Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Cobalt(II) nitrate hexahydrate, 99%, pure
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Potassium phosphate, dibasic, 99+%, for analysis, anhydrous
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.18 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
Ammonium metavanadate, 99.5%, for analysis
CAS: 7803-55-6 Molecular Formula: H4NO3V Molecular Weight (g/mol): 116.98 MDL Number: MFCD00011430 InChI Key: YBVKNHXQSRDWAA-UHFFFAOYSA-M Synonym: ammonium metavanadate,ammonium vanadate v,ammonium monovanadate,unii-fl85px638g,vanadate vo31-, ammonium,vanadate vo31-, ammonium 1:1,ammonium vanadium oxide,ammoniummetavanadate,vanadic acid, hvo3 , ammonium salt,ammonium meta-vanadate PubChem CID: 516859 SMILES: N.O[V](=O)=O
| PubChem CID | 516859 |
|---|---|
| CAS | 7803-55-6 |
| Molecular Weight (g/mol) | 116.98 |
| MDL Number | MFCD00011430 |
| SMILES | N.O[V](=O)=O |
| Synonym | ammonium metavanadate,ammonium vanadate v,ammonium monovanadate,unii-fl85px638g,vanadate vo31-, ammonium,vanadate vo31-, ammonium 1:1,ammonium vanadium oxide,ammoniummetavanadate,vanadic acid, hvo3 , ammonium salt,ammonium meta-vanadate |
| InChI Key | YBVKNHXQSRDWAA-UHFFFAOYSA-M |
| Molecular Formula | H4NO3V |
Chromium(II) chloride, anhydrous, 97%
CAS: 10049-05-5 Molecular Formula: CrCl2 MDL Number: MFCD00010947 Synonym: Chromous chloride
| CAS | 10049-05-5 |
|---|---|
| MDL Number | MFCD00010947 |
| Synonym | Chromous chloride |
| Molecular Formula | CrCl2 |
Titanium carbide, 99.5% (metals basis)
CAS: 12070-08-5 Molecular Formula: CTi Molecular Weight (g/mol): 59.88 MDL Number: MFCD00011268 InChI Key: YXIVWSJCLXKLJL-UHFFFAOYSA-N IUPAC Name: methanidylidynetitaniumylium SMILES: [C-]#[Ti+]
| CAS | 12070-08-5 |
|---|---|
| Molecular Weight (g/mol) | 59.88 |
| MDL Number | MFCD00011268 |
| SMILES | [C-]#[Ti+] |
| IUPAC Name | methanidylidynetitaniumylium |
| InChI Key | YXIVWSJCLXKLJL-UHFFFAOYSA-N |
| Molecular Formula | CTi |
Silicone oil, high temperature, usable temperature range: 25 to 250°C (open system) and 25 to 315°C (closed system)
CAS: 68083-14-7 Molecular Formula: C16H22O2Si2 Molecular Weight (g/mol): 302.52 MDL Number: MFCD00132673 InChI Key: ARWRSWALIGRKQA-UHFFFAOYSA-N Synonym: diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. PubChem CID: 121233058 IUPAC Name: methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane SMILES: CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 121233058 |
|---|---|
| CAS | 68083-14-7 |
| Molecular Weight (g/mol) | 302.52 |
| MDL Number | MFCD00132673 |
| SMILES | CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. |
| IUPAC Name | methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
| InChI Key | ARWRSWALIGRKQA-UHFFFAOYSA-N |
| Molecular Formula | C16H22O2Si2 |
Sodium bicarbonate, 99.5%, for analysis
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Sodium dihydrogen phosphate monohydrate, ACS, 98.0-102.0%
CAS: 10049-21-5 Molecular Formula: H2NaO4P x H2O Molecular Weight (g/mol): 137.99 MDL Number: MFCD00149208 InChI Key: BBMHARZCALWXSL-UHFFFAOYSA-N Synonym: sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 PubChem CID: 516949 SMILES: O.[Na+].OP(O)(O)=O
| PubChem CID | 516949 |
|---|---|
| CAS | 10049-21-5 |
| Molecular Weight (g/mol) | 137.99 |
| MDL Number | MFCD00149208 |
| SMILES | O.[Na+].OP(O)(O)=O |
| Synonym | sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 |
| InChI Key | BBMHARZCALWXSL-UHFFFAOYSA-N |
| Molecular Formula | H2NaO4P x H2O |
Zinc sulfate heptahydrate, 99%, ACS reagent
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Potassium sulfate, 99+%, for analysis, anhydrous powder
CAS: 7778-80-5 Molecular Formula: K2O4S Molecular Weight (g/mol): 174.25 MDL Number: MFCD00011388 InChI Key: OTYBMLCTZGSZBG-UHFFFAOYSA-L Synonym: potassium sulfate,dipotassium sulfate,potassium sulphate,sulfuric acid dipotassium salt,sal polychrestum,sulfuric acid, potassium salt,arcanum duplicatum,kalium sulphuricum,caswell no. 702,sulfuric acid, dipotassium salt PubChem CID: 24507 ChEBI: CHEBI:32036 SMILES: [K+].[K+].[O-]S([O-])(=O)=O
| PubChem CID | 24507 |
|---|---|
| CAS | 7778-80-5 |
| Molecular Weight (g/mol) | 174.25 |
| ChEBI | CHEBI:32036 |
| MDL Number | MFCD00011388 |
| SMILES | [K+].[K+].[O-]S([O-])(=O)=O |
| Synonym | potassium sulfate,dipotassium sulfate,potassium sulphate,sulfuric acid dipotassium salt,sal polychrestum,sulfuric acid, potassium salt,arcanum duplicatum,kalium sulphuricum,caswell no. 702,sulfuric acid, dipotassium salt |
| InChI Key | OTYBMLCTZGSZBG-UHFFFAOYSA-L |
| Molecular Formula | K2O4S |
Calcium chloride, anhydrous, ACS, 96.0% min
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 MDL Number: MFCD00010903 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 IUPAC Name: calcium dichloride SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| MDL Number | MFCD00010903 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| IUPAC Name | calcium dichloride |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Lithium bromide, 99+%, for analysis, anhydrous
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.84 MDL Number: MFCD00011077 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Synonym: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| PubChem CID | 82050 |
|---|---|
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.84 |
| ChEBI | CHEBI:63042 |
| MDL Number | MFCD00011077 |
| SMILES | [Li+].[Br-] |
| Synonym | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
Sodium Metasilicate, MP Biomedicals
CAS: 13517-24-3 Molecular Formula: H18Na2O12Si Molecular Weight (g/mol): 284.197 InChI Key: PHIQPXBZDGYJOG-UHFFFAOYSA-N Synonym: sodium metasilicate nonahydrate,unii-d8d44215lz,sodium silicate nonahydrate,silicic acid h2sio3 , disodium salt, nonahydrate,disodium oxosilanebis olate nonahydrate,2na.so3i.9h2o,sodium meta-silicate nonahydrate,disodium oxosilanediolate nonahydrate,disodium dioxido oxo silane nonahydrate,sodium oxosilanebis olate-water 1/9 PubChem CID: 61639 IUPAC Name: disodium;dioxido(oxo)silane;nonahydrate SMILES: O.O.O.O.O.O.O.O.O.[O-][Si](=O)[O-].[Na+].[Na+]
| PubChem CID | 61639 |
|---|---|
| CAS | 13517-24-3 |
| Molecular Weight (g/mol) | 284.197 |
| SMILES | O.O.O.O.O.O.O.O.O.[O-][Si](=O)[O-].[Na+].[Na+] |
| Synonym | sodium metasilicate nonahydrate,unii-d8d44215lz,sodium silicate nonahydrate,silicic acid h2sio3 , disodium salt, nonahydrate,disodium oxosilanebis olate nonahydrate,2na.so3i.9h2o,sodium meta-silicate nonahydrate,disodium oxosilanediolate nonahydrate,disodium dioxido oxo silane nonahydrate,sodium oxosilanebis olate-water 1/9 |
| IUPAC Name | disodium;dioxido(oxo)silane;nonahydrate |
| InChI Key | PHIQPXBZDGYJOG-UHFFFAOYSA-N |
| Molecular Formula | H18Na2O12Si |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |