Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Copper gauze, 100 mesh woven from 0.11mm (0.0045in) dia wire
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Lead rod, 6.35mm (0.25in) dia, 99.999% (metals basis)
CAS: 7439-92-1 Molecular Formula: Pb Molecular Weight (g/mol): 207.20 MDL Number: MFCD00134050 InChI Key: WABPQHHGFIMREM-UHFFFAOYSA-N Synonym: plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant PubChem CID: 5352425 ChEBI: CHEBI:27889 IUPAC Name: lead SMILES: [Pb]
| PubChem CID | 5352425 |
|---|---|
| CAS | 7439-92-1 |
| Molecular Weight (g/mol) | 207.20 |
| ChEBI | CHEBI:27889 |
| MDL Number | MFCD00134050 |
| SMILES | [Pb] |
| Synonym | plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant |
| IUPAC Name | lead |
| InChI Key | WABPQHHGFIMREM-UHFFFAOYSA-N |
| Molecular Formula | Pb |
Aluminum granules, 8-12mm (0.32-0.47in), 99.9% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane, 97%
CAS: 78560-45-9 Molecular Formula: C8H4Cl3F13Si Molecular Weight (g/mol): 481.534 MDL Number: MFCD00042363 InChI Key: PISDRBMXQBSCIP-UHFFFAOYSA-N Synonym: trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane PubChem CID: 123578 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 123578 |
|---|---|
| CAS | 78560-45-9 |
| Molecular Weight (g/mol) | 481.534 |
| MDL Number | MFCD00042363 |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| Molecular Formula | C8H4Cl3F13Si |
Phenylsilane, 97%
CAS: 694-53-1 Molecular Formula: C6 H8 Si Molecular Weight (g/mol): 108.22 MDL Number: MFCD00013478 InChI Key: XJWOWXZSFTXJEX-UHFFFAOYSA-N Synonym: phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, PubChem CID: 6327628 IUPAC Name: phenylsilicon SMILES: C1=CC=C(C=C1)[Si]
| PubChem CID | 6327628 |
|---|---|
| CAS | 694-53-1 |
| Molecular Weight (g/mol) | 108.22 |
| MDL Number | MFCD00013478 |
| SMILES | C1=CC=C(C=C1)[Si] |
| Synonym | phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, |
| IUPAC Name | phenylsilicon |
| InChI Key | XJWOWXZSFTXJEX-UHFFFAOYSA-N |
| Molecular Formula | C6 H8 Si |
Copper(II) bromide, 99%
CAS: 7789-45-9 Molecular Formula: CuBr2 MDL Number: MFCD00010970 Synonym: Cupric bromide
| CAS | 7789-45-9 |
|---|---|
| MDL Number | MFCD00010970 |
| Synonym | Cupric bromide |
| Molecular Formula | CuBr2 |
Adenosine 5'-monophosphate sodium salt hydrate, 98+%
CAS: 149022-20-8 Molecular Formula: C10H13N5NaO7P Molecular Weight (g/mol): 369.21 MDL Number: MFCD18785650 InChI Key: FYWLYWMEGHCZAX-GWKNMROSNA-M Synonym: sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate x:1:x,adenosine 5-monophosphoric acid disodium salt,adenosine 5'-monophosphate sodium salt,sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate,pubchem14181,sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate 2:1:x,5'-adenylic acid,sodium salt, hydrate 9ci,disodium hydrate adenosine-5-monophosphate 2- PubChem CID: 23674992 IUPAC Name: sodium [(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate SMILES: [Na+].NC1=C2N=CN([C@@H]3O[C@H](COP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 23674992 |
|---|---|
| CAS | 149022-20-8 |
| Molecular Weight (g/mol) | 369.21 |
| MDL Number | MFCD18785650 |
| SMILES | [Na+].NC1=C2N=CN([C@@H]3O[C@H](COP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate x:1:x,adenosine 5-monophosphoric acid disodium salt,adenosine 5'-monophosphate sodium salt,sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate,pubchem14181,sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate 2:1:x,5'-adenylic acid,sodium salt, hydrate 9ci,disodium hydrate adenosine-5-monophosphate 2- |
| IUPAC Name | sodium [(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| InChI Key | FYWLYWMEGHCZAX-GWKNMROSNA-M |
| Molecular Formula | C10H13N5NaO7P |
Aluminum sulfide, 99+%, (metals basis)
CAS: 1302-81-4 Molecular Formula: Al2S3 Molecular Weight (g/mol): 150.14 MDL Number: MFCD00014162 InChI Key: COOGPNLGKIHLSK-UHFFFAOYSA-N IUPAC Name: dialuminium(3+) trisulfanediide SMILES: [Al+3].[Al+3].[S--].[S--].[S--]
| CAS | 1302-81-4 |
|---|---|
| Molecular Weight (g/mol) | 150.14 |
