Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Perborate, Tetrahydrate, Granular, Purified, Spectrum™ Chemical
CAS: 10486-00-7
| CAS | 10486-00-7 |
|---|
Potassium Iodide, Crystal, ACS, 99%, Spectrum™ Chemical
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166.00 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M IUPAC Name: potassium iodide SMILES: [K+].[I-]
| CAS | 7681-11-0 |
|---|---|
| Molecular Weight (g/mol) | 166.00 |
| SMILES | [K+].[I-] |
| IUPAC Name | potassium iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |
Sodium borohydride, 99%, (VenPureTM SF powder), powder
CAS: 16940-66-2 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003518 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: Sodium tetrahydroborate,SBH IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
di-Lithium tetraborate, MilliporeSigma™
CAS: 12007-60-2 Molecular Formula: B4Li2O7 Molecular Weight (g/mol): 169.11 MDL Number: MFCD00011083 InChI Key: RDZCISUGRQUANA-UHFFFAOYSA-N Synonym: di-Lithium tetraborate IUPAC Name: dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) SMILES: [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| CAS | 12007-60-2 |
|---|---|
| Molecular Weight (g/mol) | 169.11 |
| MDL Number | MFCD00011083 |
| SMILES | [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Synonym | di-Lithium tetraborate |
| IUPAC Name | dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) |
| InChI Key | RDZCISUGRQUANA-UHFFFAOYSA-N |
| Molecular Formula | B4Li2O7 |
Thermo Scientific Chemicals Magnesium carbonate hydroxide pentahydrate, for biochemistry, 40.0-43.5% Magnesium oxide
CAS: 56378-72-4 Molecular Formula: C4H12Mg5O19 Molecular Weight (g/mol): 485.65 MDL Number: MFCD00149784 InChI Key: SXKPPTNZIUYFJR-UHFFFAOYSA-D Synonym: acmc-20akln,ksc492i1t,magnesium carbonate hydroxide pentahydrate, light,magnesium hydrogen carbonate hydroxide-water 1/1/1/5 IUPAC Name: pentamagnesium(2+) pentahydrate dihydroxide tetracarbonate SMILES: O.O.O.O.O.[OH-].[OH-].[Mg++].[Mg++].[Mg++].[Mg++].[Mg++].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O
| CAS | 56378-72-4 |
|---|---|
| Molecular Weight (g/mol) | 485.65 |
| MDL Number | MFCD00149784 |
| SMILES | O.O.O.O.O.[OH-].[OH-].[Mg++].[Mg++].[Mg++].[Mg++].[Mg++].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O |
| Synonym | acmc-20akln,ksc492i1t,magnesium carbonate hydroxide pentahydrate, light,magnesium hydrogen carbonate hydroxide-water 1/1/1/5 |
| IUPAC Name | pentamagnesium(2+) pentahydrate dihydroxide tetracarbonate |
| InChI Key | SXKPPTNZIUYFJR-UHFFFAOYSA-D |
| Molecular Formula | C4H12Mg5O19 |
Magnesium sulfate, 99%, for analysis, anhydrous
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 IUPAC Name: magnesium;sulfate SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| IUPAC Name | magnesium;sulfate |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Thermo Scientific Chemicals Sodium bromide, 99+%, for biochemistry
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Sodium bismuthate, ACS reagent
CAS: 12232-99-4 Molecular Formula: BiNaO3 Molecular Weight (g/mol): 279.96 InChI Key: PNYYBUOBTVHFDN-UHFFFAOYSA-N Synonym: sodium bismuthate,bismuth sodium oxide,sodium bismuthate v,bismuth sodium trioxide,bismuthate bio31-, sodium,sodium oxido dioxo bismuth,sodium bismuth oxide,bio3.na,bismuthate bio31#-, sodium PubChem CID: 4063671 IUPAC Name: sodium;oxido(dioxo)bismuth SMILES: [O-][Bi](=O)=O.[Na+]
| PubChem CID | 4063671 |
|---|---|
| CAS | 12232-99-4 |
| Molecular Weight (g/mol) | 279.96 |
| SMILES | [O-][Bi](=O)=O.[Na+] |
| Synonym | sodium bismuthate,bismuth sodium oxide,sodium bismuthate v,bismuth sodium trioxide,bismuthate bio31-, sodium,sodium oxido dioxo bismuth,sodium bismuth oxide,bio3.na,bismuthate bio31#-, sodium |
| IUPAC Name | sodium;oxido(dioxo)bismuth |
| InChI Key | PNYYBUOBTVHFDN-UHFFFAOYSA-N |
| Molecular Formula | BiNaO3 |
Ammonium Bifluoride, Flake, BAKER ANALYZED™ Reagent, J.T. Baker™
CAS: 1341-49-7 Molecular Formula: F2H5N Molecular Weight (g/mol): 57.04 MDL Number: MFCD00012018 InChI Key: KVBCYCWRDBDGBG-UHFFFAOYSA-N IUPAC Name: amine dihydrofluoride SMILES: N.F.F
| CAS | 1341-49-7 |
|---|---|
| Molecular Weight (g/mol) | 57.04 |
| MDL Number | MFCD00012018 |
| SMILES | N.F.F |
| IUPAC Name | amine dihydrofluoride |
| InChI Key | KVBCYCWRDBDGBG-UHFFFAOYSA-N |
| Molecular Formula | F2H5N |
Sodium borohydride, 12% solution in 40% aq. NaOH solution, AcroSeal™
CAS: 16940-66-2 | BH4Na | 37.83 g/mol
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
Ammonium hexachlororuthenate(IV), 99.99%, (trace metal basis)
CAS: 18746-63-9 Molecular Formula: Cl6H8N2Ru Molecular Weight (g/mol): 349.85 MDL Number: MFCD00015962 InChI Key: DHTSBQSPUBOKKI-UHFFFAOYSA-J Synonym: ammonium hexachlororuthenate iv,diammonium hexachlororuthenate,ammonium chlororuthenate,ammonium hexachlororuthenate,epitope id:151520,ruthenium iv-ammonium chloride,ammonium hexachloridoruthenate iv,ammonium hexachloridoruthenate 2-,diammonium hexachlororuthenate 2- PubChem CID: 46173598 ChEBI: CHEBI:60134 IUPAC Name: diazanium;hexachlororuthenium(2-) SMILES: [NH4+].[NH4+].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+4]
| PubChem CID | 46173598 |
|---|---|
| CAS | 18746-63-9 |
| Molecular Weight (g/mol) | 349.85 |
| ChEBI | CHEBI:60134 |
| MDL Number | MFCD00015962 |
| SMILES | [NH4+].[NH4+].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ru+4] |
| Synonym | ammonium hexachlororuthenate iv,diammonium hexachlororuthenate,ammonium chlororuthenate,ammonium hexachlororuthenate,epitope id:151520,ruthenium iv-ammonium chloride,ammonium hexachloridoruthenate iv,ammonium hexachloridoruthenate 2-,diammonium hexachlororuthenate 2- |
| IUPAC Name | diazanium;hexachlororuthenium(2-) |
| InChI Key | DHTSBQSPUBOKKI-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Ru |
3-Thienylmagnesium iodide, 0.3M solution in THF, AcroSeal™
CAS: 172035-86-8 Molecular Formula: C4H3IMgS Molecular Weight (g/mol): 234.34 MDL Number: MFCD03427252 InChI Key: LDERXYCTDNLPTD-UHFFFAOYSA-M Synonym: 3-thienylmagnesium iodide,magnesium, iodo-3-thienyl,iodo 3-thienyl magnesium,3-thienyl magnesium iodide,thiophen-3-ylmagnesium iodide,3-iodomagnesio thiophene,lderxyctdnlptd-uhfffaoysa-m,magnesium,3h-thiophen-3-ide,iodide,3-thienylmagnesium iodide 0.5 m in tetrahydrofuran,3-thienylmagnesium iodide solution, 0.3 m in thf PubChem CID: 10752186 IUPAC Name: 3-(iodomagnesio)thiophene SMILES: I[Mg]C1=CSC=C1
| PubChem CID | 10752186 |
|---|---|
| CAS | 172035-86-8 |
| Molecular Weight (g/mol) | 234.34 |
| MDL Number | MFCD03427252 |
| SMILES | I[Mg]C1=CSC=C1 |
| Synonym | 3-thienylmagnesium iodide,magnesium, iodo-3-thienyl,iodo 3-thienyl magnesium,3-thienyl magnesium iodide,thiophen-3-ylmagnesium iodide,3-iodomagnesio thiophene,lderxyctdnlptd-uhfffaoysa-m,magnesium,3h-thiophen-3-ide,iodide,3-thienylmagnesium iodide 0.5 m in tetrahydrofuran,3-thienylmagnesium iodide solution, 0.3 m in thf |
| IUPAC Name | 3-(iodomagnesio)thiophene |
| InChI Key | LDERXYCTDNLPTD-UHFFFAOYSA-M |
| Molecular Formula | C4H3IMgS |
| CAS | 7789-75-5 |
|---|
Sodium chloride, 5M aq. soln., pH 8.0, autoclaved
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Potassium hydrogen carbonate, MilliporeSigma™
CAS: 298-14-6 Molecular Formula: CHKO3 Molecular Weight (g/mol): 100.11 MDL Number: MFCD00011402 InChI Key: TYJJADVDDVDEDZ-UHFFFAOYSA-M Synonym: potassium bicarbonate,potassium hydrogen carbonate,potassium hydrogencarbonate,potassium acid carbonate,monopotassium carbonate,carbonic acid, monopotassium salt,unii-hm5z15lebn,potassiumbicarbonate,ccris 3510,khco3 PubChem CID: 516893 ChEBI: CHEBI:81862 IUPAC Name: potassium hydrogen carbonate SMILES: [K+].OC([O-])=O
| PubChem CID | 516893 |
|---|---|
| CAS | 298-14-6 |
| Molecular Weight (g/mol) | 100.11 |
| ChEBI | CHEBI:81862 |
| MDL Number | MFCD00011402 |
| SMILES | [K+].OC([O-])=O |
| Synonym | potassium bicarbonate,potassium hydrogen carbonate,potassium hydrogencarbonate,potassium acid carbonate,monopotassium carbonate,carbonic acid, monopotassium salt,unii-hm5z15lebn,potassiumbicarbonate,ccris 3510,khco3 |
| IUPAC Name | potassium hydrogen carbonate |
| InChI Key | TYJJADVDDVDEDZ-UHFFFAOYSA-M |
| Molecular Formula | CHKO3 |