Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Chromium(II) chloride, anhydrous, 97%
CAS: 10049-05-5 Molecular Formula: CrCl2 MDL Number: MFCD00010947 Synonym: Chromous chloride
| CAS | 10049-05-5 |
|---|---|
| MDL Number | MFCD00010947 |
| Synonym | Chromous chloride |
| Molecular Formula | CrCl2 |
Lithium aluminum hydride, pellets, 97%
CAS: 16853-85-3 Molecular Formula: AlH4Li Molecular Weight (g/mol): 37.95 MDL Number: MFCD00011075 InChI Key: OCZDCIYGECBNKL-UHFFFAOYSA-N Synonym: lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride PubChem CID: 21226445 IUPAC Name: lithium(1+) alumanuide SMILES: [Li+].[AlH4-]
| PubChem CID | 21226445 |
|---|---|
| CAS | 16853-85-3 |
| Molecular Weight (g/mol) | 37.95 |
| MDL Number | MFCD00011075 |
| SMILES | [Li+].[AlH4-] |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| IUPAC Name | lithium(1+) alumanuide |
| InChI Key | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Molecular Formula | AlH4Li |
tert-Butyldiphenylchlorosilane, 97%
CAS: 58479-61-1 Molecular Formula: C16H19ClSi Molecular Weight (g/mol): 274.863 MDL Number: MFCD00000497 InChI Key: MHYGQXWCZAYSLJ-UHFFFAOYSA-N Synonym: tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e PubChem CID: 94078 IUPAC Name: tert-butyl-chloro-diphenylsilane SMILES: CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl
| PubChem CID | 94078 |
|---|---|
| CAS | 58479-61-1 |
| Molecular Weight (g/mol) | 274.863 |
| MDL Number | MFCD00000497 |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| Synonym | tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e |
| IUPAC Name | tert-butyl-chloro-diphenylsilane |
| InChI Key | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Molecular Formula | C16H19ClSi |
Strontium fluoride, Puratronic™, 99.99% (metals basis)
CAS: 7783-48-4 Molecular Formula: F2Sr Molecular Weight (g/mol): 125.62 MDL Number: MFCD00011251 InChI Key: FVRNDBHWWSPNOM-UHFFFAOYSA-L Synonym: strontium difluoride,unii-efy8gjs81z,strontium fluoride srf2,efy8gjs81z,strontium 2+ ion difluoride,fluoride, sr, fluoride,strontium 2+ difluoride,beta-bromo isovaleric acid,ksc379a4r,strontium fluoride 250g PubChem CID: 82210 SMILES: [F-].[F-].[Sr++]
| PubChem CID | 82210 |
|---|---|
| CAS | 7783-48-4 |
| Molecular Weight (g/mol) | 125.62 |
| MDL Number | MFCD00011251 |
| SMILES | [F-].[F-].[Sr++] |
| Synonym | strontium difluoride,unii-efy8gjs81z,strontium fluoride srf2,efy8gjs81z,strontium 2+ ion difluoride,fluoride, sr, fluoride,strontium 2+ difluoride,beta-bromo isovaleric acid,ksc379a4r,strontium fluoride 250g |
| InChI Key | FVRNDBHWWSPNOM-UHFFFAOYSA-L |
| Molecular Formula | F2Sr |
Osmium powder, -20 mesh, 99.95% (metals basis)
CAS: 4-2-7440 PubChem CID: 23937 ChEBI: CHEBI:30687 IUPAC Name: osmium
| PubChem CID | 23937 |
|---|---|
| CAS | 4-2-7440 |
| ChEBI | CHEBI:30687 |
| IUPAC Name | osmium |
Tin foil, 0.05mm (0.002in) thick, 99.999% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Strontium sulfide, 99.9% (metals basis)
CAS: 1314-96-1 Molecular Formula: SSr Molecular Weight (g/mol): 119.68 MDL Number: MFCD00049560 InChI Key: ZEGFMFQPWDMMEP-UHFFFAOYSA-N Synonym: strontium sulfide,strontium monosulfide,strontium sulphide,strontiumsulfid,hsdb 12 PubChem CID: 14820 IUPAC Name: strontium(2+) sulfanediide SMILES: [S--].[Sr++]
| PubChem CID | 14820 |
|---|---|
| CAS | 1314-96-1 |
| Molecular Weight (g/mol) | 119.68 |
| MDL Number | MFCD00049560 |
| SMILES | [S--].[Sr++] |
| Synonym | strontium sulfide,strontium monosulfide,strontium sulphide,strontiumsulfid,hsdb 12 |
| IUPAC Name | strontium(2+) sulfanediide |
| InChI Key | ZEGFMFQPWDMMEP-UHFFFAOYSA-N |
| Molecular Formula | SSr |
Potassium borohydride, 98+%
