Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Thermo Scientific Chemicals Pararosaniline chloride, 96%, pure
CAS: 569-61-9 Molecular Formula: C19H17N3·HCl Molecular Weight (g/mol): 323.83 InChI Key: JUQPZRLQQYSMEQ-UHFFFAOYSA-N Synonym: basic red 9,pararosaniline hydrochloride,parafuchsin,pararosaniline chloride,parafuchsine,p-fuchsin,basic fuchsin,ci basic red 9,c.i. basic red 9,parafuksin PubChem CID: 11292 ChEBI: CHEBI:87663 IUPAC Name: 4-[(4-aminophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride SMILES: C1=CC(=N)C=CC1=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.Cl
| PubChem CID | 11292 |
|---|---|
| CAS | 569-61-9 |
| Molecular Weight (g/mol) | 323.83 |
| ChEBI | CHEBI:87663 |
| SMILES | C1=CC(=N)C=CC1=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.Cl |
| Synonym | basic red 9,pararosaniline hydrochloride,parafuchsin,pararosaniline chloride,parafuchsine,p-fuchsin,basic fuchsin,ci basic red 9,c.i. basic red 9,parafuksin |
| IUPAC Name | 4-[(4-aminophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
| InChI Key | JUQPZRLQQYSMEQ-UHFFFAOYSA-N |
| Molecular Formula | C19H17N3·HCl |
Iodine, 0.01 N (0.005 M) Solution, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N IUPAC Name: diiodine SMILES: II
| CAS | 7553-56-2 |
|---|---|
| Molecular Weight (g/mol) | 253.81 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
| PubChem CID | 24640 |
|---|---|
| CAS | 7790-99-0 |
| Molecular Weight (g/mol) | 162.35 |
| MDL Number | MFCD00011354 |
| SMILES | ClI |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| IUPAC Name | iodochlorane |
| InChI Key | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
| Molecular Formula | ClI |
Benzalkonium Chloride, 95-104%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 8001-54-5 Molecular Formula: C9H13ClN Molecular Weight (g/mol): 170.66 SMILES: [Cl-].C[N+](C)(*)CC1=CC=CC=C1
| CAS | 8001-54-5 |
|---|---|
| Molecular Weight (g/mol) | 170.66 |
| SMILES | [Cl-].C[N+](C)(*)CC1=CC=CC=C1 |
| Molecular Formula | C9H13ClN |
MilliporeSigma™ Dansyl Chloride, Calbiochem™,
CAS: 605-65-2 Molecular Formula: C12H12ClNO2S Molecular Weight (g/mol): 269.74 MDL Number: MFCD00003985 InChI Key: XPDXVDYUQZHFPV-UHFFFAOYSA-N Synonym: dansyl chloride,5-dimethylamino naphthalene-1-sulfonyl chloride,dns chloride,dansyl,5-dimethylamino-1-naphthalenesulfonyl chloride,1-naphthalenesulfonyl chloride, 5-dimethylamino,1-dimethylaminonaphthalene-5-sulfonyl chloride,1-chlorosulfonyl-5-dimethylaminonaphthalene,unii-qmu9166tj4,5-dimethylaminonaphthalene-1-sulphonyl chloride PubChem CID: 11801 ChEBI: CHEBI:51907 IUPAC Name: 5-(dimethylamino)naphthalene-1-sulfonyl chloride SMILES: CN(C)C1=CC=CC2=C(C=CC=C12)S(Cl)(=O)=O
| PubChem CID | 11801 |
|---|---|
| CAS | 605-65-2 |
| Molecular Weight (g/mol) | 269.74 |
| ChEBI | CHEBI:51907 |
| MDL Number | MFCD00003985 |
| SMILES | CN(C)C1=CC=CC2=C(C=CC=C12)S(Cl)(=O)=O |
| Synonym | dansyl chloride,5-dimethylamino naphthalene-1-sulfonyl chloride,dns chloride,dansyl,5-dimethylamino-1-naphthalenesulfonyl chloride,1-naphthalenesulfonyl chloride, 5-dimethylamino,1-dimethylaminonaphthalene-5-sulfonyl chloride,1-chlorosulfonyl-5-dimethylaminonaphthalene,unii-qmu9166tj4,5-dimethylaminonaphthalene-1-sulphonyl chloride |
| IUPAC Name | 5-(dimethylamino)naphthalene-1-sulfonyl chloride |
| InChI Key | XPDXVDYUQZHFPV-UHFFFAOYSA-N |
| Molecular Formula | C12H12ClNO2S |
Iodotrimethylplatinum(IV)
CAS: 14364-93-3 Molecular Formula: C3H9IPt Molecular Weight (g/mol): 367.10 MDL Number: MFCD00013702 InChI Key: ZCSQPOLLUOLHHF-UHFFFAOYSA-M Synonym: iodotrimethylplatinum iv,iodotrimethylplatinum,trimethylplatinum iodide,acmc-1c6hk,trimethylplatinum iv iodide PubChem CID: 11824720 IUPAC Name: carbanide;iodoplatinum SMILES: [CH3-].[CH3-].[CH3-].I[Pt]
| PubChem CID | 11824720 |
|---|---|
| CAS | 14364-93-3 |
| Molecular Weight (g/mol) | 367.10 |
| MDL Number | MFCD00013702 |
| SMILES | [CH3-].[CH3-].[CH3-].I[Pt] |
| Synonym | iodotrimethylplatinum iv,iodotrimethylplatinum,trimethylplatinum iodide,acmc-1c6hk,trimethylplatinum iv iodide |
| IUPAC Name | carbanide;iodoplatinum |
| InChI Key | ZCSQPOLLUOLHHF-UHFFFAOYSA-M |
| Molecular Formula | C3H9IPt |
hydrogen tetrachloroaurate(III) hydrate
CAS: 27988-77-8 Molecular Formula: AuCl4H Molecular Weight (g/mol): 339.77 MDL Number: MFCD00149903 InChI Key: RFWCEGCWRSNAGT-UHFFFAOYSA-K Synonym: Chloroauric acid hydrate,Gold trichloride acid hydrate IUPAC Name: hydrogen tetrachlorogoldtris(ylium) SMILES: [H+].Cl[Au+3](Cl)(Cl)Cl
| CAS | 27988-77-8 |
|---|---|
| Molecular Weight (g/mol) | 339.77 |
| MDL Number | MFCD00149903 |
| SMILES | [H+].Cl[Au+3](Cl)(Cl)Cl |
| Synonym | Chloroauric acid hydrate,Gold trichloride acid hydrate |
| IUPAC Name | hydrogen tetrachlorogoldtris(ylium) |
| InChI Key | RFWCEGCWRSNAGT-UHFFFAOYSA-K |
| Molecular Formula | AuCl4H |
N-alpha-Benzoyl-L-arginine 4-nitroanilide hydrochloride, 98%
CAS: 21653-40-7 Molecular Formula: C19H22N6O4·HCl Molecular Weight (g/mol): 434.88 MDL Number: MFCD00063682 InChI Key: DEOKFPFLXFNAON-NTISSMGPSA-N Synonym: bz-arg-pna.hcl,s-n-5-guanidino-1-4-nitrophenyl amino-1-oxopentan-2-yl benzamide hydrochloride,nalpha-benzoyl-l-arginine 4-nitroanilide hydrochloride,bani,s-5-amidinoamino-2-benzoylamino-n-4-nitrophenyl valeramide monohydrochloride,l-bapna,2s-5-carbamimidamido-n-4-nitrophenyl-2-phenylformamido pentanamide hydrochloride,bz-arg-pna-hcl,bz-arg-pna hcl,bz-arg-pna . hcl PubChem CID: 16219022 IUPAC Name: N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]benzamide;hydrochloride SMILES: C1=CC=C(C=C1)C(=O)NC(CCCN=C(N)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-].Cl
| PubChem CID | 16219022 |
|---|---|
| CAS | 21653-40-7 |
| Molecular Weight (g/mol) | 434.88 |
| MDL Number | MFCD00063682 |
| SMILES | C1=CC=C(C=C1)C(=O)NC(CCCN=C(N)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-].Cl |
| Synonym | bz-arg-pna.hcl,s-n-5-guanidino-1-4-nitrophenyl amino-1-oxopentan-2-yl benzamide hydrochloride,nalpha-benzoyl-l-arginine 4-nitroanilide hydrochloride,bani,s-5-amidinoamino-2-benzoylamino-n-4-nitrophenyl valeramide monohydrochloride,l-bapna,2s-5-carbamimidamido-n-4-nitrophenyl-2-phenylformamido pentanamide hydrochloride,bz-arg-pna-hcl,bz-arg-pna hcl,bz-arg-pna . hcl |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]benzamide;hydrochloride |
| InChI Key | DEOKFPFLXFNAON-NTISSMGPSA-N |
| Molecular Formula | C19H22N6O4·HCl |
B-Tribromoborazine, 96%
CAS: 13703-88-3 Molecular Formula: B3Br3H3N3 Molecular Weight (g/mol): 317.187 MDL Number: MFCD00058924 InChI Key: PCLMMJIWMGUYKF-UHFFFAOYSA-N Synonym: b-tribromoborazine,2,4,6-tribromoborazine,b-tribromoborazol,borazine, 2,4,6-tribromo PubChem CID: 23278010 IUPAC Name: 2,4,6-tribromo-1,3,5,2,4,6-triazatriborinane SMILES: B1(NB(NB(N1)Br)Br)Br
| PubChem CID | 23278010 |
|---|---|
| CAS | 13703-88-3 |
| Molecular Weight (g/mol) | 317.187 |
| MDL Number | MFCD00058924 |
| SMILES | B1(NB(NB(N1)Br)Br)Br |
| Synonym | b-tribromoborazine,2,4,6-tribromoborazine,b-tribromoborazol,borazine, 2,4,6-tribromo |
| IUPAC Name | 2,4,6-tribromo-1,3,5,2,4,6-triazatriborinane |
| InChI Key | PCLMMJIWMGUYKF-UHFFFAOYSA-N |
| Molecular Formula | B3Br3H3N3 |
Iodine monobromide, 98%
CAS: 7789-33-5 Molecular Formula: BrI Molecular Weight (g/mol): 206.81 MDL Number: MFCD00011353 InChI Key: CBEQRNSPHCCXSH-UHFFFAOYSA-N Synonym: iodine monobromide,iodine bromide,iodobromine,iodine bromide ibr,unii-g0k622rd9n,iodinemonobromide,iodobromane,bromoiodine,jodmonobromid,hanus solution PubChem CID: 82238 IUPAC Name: iodobromane SMILES: BrI
| PubChem CID | 82238 |
|---|---|
| CAS | 7789-33-5 |
| Molecular Weight (g/mol) | 206.81 |
| MDL Number | MFCD00011353 |
| SMILES | BrI |
| Synonym | iodine monobromide,iodine bromide,iodobromine,iodine bromide ibr,unii-g0k622rd9n,iodinemonobromide,iodobromane,bromoiodine,jodmonobromid,hanus solution |
| IUPAC Name | iodobromane |
| InChI Key | CBEQRNSPHCCXSH-UHFFFAOYSA-N |
| Molecular Formula | BrI |
LiChropur™ Dansyl chloride, ≥99.0% (HPLC), MilliporeSigma™ Supelco™
MDL Number: MFCD00003985 Synonym: 5-(Dimethylamino)naphthalene-1-sulfonyl chloride; DNSCl
| MDL Number | MFCD00003985 |
|---|---|
| Synonym | 5-(Dimethylamino)naphthalene-1-sulfonyl chloride; DNSCl |
Hydroxylamine HCl, MP Biomedicals
CAS: 5470-11-1 Molecular Formula: ClH4NO Molecular Weight (g/mol): 69.49 MDL Number: MFCD00051089 InChI Key: WTDHULULXKLSOZ-UHFFFAOYSA-N Synonym: hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci PubChem CID: 443297 ChEBI: CHEBI:5807 IUPAC Name: hydroxylamine hydrochloride SMILES: Cl.NO
| PubChem CID | 443297 |
|---|---|
| CAS | 5470-11-1 |
| Molecular Weight (g/mol) | 69.49 |
| ChEBI | CHEBI:5807 |
| MDL Number | MFCD00051089 |
| SMILES | Cl.NO |
| Synonym | hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci |
| IUPAC Name | hydroxylamine hydrochloride |
| InChI Key | WTDHULULXKLSOZ-UHFFFAOYSA-N |
| Molecular Formula | ClH4NO |
Boron tribromide, 1M soln. in dichloromethane
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |
Iodine(V) oxide, 98%
CAS: 12029-98-0 Molecular Formula: I2O5 Molecular Weight (g/mol): 333.804 MDL Number: MFCD00011356 InChI Key: BIZCJSDBWZTASZ-UHFFFAOYSA-N Synonym: iodine pentoxide,iodopentoxide,iodic anhydride,iodine v oxide,diiodine pentaoxide,unii-upu35c0q0n,upu35c0q0n,iodine oxide,jodpentoxyd,iodine pentaoxide PubChem CID: 159402 ChEBI: CHEBI:29914 IUPAC Name: iodyl iodate SMILES: O=I(=O)OI(=O)=O
| PubChem CID | 159402 |
|---|---|
| CAS | 12029-98-0 |
| Molecular Weight (g/mol) | 333.804 |
| ChEBI | CHEBI:29914 |
| MDL Number | MFCD00011356 |
| SMILES | O=I(=O)OI(=O)=O |
| Synonym | iodine pentoxide,iodopentoxide,iodic anhydride,iodine v oxide,diiodine pentaoxide,unii-upu35c0q0n,upu35c0q0n,iodine oxide,jodpentoxyd,iodine pentaoxide |
| IUPAC Name | iodyl iodate |
| InChI Key | BIZCJSDBWZTASZ-UHFFFAOYSA-N |
| Molecular Formula | I2O5 |
Iodine monochloride
CAS: 7790-99-0 Molecular Formula: ClI Molecular Weight (g/mol): 162.35 MDL Number: MFCD00011354 InChI Key: QZRGKCOWNLSUDK-UHFFFAOYSA-N Synonym: iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french PubChem CID: 24640 IUPAC Name: iodochlorane SMILES: ClI
| PubChem CID | 24640 |
|---|---|
| CAS | 7790-99-0 |
| Molecular Weight (g/mol) | 162.35 |
| MDL Number | MFCD00011354 |
| SMILES | ClI |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| IUPAC Name | iodochlorane |
| InChI Key | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
| Molecular Formula | ClI |