Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Silver chloride, 95%
CAS: 7783-90-6 Molecular Formula: AgCl Molecular Weight (g/mol): 143.32 MDL Number: MFCD00003399 InChI Key: HKZLPVFGJNLROG-UHFFFAOYSA-M IUPAC Name: silver(1+) chloride SMILES: [Cl-].[Ag+]
| CAS | 7783-90-6 |
|---|---|
| Molecular Weight (g/mol) | 143.32 |
| MDL Number | MFCD00003399 |
| SMILES | [Cl-].[Ag+] |
| IUPAC Name | silver(1+) chloride |
| InChI Key | HKZLPVFGJNLROG-UHFFFAOYSA-M |
| Molecular Formula | AgCl |
Diethoxydiphenylsilane, 98%
CAS: 2553-19-7 Molecular Formula: C16H20O2Si Molecular Weight (g/mol): 272.42 MDL Number: MFCD00015126 InChI Key: ZZNQQQWFKKTOSD-UHFFFAOYSA-N Synonym: diphenyldiethoxysilane,silane, diethoxydiphenyl,diethoxy diphenyl silane,benzene, 1,1'-diethoxysilylene bis,acmc-1cmgu,diethoxy-di phenyl silane,diethoxydiphenylsilane,zznqqqwfkktosd-uhfffaoysa PubChem CID: 75705 IUPAC Name: diethoxy(diphenyl)silane SMILES: CCO[Si](OCC)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 75705 |
|---|---|
| CAS | 2553-19-7 |
| Molecular Weight (g/mol) | 272.42 |
| MDL Number | MFCD00015126 |
| SMILES | CCO[Si](OCC)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyldiethoxysilane,silane, diethoxydiphenyl,diethoxy diphenyl silane,benzene, 1,1'-diethoxysilylene bis,acmc-1cmgu,diethoxy-di phenyl silane,diethoxydiphenylsilane,zznqqqwfkktosd-uhfffaoysa |
| IUPAC Name | diethoxy(diphenyl)silane |
| InChI Key | ZZNQQQWFKKTOSD-UHFFFAOYSA-N |
| Molecular Formula | C16H20O2Si |
Zinc oxide, NanoArc™ ZN-0625, 50% in 1,2-propanediol monomethyl ether acetate, colloidal dispersion with dispersant
CAS: 1314-13-2 Molecular Formula: OZn Molecular Weight (g/mol): 81.38 MDL Number: MFCD00011300 InChI Key: XLOMVQKBTHCTTD-UHFFFAOYSA-N Synonym: zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 PubChem CID: 14806 ChEBI: CHEBI:36560 IUPAC Name: oxozinc SMILES: O=[Zn]
| PubChem CID | 14806 |
|---|---|
| CAS | 1314-13-2 |
| Molecular Weight (g/mol) | 81.38 |
| ChEBI | CHEBI:36560 |
| MDL Number | MFCD00011300 |
| SMILES | O=[Zn] |
| Synonym | zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 |
| IUPAC Name | oxozinc |
| InChI Key | XLOMVQKBTHCTTD-UHFFFAOYSA-N |
| Molecular Formula | OZn |
Neodymium rod, 6.35mm (0.25in) dia, 99.5% (metals basis excluding Ta)
CAS: 7440-00-8 Molecular Formula: Nd Molecular Weight (g/mol): 144.24 MDL Number: MFCD00011130 InChI Key: QEFYFXOXNSNQGX-UHFFFAOYSA-N Synonym: neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n PubChem CID: 23934 ChEBI: CHEBI:33372 IUPAC Name: neodymium SMILES: [Nd]
| PubChem CID | 23934 |
|---|---|
| CAS | 7440-00-8 |
| Molecular Weight (g/mol) | 144.24 |
| ChEBI | CHEBI:33372 |
| MDL Number | MFCD00011130 |
| SMILES | [Nd] |
| Synonym | neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n |
| IUPAC Name | neodymium |
| InChI Key | QEFYFXOXNSNQGX-UHFFFAOYSA-N |
| Molecular Formula | Nd |
Silver bromide, Premion™, 99.998% (metals basis)
CAS: 7785-23-1 Molecular Formula: AgBr Molecular Weight (g/mol): 187.772 MDL Number: MFCD00003398 InChI Key: ADZWSOLPGZMUMY-UHFFFAOYSA-M Synonym: silver bromide,bromargyrite,bromyrite,nanoparticles,silver i bromide,silver bromide, premion PubChem CID: 66199 IUPAC Name: bromosilver SMILES: Br[Ag]
| PubChem CID | 66199 |
|---|---|
| CAS | 7785-23-1 |
| Molecular Weight (g/mol) | 187.772 |
| MDL Number | MFCD00003398 |
| SMILES | Br[Ag] |
| Synonym | silver bromide,bromargyrite,bromyrite,nanoparticles,silver i bromide,silver bromide, premion |
| IUPAC Name | bromosilver |
| InChI Key | ADZWSOLPGZMUMY-UHFFFAOYSA-M |
| Molecular Formula | AgBr |
Chlorodimethylphenylsilane, 97+%
CAS: 768-33-2 Molecular Formula: C8H11ClSi Molecular Weight (g/mol): 170.71 MDL Number: MFCD00000499 InChI Key: KWYZNESIGBQHJK-UHFFFAOYSA-N Synonym: chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 PubChem CID: 13029 IUPAC Name: chloro-dimethyl-phenylsilane SMILES: C[Si](C)(Cl)C1=CC=CC=C1
| PubChem CID | 13029 |
|---|---|
| CAS | 768-33-2 |
| Molecular Weight (g/mol) | 170.71 |
| MDL Number | MFCD00000499 |
| SMILES | C[Si](C)(Cl)C1=CC=CC=C1 |
| Synonym | chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 |
| IUPAC Name | chloro-dimethyl-phenylsilane |
| InChI Key | KWYZNESIGBQHJK-UHFFFAOYSA-N |
| Molecular Formula | C8H11ClSi |
Boron trifluoride-Methanol Solution, ∼10 (∼1.3 M), MilliporeSigma™ Supelco™
MDL Number: MFCD00071635
| MDL Number | MFCD00071635 |
|---|
D-Pantothenic Acid, Calcium Salt, MP Biomedicals™
CAS: 137-08-6 Molecular Formula: C18H32CaN2O10 Molecular Weight (g/mol): 476.54 MDL Number: MFCD00002766 InChI Key: FAPWYRCQGJNNSJ-DXHDTSSINA-L Synonym: calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r PubChem CID: 131847364 IUPAC Name: calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) SMILES: [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O
| PubChem CID | 131847364 |
|---|---|
| CAS | 137-08-6 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Synonym | calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| IUPAC Name | calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| Molecular Formula | C18H32CaN2O10 |
Ytterbium(III) sulfate octahydrate, REacton™, 99.9% (REO)
CAS: 10034-98-7 Molecular Formula: H16O20S3Yb2 Molecular Weight (g/mol): 778.40 MDL Number: MFCD00149887 InChI Key: MDOSIOHMOWGVIM-UHFFFAOYSA-H Synonym: unii-e5w6do92vs,e5w6do92vs,3so4.2yb.8h2o,ytterbium sulfate,,ytterbium sulfate octahydrate,ytterbium sulfate,ytterbium iii sulfate octahydrate, reacton,diytterbium 3+ octahydrate trisulfate,sulfuric acid,ytterbium 3+ salt 3:2 , octahydrate 8ci,9ci PubChem CID: 25022290 SMILES: O.O.O.O.O.O.O.O.[Yb+3].[Yb+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| PubChem CID | 25022290 |
|---|---|
| CAS | 10034-98-7 |
| Molecular Weight (g/mol) | 778.40 |
| MDL Number | MFCD00149887 |
| SMILES | O.O.O.O.O.O.O.O.[Yb+3].[Yb+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | unii-e5w6do92vs,e5w6do92vs,3so4.2yb.8h2o,ytterbium sulfate,,ytterbium sulfate octahydrate,ytterbium sulfate,ytterbium iii sulfate octahydrate, reacton,diytterbium 3+ octahydrate trisulfate,sulfuric acid,ytterbium 3+ salt 3:2 , octahydrate 8ci,9ci |
| InChI Key | MDOSIOHMOWGVIM-UHFFFAOYSA-H |
| Molecular Formula | H16O20S3Yb2 |
Thermo Scientific Chemicals Dodecyl sulfate, sodium salt, 98%, for biochemistry, suitable for electrophoresis
CAS: 151-21-3 | C12H25NaO4S | 288.38 g/mol
| Linear Formula | CH3(CH2)11OSO3Na |
|---|---|