CAS: 13762-51-1 Molecular Formula: BH4K Molecular Weight (g/mol): 53.94 MDL Number: MFCD00011396 InChI Key: ICRGAIPBTSPUEX-UHFFFAOYSA-N Synonym: potassium borohydride,potassium tetrahydroborate,potassium borohydrate,unii-0ws230dtgf,potassium tetrahydroborate 1-,borohydrure de potassium french,borate 1-, tetrahydro-, potassium,0ws230dtgf,borohydrure de potassium,borylpotassium PubChem CID: 22892188 SMILES: [BH4-].[K+]
| PubChem CID | 22892188 |
|---|---|
| CAS | 13762-51-1 |
| Molecular Weight (g/mol) | 53.94 |
| MDL Number | MFCD00011396 |
| SMILES | [BH4-].[K+] |
| Synonym | potassium borohydride,potassium tetrahydroborate,potassium borohydrate,unii-0ws230dtgf,potassium tetrahydroborate 1-,borohydrure de potassium french,borate 1-, tetrahydro-, potassium,0ws230dtgf,borohydrure de potassium,borylpotassium |
| InChI Key | ICRGAIPBTSPUEX-UHFFFAOYSA-N |
| Molecular Formula | BH4K |
Copper shot, 6mm (0.24in) & down, Puratronic™, 99.9999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Molybdenum(IV) sulfide, 98.5%
CAS: 1317-33-5 Molecular Formula: MoS2 Molecular Weight (g/mol): 160.07 InChI Key: CWQXQMHSOZUFJS-UHFFFAOYSA-N Synonym: molybdenum disulfide,molybdenite,molybdenum iv sulfide,molybdenum disulphide,molysulfide,molykote,motimol,nichimoly c,sumipowder pa,molykote z PubChem CID: 14823 ChEBI: CHEBI:30704 IUPAC Name: bis(sulfanylidene)molybdenum SMILES: S=[Mo]=S
| PubChem CID | 14823 |
|---|---|
| CAS | 1317-33-5 |
| Molecular Weight (g/mol) | 160.07 |
| ChEBI | CHEBI:30704 |
| SMILES | S=[Mo]=S |
| Synonym | molybdenum disulfide,molybdenite,molybdenum iv sulfide,molybdenum disulphide,molysulfide,molykote,motimol,nichimoly c,sumipowder pa,molykote z |
| IUPAC Name | bis(sulfanylidene)molybdenum |
| InChI Key | CWQXQMHSOZUFJS-UHFFFAOYSA-N |
| Molecular Formula | MoS2 |
Potassium phosphate, tribasic monohydrate, 96%, extra pure
CAS: 27176-10-9 Molecular Formula: K3O4P·H2O Molecular Weight (g/mol): 230.28 MDL Number: MFCD00150410 InChI Key: RMNIZOOYFMNEJJ-UHFFFAOYSA-K Synonym: tri-potassium phosphate monohydrate,potassium phosphate tribasic monohydrate,potassium phosphate hydrate,potassium phosphate monohydrate,unii-4927m96tfv,tert-potassium phosphate monohydrate,potassium phosphate, tribasic, monohydrate,phosphoric acid, tripotassium salt, monohydrate,tripotassium phosphate, monohydrate,acmc-1chx7 PubChem CID: 22031701 IUPAC Name: tripotassium;phosphate;hydrate SMILES: O.[O-]P(=O)([O-])[O-].[K+].[K+].[K+]
| PubChem CID | 22031701 |
|---|---|
| CAS | 27176-10-9 |
| Molecular Weight (g/mol) | 230.28 |
| MDL Number | MFCD00150410 |
| SMILES | O.[O-]P(=O)([O-])[O-].[K+].[K+].[K+] |
| Synonym | tri-potassium phosphate monohydrate,potassium phosphate tribasic monohydrate,potassium phosphate hydrate,potassium phosphate monohydrate,unii-4927m96tfv,tert-potassium phosphate monohydrate,potassium phosphate, tribasic, monohydrate,phosphoric acid, tripotassium salt, monohydrate,tripotassium phosphate, monohydrate,acmc-1chx7 |
| IUPAC Name | tripotassium;phosphate;hydrate |
| InChI Key | RMNIZOOYFMNEJJ-UHFFFAOYSA-K |
| Molecular Formula | K3O4P·H2O |
Sodium iodide, 99+%, pure, anhydrous
CAS: 7681-82-5 Molecular Formula: INa Molecular Weight (g/mol): 149.89 MDL Number: MFCD00003532 InChI Key: FVAUCKIRQBBSSJ-UHFFFAOYSA-M Synonym: sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech PubChem CID: 5238 ChEBI: CHEBI:33167 IUPAC Name: sodium;iodide SMILES: [Na+].[I-]
| PubChem CID | 5238 |
|---|---|
| CAS | 7681-82-5 |
| Molecular Weight (g/mol) | 149.89 |
| ChEBI | CHEBI:33167 |
| MDL Number | MFCD00003532 |
| SMILES | [Na+].[I-] |
| Synonym | sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech |
| IUPAC Name | sodium;iodide |
| InChI Key | FVAUCKIRQBBSSJ-UHFFFAOYSA-M |
| Molecular Formula | INa |
Nickel powder, spherical, APS 0.08-0.15 micron, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Cobalt wire, 0.1mm (0.004in) dia, Puratronic™, 99.995% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |