Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium bromide, 99+%, extra pure, anhydrous
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 IUPAC Name: sodium bromide SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| IUPAC Name | sodium bromide |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Sodium metasilicate, anhydrous, tech.
CAS: 6834-92-0 Molecular Formula: Na2O3Si Molecular Weight (g/mol): 122.062 MDL Number: MFCD00003492 InChI Key: NTHWMYGWWRZVTN-UHFFFAOYSA-N Synonym: sodium metasilicate,sodium silicate,waterglass,water glass,sodium siliconate,sodium polysilicate,sodium sesquisilicate,sodium silicate glass,sodium silicate solution,sodium water glass PubChem CID: 23266 ChEBI: CHEBI:60720 IUPAC Name: disodium;dioxido(oxo)silane SMILES: [O-][Si](=O)[O-].[Na+].[Na+]
| PubChem CID | 23266 |
|---|---|
| CAS | 6834-92-0 |
| Molecular Weight (g/mol) | 122.062 |
| ChEBI | CHEBI:60720 |
| MDL Number | MFCD00003492 |
| SMILES | [O-][Si](=O)[O-].[Na+].[Na+] |
| Synonym | sodium metasilicate,sodium silicate,waterglass,water glass,sodium siliconate,sodium polysilicate,sodium sesquisilicate,sodium silicate glass,sodium silicate solution,sodium water glass |
| IUPAC Name | disodium;dioxido(oxo)silane |
| InChI Key | NTHWMYGWWRZVTN-UHFFFAOYSA-N |
| Molecular Formula | Na2O3Si |
Sodium bromide, 99.5%, for analysis
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Sodium phosphate, tribasic, pure, anhydrous
CAS: 7601-54-9 Molecular Formula: Na3O4P Molecular Weight (g/mol): 163.94 MDL Number: MFCD00003510 InChI Key: RYFMWSXOAZQYPI-UHFFFAOYSA-K Synonym: trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat PubChem CID: 24243 ChEBI: CHEBI:37583 IUPAC Name: trisodium;phosphate SMILES: [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 24243 |
|---|---|
| CAS | 7601-54-9 |
| Molecular Weight (g/mol) | 163.94 |
| ChEBI | CHEBI:37583 |
| MDL Number | MFCD00003510 |
| SMILES | [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat |
| IUPAC Name | trisodium;phosphate |
| InChI Key | RYFMWSXOAZQYPI-UHFFFAOYSA-K |
| Molecular Formula | Na3O4P |
Iron(III) sulfate hydrate, Reagent Grade
CAS: 15244-10-7 Molecular Formula: Fe2H2O13S3 Molecular Weight (g/mol): 417.87 MDL Number: MFCD00011007 InChI Key: VXWSFRMTBJZULV-UHFFFAOYSA-H PubChem CID: 167265 SMILES: O.[Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| PubChem CID | 167265 |
|---|---|
| CAS | 15244-10-7 |
| Molecular Weight (g/mol) | 417.87 |
| MDL Number | MFCD00011007 |
| SMILES | O.[Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| InChI Key | VXWSFRMTBJZULV-UHFFFAOYSA-H |
| Molecular Formula | Fe2H2O13S3 |
Potassium ferrocyanide trihydrate, 98.5%, ACS reagent
CAS: 14459-95-1 Molecular Formula: C6H6FeK4N6O3 Molecular Weight (g/mol): 422.39 MDL Number: MFCD00167023 InChI Key: NLYKFUFIUWPPIZ-UHFFFAOYSA-N Synonym: Potassium hexacyanoferrate(II) IUPAC Name: tetrapotassium hexacyanoironbis(ylium) trihydrate SMILES: O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N
| CAS | 14459-95-1 |
|---|---|
| Molecular Weight (g/mol) | 422.39 |
| MDL Number | MFCD00167023 |
| SMILES | O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | Potassium hexacyanoferrate(II) |
| IUPAC Name | tetrapotassium hexacyanoironbis(ylium) trihydrate |
| InChI Key | NLYKFUFIUWPPIZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6FeK4N6O3 |
Magnesium acetate tetrahydrate, ACS, 98.0-102.0%
CAS: 16674-78-5 Molecular Formula: C4H14MgO8 Molecular Weight (g/mol): 214.45 MDL Number: MFCD00149214 InChI Key: XKPKPGCRSHFTKM-UHFFFAOYSA-L Synonym: magnesium acetate tetrahydrate,cromosa,acetic acid, magnesium salt, tetrahydrate,unii-i01g0ejc3b,i01g0ejc3b,magnesium diacetate tetrahydrate,magnesium diethanoate tetrahydrate,acmc-20aklu,magnesiumacetatetetrahydrate,ksc497c8p PubChem CID: 134717 IUPAC Name: magnesium(2+) diacetate tetrahydrate SMILES: O.O.O.O.[Mg++].CC([O-])=O.CC([O-])=O
