Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
tert-Butyldimethylchlorosilane, 97%
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.721 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.721 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
3-(Trimethylsilyl)propargyl alcohol, 98%
CAS: 5272-36-6 Molecular Formula: C6H12OSi Molecular Weight (g/mol): 128.25 MDL Number: MFCD00002913 InChI Key: ZVGCJDPEKKEYES-UHFFFAOYSA-N Synonym: 3-trimethylsilyl-2-propyn-1-ol,3-trimethylsilyl propargyl alcohol,2-propyn-1-ol, 3-trimethylsilyl,3-trimethylsilyl prop-2-yn-1-ol,1-trimethylsilylpropargyl alcohol,acmc-209l1b,3-trimethylsilylpropargyl alcohol,3-trimethylsilanyl-prop-2-yn-1-ol,3-trimethylsilyl-2-propyn-1-ol # PubChem CID: 78930 IUPAC Name: 3-trimethylsilylprop-2-yn-1-ol SMILES: C[Si](C)(C)C#CCO
| PubChem CID | 78930 |
|---|---|
| CAS | 5272-36-6 |
| Molecular Weight (g/mol) | 128.25 |
| MDL Number | MFCD00002913 |
| SMILES | C[Si](C)(C)C#CCO |
| Synonym | 3-trimethylsilyl-2-propyn-1-ol,3-trimethylsilyl propargyl alcohol,2-propyn-1-ol, 3-trimethylsilyl,3-trimethylsilyl prop-2-yn-1-ol,1-trimethylsilylpropargyl alcohol,acmc-209l1b,3-trimethylsilylpropargyl alcohol,3-trimethylsilanyl-prop-2-yn-1-ol,3-trimethylsilyl-2-propyn-1-ol # |
| IUPAC Name | 3-trimethylsilylprop-2-yn-1-ol |
| InChI Key | ZVGCJDPEKKEYES-UHFFFAOYSA-N |
| Molecular Formula | C6H12OSi |
1,4-Bis(methoxydimethylsilyl)benzene, 97%
CAS: 131182-68-8 Molecular Formula: C12H22O2Si2 Molecular Weight (g/mol): 254.476 MDL Number: MFCD09266162 InChI Key: VQECZZRUEDMVCU-UHFFFAOYSA-N Synonym: 1,4-bis methoxydimethylsilyl benzene,methoxy 4-methoxydimethylsilyl phenyl dimethylsilane,amtsi067,1,4-phenylenebis methoxydimethylsilane,p-bis dimethylmethoxysilyl benzene,1,4-phenylene bis methoxy dimethyl silane,methoxy-4-methoxy dimethyl silyl phenyl-dimethylsilane PubChem CID: 21900341 IUPAC Name: methoxy-[4-[methoxy(dimethyl)silyl]phenyl]-dimethylsilane SMILES: CO[Si](C)(C)C1=CC=C(C=C1)[Si](C)(C)OC
| PubChem CID | 21900341 |
|---|---|
| CAS | 131182-68-8 |
| Molecular Weight (g/mol) | 254.476 |
| MDL Number | MFCD09266162 |
| SMILES | CO[Si](C)(C)C1=CC=C(C=C1)[Si](C)(C)OC |
| Synonym | 1,4-bis methoxydimethylsilyl benzene,methoxy 4-methoxydimethylsilyl phenyl dimethylsilane,amtsi067,1,4-phenylenebis methoxydimethylsilane,p-bis dimethylmethoxysilyl benzene,1,4-phenylene bis methoxy dimethyl silane,methoxy-4-methoxy dimethyl silyl phenyl-dimethylsilane |
| IUPAC Name | methoxy-[4-[methoxy(dimethyl)silyl]phenyl]-dimethylsilane |
| InChI Key | VQECZZRUEDMVCU-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2Si2 |
Vinyloxytrimethylsilane, 97%
CAS: 6213-94-1 Molecular Formula: C5H12OSi Molecular Weight (g/mol): 116.235 MDL Number: MFCD00054764 InChI Key: HFTNNOZFRQLFQB-UHFFFAOYSA-N Synonym: trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether PubChem CID: 80344 IUPAC Name: ethenoxy(trimethyl)silane SMILES: C[Si](C)(C)OC=C
| PubChem CID | 80344 |
|---|---|
| CAS | 6213-94-1 |
| Molecular Weight (g/mol) | 116.235 |
| MDL Number | MFCD00054764 |
| SMILES | C[Si](C)(C)OC=C |
| Synonym | trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether |
| IUPAC Name | ethenoxy(trimethyl)silane |
| InChI Key | HFTNNOZFRQLFQB-UHFFFAOYSA-N |
| Molecular Formula | C5H12OSi |
Silicon carbide, 99% (metals basis)
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 IUPAC Name: methanidylidynesilanylium SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| IUPAC Name | methanidylidynesilanylium |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
Boron carbide
CAS: 12069-32-8 Molecular Formula: CB4 Molecular Weight (g/mol): 55.25 MDL Number: MFCD00011520 InChI Key: INAHAJYZKVIDIZ-UHFFFAOYSA-N Synonym: boron carbide,boron carbide b4c,tetra 10b boron carbide,boron carbide, dust,tetrabor,boron carbide powder,boron carbide b4c grade hp,boron carbide b4c grade hs,b4-c,boron carbide b4c grade hd 07 PubChem CID: 123279 IUPAC Name: 2,3,4,5-tetraboratetracyclo[2.1.0.0¹,³.0²,⁵]pentane SMILES: B12B3B4B1C234
| PubChem CID | 123279 |
|---|---|
| CAS | 12069-32-8 |
| Molecular Weight (g/mol) | 55.25 |
| MDL Number | MFCD00011520 |
| SMILES | B12B3B4B1C234 |
| Synonym | boron carbide,boron carbide b4c,tetra 10b boron carbide,boron carbide, dust,tetrabor,boron carbide powder,boron carbide b4c grade hp,boron carbide b4c grade hs,b4-c,boron carbide b4c grade hd 07 |
| IUPAC Name | 2,3,4,5-tetraboratetracyclo[2.1.0.0¹,³.0²,⁵]pentane |
| InChI Key | INAHAJYZKVIDIZ-UHFFFAOYSA-N |
| Molecular Formula | CB4 |
Arsenic(III) sulfide, 99.9% (metals basis)
CAS: 1303-33-9 Molecular Formula: As2S3 Molecular Weight (g/mol): 246.02 MDL Number: MFCD00003435 InChI Key: CUGMJFZCCDSABL-UHFFFAOYSA-N IUPAC Name: diarsenic(3+) trisulfanediide SMILES: [S--].[S--].[S--].[As+3].[As+3]
| CAS | 1303-33-9 |
|---|---|
| Molecular Weight (g/mol) | 246.02 |
| MDL Number | MFCD00003435 |
| SMILES | [S--].[S--].[S--].[As+3].[As+3] |
| IUPAC Name | diarsenic(3+) trisulfanediide |
| InChI Key | CUGMJFZCCDSABL-UHFFFAOYSA-N |
| Molecular Formula | As2S3 |
Tungsten foil, 0.25mm (0.01in) thick, 99.95% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
| Name Note | 0.1mm (0.004 in.) dia. |
|---|---|
| Concentration or Composition (by Analyte or Components) | Au 99.99%, W 99.95% |
| Percent Purity | 99.95% |
| Form | Wire |
| MDL Number | MFCD00011461 |
| Chemical Name or Material | Tungsten wire, gold plated |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Assay Percent Notes | (metals basis) |
| Weight | ≈0.15g/m (W only), 3 to 5 wt% Au plating |
Antimony tribromide, 97%, pure
CAS: 7789-61-9 Molecular Formula: Br3Sb Molecular Weight (g/mol): 361.48 InChI Key: RPJGYLSSECYURW-UHFFFAOYSA-K Synonym: antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 PubChem CID: 24615 IUPAC Name: tribromostibane SMILES: Br[Sb](Br)Br
| PubChem CID | 24615 |
|---|---|
| CAS | 7789-61-9 |
| Molecular Weight (g/mol) | 361.48 |
| SMILES | Br[Sb](Br)Br |
| Synonym | antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 |
| IUPAC Name | tribromostibane |
| InChI Key | RPJGYLSSECYURW-UHFFFAOYSA-K |
| Molecular Formula | Br3Sb |
Vinyltriethylsilane, 97%
CAS: 1112-54-5 Molecular Formula: C8H18Si Molecular Weight (g/mol): 142.32 MDL Number: MFCD00041345 InChI Key: HBWGDHDXAMFADB-UHFFFAOYSA-N Synonym: vinyltriethylsilane,triethylvinylsilane,triethyl vinyl silane,vinyl triethyl silane,ethenyl-triethylsilane,triethylsilyl ethylene,ethenyl triethyl silane,pubchem13130,triethyl vinyl silane # PubChem CID: 559195 IUPAC Name: ethenyl(triethyl)silane SMILES: CC[Si](CC)(CC)C=C
| PubChem CID | 559195 |
|---|---|
| CAS | 1112-54-5 |
| Molecular Weight (g/mol) | 142.32 |
| MDL Number | MFCD00041345 |
| SMILES | CC[Si](CC)(CC)C=C |
| Synonym | vinyltriethylsilane,triethylvinylsilane,triethyl vinyl silane,vinyl triethyl silane,ethenyl-triethylsilane,triethylsilyl ethylene,ethenyl triethyl silane,pubchem13130,triethyl vinyl silane # |
| IUPAC Name | ethenyl(triethyl)silane |
| InChI Key | HBWGDHDXAMFADB-UHFFFAOYSA-N |
| Molecular Formula | C8H18Si |
Tungsten wire, 0.75mm (0.03in) dia, 99.95% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Silicon carbide powder, superfine, 600 grit
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
n-Hexyltrimethoxysilane, 97%
CAS: 3069-19-0 Molecular Formula: C9H22O3Si Molecular Weight (g/mol): 206.36 MDL Number: MFCD00039801 InChI Key: CZWLNMOIEMTDJY-UHFFFAOYSA-N Synonym: n-hexyltrimethoxysilane,silane, hexyltrimethoxy,unii-9aui936hic,hexyl trimethoxy silane,9aui936hic,hexyl-trimethoxysilane,acmc-209hhw,czwlnmoiemtdjy-uhfffaoysa PubChem CID: 76478 IUPAC Name: hexyl(trimethoxy)silane SMILES: CCCCCC[Si](OC)(OC)OC
| PubChem CID | 76478 |
|---|---|
| CAS | 3069-19-0 |
| Molecular Weight (g/mol) | 206.36 |
| MDL Number | MFCD00039801 |
| SMILES | CCCCCC[Si](OC)(OC)OC |
| Synonym | n-hexyltrimethoxysilane,silane, hexyltrimethoxy,unii-9aui936hic,hexyl trimethoxy silane,9aui936hic,hexyl-trimethoxysilane,acmc-209hhw,czwlnmoiemtdjy-uhfffaoysa |
| IUPAC Name | hexyl(trimethoxy)silane |
| InChI Key | CZWLNMOIEMTDJY-UHFFFAOYSA-N |
| Molecular Formula | C9H22O3Si |