| Molecular Weight (g/mol) | 288.38 |
| Loss on Drying | 1% max. |
| ChEBI | CHEBI:8984 |
| Color | White |
| Physical Form | Fine Crystalline, Flaky or Granular Powder |
| Chemical Name or Material | Dodecyl sulfate, sodium salt |
| Grade | Biochemical |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Merck Index | 15, 8768 |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| PubChem CID | 3423265 |
| Percent Purity | 98% |
| Fieser | 13,281 |
| CAS | 7647-14-5 |
| Infrared Spectrum | Authentic |
| MDL Number | MFCD00036175 |
| Flash Point | >150°C |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| IUPAC Name | sodium dodecyl sulfate |
| Beilstein | 01, III, 1786 |
| Molecular Formula | C12H25NaO4S |
| Formula Weight | 288.38 |
| Melting Point | 206.0°C |
Potassium dichromate, 99+%, ACS reagent
CAS: 7778-50-9 MDL Number: MFCD00011367 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| ChEBI | CHEBI:53444 |
| MDL Number | MFCD00011367 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
Ethynylmagnesium bromide, 0.5M solution in THF, AcroSeal™
CAS: 4301-14-8 Molecular Formula: C2HBrMg Molecular Weight (g/mol): 129.24 MDL Number: MFCD00075342 InChI Key: HUGJUYPSXULVQQ-UHFFFAOYSA-M Synonym: ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent PubChem CID: 4071243 IUPAC Name: bromo(ethynyl)magnesium SMILES: Br[Mg]C#C
| PubChem CID | 4071243 |
|---|---|
| CAS | 4301-14-8 |
| Molecular Weight (g/mol) | 129.24 |
| MDL Number | MFCD00075342 |
| SMILES | Br[Mg]C#C |
| Synonym | ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent |
| IUPAC Name | bromo(ethynyl)magnesium |
| InChI Key | HUGJUYPSXULVQQ-UHFFFAOYSA-M |
| Molecular Formula | C2HBrMg |
| Boiling Point | 65.0°C |
|---|---|
| Linear Formula | BF3 |
| Molecular Weight (g/mol) | 67.81 |
| Chemical Name or Material | Boron trifluoride |
| SMILES | FB(F)F |
| InChI Key | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Density | 0.8700g/mL |
| PubChem CID | 11062313 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00011316 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Packaging | AcroSeal™ Glass bottle |
| Solubility Information | Solubility in water: may decompose |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| IUPAC Name | trifluoroborane |
| Molecular Formula | BF3 |
| EINECS Number | 206-766-4 |
| Formula Weight | 67.81 |
| Specific Gravity | 0.87 |
| Melting Point | -98.0°C |
| CAS | 13765-74-7 |
|---|---|
| MDL Number | MFCD00053384 |
| Synonym | Silver(I) molybdate |
Sodium nitrate, Puratronic™, 99.999% (metals basis)
CAS: 7631-99-4 Molecular Formula: NNaO3 Molecular Weight (g/mol): 84.99 MDL Number: MFCD00011119 InChI Key: VWDWKYIASSYTQR-UHFFFAOYSA-N Synonym: sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 PubChem CID: 24268 ChEBI: CHEBI:63005 IUPAC Name: sodium nitrate SMILES: [Na+].[O-][N+]([O-])=O
| PubChem CID | 24268 |
|---|---|
| CAS | 7631-99-4 |
| Molecular Weight (g/mol) | 84.99 |
| ChEBI | CHEBI:63005 |
| MDL Number | MFCD00011119 |
| SMILES | [Na+].[O-][N+]([O-])=O |
| Synonym | sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 |
| IUPAC Name | sodium nitrate |
| InChI Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Molecular Formula | NNaO3 |