| PubChem CID | 134717 |
|---|---|
| CAS | 16674-78-5 |
| Molecular Weight (g/mol) | 214.45 |
| MDL Number | MFCD00149214 |
| SMILES | O.O.O.O.[Mg++].CC([O-])=O.CC([O-])=O |
| Synonym | magnesium acetate tetrahydrate,cromosa,acetic acid, magnesium salt, tetrahydrate,unii-i01g0ejc3b,i01g0ejc3b,magnesium diacetate tetrahydrate,magnesium diethanoate tetrahydrate,acmc-20aklu,magnesiumacetatetetrahydrate,ksc497c8p |
| IUPAC Name | magnesium(2+) diacetate tetrahydrate |
| InChI Key | XKPKPGCRSHFTKM-UHFFFAOYSA-L |
| Molecular Formula | C4H14MgO8 |
Hydrazine sulfate, ACS reagent
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
Calcium chloride, 93+%, extra pure, powder, anhydrous
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 MDL Number: MFCD00010903 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| MDL Number | MFCD00010903 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Copper(I) iodide, 99.995%, (trace metal basis)
CAS: 7681-65-4 Molecular Formula: CuI Molecular Weight (g/mol): 190.45 MDL Number: MFCD00010978 Synonym: cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g
| CAS | 7681-65-4 |
|---|---|
| Molecular Weight (g/mol) | 190.45 |
| MDL Number | MFCD00010978 |
| Synonym | cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g |
| Molecular Formula | CuI |
Bismuth(III) nitrate pentahydrate, 98%
CAS: 10035-06-0 Molecular Formula: BiH10N3O14 Molecular Weight (g/mol): 485.07 MDL Number: MFCD00149157 InChI Key: FBXVOTBTGXARNA-UHFFFAOYSA-N Synonym: bismuth nitrate pentahydrate,bismuth trinitrate pentahydrate,bismuth nitrate, hydrate 1:5,bismuth iii nitrate pentahydrate,unii-fo2icy167b,fo2icy167b,nitric acid, bismuth 3+ salt, pentahydrate,acmc-20alle,bismuthnitratepentahydrate PubChem CID: 160911 IUPAC Name: bismuth;trinitrate;pentahydrate SMILES: O.O.O.O.O.[Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 160911 |
|---|---|
| CAS | 10035-06-0 |
| Molecular Weight (g/mol) | 485.07 |
| MDL Number | MFCD00149157 |
| SMILES | O.O.O.O.O.[Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | bismuth nitrate pentahydrate,bismuth trinitrate pentahydrate,bismuth nitrate, hydrate 1:5,bismuth iii nitrate pentahydrate,unii-fo2icy167b,fo2icy167b,nitric acid, bismuth 3+ salt, pentahydrate,acmc-20alle,bismuthnitratepentahydrate |
| IUPAC Name | bismuth;trinitrate;pentahydrate |
| InChI Key | FBXVOTBTGXARNA-UHFFFAOYSA-N |
| Molecular Formula | BiH10N3O14 |
Iron(II) sulfate heptahydrate, 99+%, ACS reagent
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Copper(II) nitrate trihydrate, 99%, pure
CAS: 10031-43-3 Molecular Formula: CuN2O6·3H2O Molecular Weight (g/mol): 241.6 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| Molecular Weight (g/mol) | 241.6 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
| Molecular Formula | CuN2O6·3H2O |
Potassium dichromate, 99%
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.182 MDL Number: MFCD00011367 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.182 |
| ChEBI | CHEBI:53444 |
| MDL Number | MFCD00011367 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Titanium(III) chloride, 20%w/v solution in 2N Hydrochloric acid,AcroSeal™
CAS: 7705-07-9 | Cl3Ti | 154.22 g/mol
| CAS | 7705-07-9 |
|---|---|
| Molecular Weight (g/mol) | 154.22 |
| MDL Number | MFCD00011266 |
| SMILES | [Cl-].[Cl-].[Cl-].[Ti+3] |
| Synonym | Titanous chloride |
| IUPAC Name | titanium(3+) trichloride |
| InChI Key | YONPGGFAJWQGJC-UHFFFAOYSA-K |
| Molecular Formula | Cl3Ti |