Nb](OCC)(OCC)(OCC)OCC
| PubChem CID | 160675 |
|---|---|
| CAS | 3236-82-6 |
| Molecular Weight (g/mol) | 318.21 |
| MDL Number | MFCD00015122 |
| SMILES | CCO[Nb](OCC)(OCC)(OCC)OCC |
| Synonym | niobium ethoxide,niobium 5+ ethanolate,ethanol, niobium 5+ salt,niobium 5+ ion pentakis ethoxide,pentaethoxyniobium,niobium pentaethoxide,ethanol, niobium 5+ salt 5:1,acmc-1cmht,niobium v pentaethoxide,ethanolate; niobium 5+ |
| InChI Key | ZTILUDNICMILKJ-UHFFFAOYSA-N |
| Molecular Formula | C10H25NbO5 |
Silver(I) fluoride, 99+%
CAS: 7775-41-9 Molecular Formula: AgF Molecular Weight (g/mol): 126.87 MDL Number: MFCD00003410 InChI Key: REYHXKZHIMGNSE-UHFFFAOYSA-M Synonym: silver fluoride,silver 1+ fluoride,silver 1+ ion fluoride,argentous fluoride,ag-f,silverfluoride,silver salt, fluoride,silver fluoride,,silver i fluoride 5g PubChem CID: 165912 ChEBI: CHEBI:30340 IUPAC Name: silver;fluoride SMILES: [F-].[Ag+]
| PubChem CID | 165912 |
|---|---|
| CAS | 7775-41-9 |
| Molecular Weight (g/mol) | 126.87 |
| ChEBI | CHEBI:30340 |
| MDL Number | MFCD00003410 |
| SMILES | [F-].[Ag+] |
| Synonym | silver fluoride,silver 1+ fluoride,silver 1+ ion fluoride,argentous fluoride,ag-f,silverfluoride,silver salt, fluoride,silver fluoride,,silver i fluoride 5g |
| IUPAC Name | silver;fluoride |
| InChI Key | REYHXKZHIMGNSE-UHFFFAOYSA-M |
| Molecular Formula | AgF |
Nitronium tetrafluoroborate, 96%
CAS: 13826-86-3 Molecular Formula: BF4NO2 Molecular Weight (g/mol): 132.81 MDL Number: MFCD00011432 InChI Key: XYRQURYIJKJVSF-UHFFFAOYSA-N Synonym: nitronium tetrafluoroborate,nitronium ion tetrafluoroborate,nitronium tetrafluoroboron,nitroniumtetrafluoroborate,nitronium.tetrafluoroborate,nitronium tetrafluoroborate, 0.3-0.5m solution in sulfolane PubChem CID: 11073463 SMILES: [O-][NH+]=O.F[B-](F)(F)F
| PubChem CID | 11073463 |
|---|---|
| CAS | 13826-86-3 |
| Molecular Weight (g/mol) | 132.81 |
| MDL Number | MFCD00011432 |
| SMILES | [O-][NH+]=O.F[B-](F)(F)F |
| Synonym | nitronium tetrafluoroborate,nitronium ion tetrafluoroborate,nitronium tetrafluoroboron,nitroniumtetrafluoroborate,nitronium.tetrafluoroborate,nitronium tetrafluoroborate, 0.3-0.5m solution in sulfolane |
| InChI Key | XYRQURYIJKJVSF-UHFFFAOYSA-N |
| Molecular Formula | BF4NO2 |