| MDL Number | MFCD00014162 |
| SMILES | [Al+3].[Al+3].[S--].[S--].[S--] |
| IUPAC Name | dialuminium(3+) trisulfanediide |
| InChI Key | COOGPNLGKIHLSK-UHFFFAOYSA-N |
| Molecular Formula | Al2S3 |
Ferrous Sulfate Heptahydrate, >99%, MP Biomedicals
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
| CAS | 10025-82-8 |
|---|---|
| MDL Number | MFCD00011058 |
Silver nanopowder, APS 20-40nm, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Barium fluoride, Optical Grade
CAS: 7787-32-8 Molecular Formula: BaF2 Molecular Weight (g/mol): 175.32 MDL Number: MFCD00003450 InChI Key: OYLGJCQECKOTOL-UHFFFAOYSA-L Synonym: barium fluoride,baryum fluorure french,baryum fluorure,difluorobarium,barium fluoride, ultra dry,barium ii fluoride,barium fluoride, powder,nickelous sulfate; nickel ii sulfate,barium fluoride trace metals basis PubChem CID: 62670 SMILES: [F-].[F-].[Ba++]
| PubChem CID | 62670 |
|---|---|
| CAS | 7787-32-8 |
| Molecular Weight (g/mol) | 175.32 |
| MDL Number | MFCD00003450 |
| SMILES | [F-].[F-].[Ba++] |
| Synonym | barium fluoride,baryum fluorure french,baryum fluorure,difluorobarium,barium fluoride, ultra dry,barium ii fluoride,barium fluoride, powder,nickelous sulfate; nickel ii sulfate,barium fluoride trace metals basis |
| InChI Key | OYLGJCQECKOTOL-UHFFFAOYSA-L |
| Molecular Formula | BaF2 |
Cadmium oxide, 99%, pure
CAS: 1306-19-0 Molecular Formula: CdO Molecular Weight (g/mol): 128.41 MDL Number: MFCD00010921 InChI Key: CFEAAQFZALKQPA-UHFFFAOYSA-N Synonym: cadmium oxide,cadmium monoxide,cadmium fume,aska-rid,kadmu tlenek polish,caswell no. 136aa,ccris 115,epa pesticide chemical code 236200,dsstox_cid_4715 PubChem CID: 14782 IUPAC Name: oxocadmium SMILES: [O--].[Cd++]
| PubChem CID | 14782 |
|---|---|
| CAS | 1306-19-0 |
| Molecular Weight (g/mol) | 128.41 |
| MDL Number | MFCD00010921 |
| SMILES | [O--].[Cd++] |
| Synonym | cadmium oxide,cadmium monoxide,cadmium fume,aska-rid,kadmu tlenek polish,caswell no. 136aa,ccris 115,epa pesticide chemical code 236200,dsstox_cid_4715 |
| IUPAC Name | oxocadmium |
| InChI Key | CFEAAQFZALKQPA-UHFFFAOYSA-N |
| Molecular Formula | CdO |
Titanium(IV) oxide, anatase, 99.6% (metals basis)
CAS: 1317-70-0 Molecular Formula: O2Ti Molecular Weight (g/mol): 79.87 MDL Number: MFCD00011269,MFCD00210650 InChI Key: GWEVSGVZZGPLCZ-UHFFFAOYSA-N Synonym: titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance PubChem CID: 26042 ChEBI: CHEBI:32234 IUPAC Name: dioxotitanium SMILES: O=[Ti]=O
| PubChem CID | 26042 |
|---|---|
| CAS | 1317-70-0 |
| Molecular Weight (g/mol) | 79.87 |
| ChEBI | CHEBI:32234 |
| MDL Number | MFCD00011269,MFCD00210650 |
| SMILES | O=[Ti]=O |
| Synonym | titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance |
| IUPAC Name | dioxotitanium |
| InChI Key | GWEVSGVZZGPLCZ-UHFFFAOYSA-N |
| Molecular Formula | O2Ti |
Sodium phosphate, monobasic, 98%, extra pure, anhydrous
CAS: 7558-80-7 Molecular Formula: H2NaO4P Molecular Weight (g/mol): 119.98 MDL Number: MFCD00003527,MFCD00146206 InChI Key: AJPJDKMHJJGVTQ-UHFFFAOYSA-M Synonym: monosodium phosphate,sodium dihydrogen phosphate,sodium dihydrogenorthophosphate,sodium phosphate monobasic,sodium acid phosphate,sodium phosphate, monobasic,monosodium dihydrogen orthophosphate,sodium phosphate monobasic anhydrous,monosodium orthophosphate,monobasic sodium phosphate PubChem CID: 23672064 ChEBI: CHEBI:37585 IUPAC Name: sodium;dihydrogen phosphate SMILES: [Na+].OP(O)([O-])=O
| PubChem CID | 23672064 |
|---|---|
| CAS | 7558-80-7 |
| Molecular Weight (g/mol) | 119.98 |
| ChEBI | CHEBI:37585 |
| MDL Number | MFCD00003527,MFCD00146206 |
| SMILES | [Na+].OP(O)([O-])=O |
| Synonym | monosodium phosphate,sodium dihydrogen phosphate,sodium dihydrogenorthophosphate,sodium phosphate monobasic,sodium acid phosphate,sodium phosphate, monobasic,monosodium dihydrogen orthophosphate,sodium phosphate monobasic anhydrous,monosodium orthophosphate,monobasic sodium phosphate |
| IUPAC Name | sodium;dihydrogen phosphate |
| InChI Key | AJPJDKMHJJGVTQ-UHFFFAOYSA-M |
| Molecular Formula | H2NaO4P |