Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Cadmium chloride hemipentahydrate, ACS, 79.5-81.0%
CAS: 7790-78-5 Molecular Weight (g/mol): 563.984 MDL Number: MFCD00799071 InChI Key: GUGHGUXZJWAIAS-QQYBVWGSSA-N Synonym: daunorubicin hydrochloride,daunorubicin hcl,daunomycin hydrochloride,daunoblastina,rubidomycin hydrochloride,daunorubicinol hydrochloride,daunoblastin,rubomycin,ondena,daunomycin chlorohydrate PubChem CID: 62770 IUPAC Name: (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride SMILES: CC1C(C(CC(O1)OC2CC(CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)N)O.Cl
| PubChem CID | 62770 |
|---|---|
| CAS | 7790-78-5 |
| Molecular Weight (g/mol) | 563.984 |
| MDL Number | MFCD00799071 |
| SMILES | CC1C(C(CC(O1)OC2CC(CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)N)O.Cl |
| Synonym | daunorubicin hydrochloride,daunorubicin hcl,daunomycin hydrochloride,daunoblastina,rubidomycin hydrochloride,daunorubicinol hydrochloride,daunoblastin,rubomycin,ondena,daunomycin chlorohydrate |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| InChI Key | GUGHGUXZJWAIAS-QQYBVWGSSA-N |
Iron(II,III) oxide, 97% (metals basis)
CAS: 1317-61-9 Molecular Formula: Fe3O4 Molecular Weight (g/mol): 231.53 MDL Number: MFCD00011010 InChI Key: WTFXARWRTYJXII-UHFFFAOYSA-N Synonym: Ferrosoferric oxide,Ferric ferrous oxide IUPAC Name: diiron(3+) λ²-iron(2+) tetraoxidandiide SMILES: [O--].[O--].[O--].[O--].[Fe++].[Fe+3].[Fe+3]
| CAS | 1317-61-9 |
|---|---|
| Molecular Weight (g/mol) | 231.53 |
| MDL Number | MFCD00011010 |
| SMILES | [O--].[O--].[O--].[O--].[Fe++].[Fe+3].[Fe+3] |
| Synonym | Ferrosoferric oxide,Ferric ferrous oxide |
| IUPAC Name | diiron(3+) λ²-iron(2+) tetraoxidandiide |
| InChI Key | WTFXARWRTYJXII-UHFFFAOYSA-N |
| Molecular Formula | Fe3O4 |
Zinc Sulfate, Heptahydrate, Crystal, ACS, 99.0-103.0%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L IUPAC Name: zinc(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| CAS | 7446-20-0 |
|---|---|
| Molecular Weight (g/mol) | 287.54 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| IUPAC Name | zinc(2+) heptahydrate sulfate |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Aluminum silicate
CAS: 12428-46-5 Molecular Formula: Al2H4O9Si2 Molecular Weight (g/mol): 258.16 MDL Number: MFCD00062311 InChI Key: NLYAJNPCOHFWQQ-UHFFFAOYSA-N Synonym: kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss PubChem CID: 56841936 IUPAC Name: oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate SMILES: O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O
| PubChem CID | 56841936 |
|---|---|
| CAS | 12428-46-5 |
| Molecular Weight (g/mol) | 258.16 |
| MDL Number | MFCD00062311 |
| SMILES | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
| Synonym | kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss |
| IUPAC Name | oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
| InChI Key | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| Molecular Formula | Al2H4O9Si2 |
Tantalum(V) oxide, 99% (metals basis)
CAS: 1314-61-0 Molecular Formula: O5Ta2 Molecular Weight (g/mol): 441.89 MDL Number: MFCD00011254 InChI Key: PBCFLUZVCVVTBY-UHFFFAOYSA-N Synonym: Tantalum pentoxide IUPAC Name: [(dioxotantalio)oxy]dioxotantalum SMILES: O=[Ta](=O)O[Ta](=O)=O
| CAS | 1314-61-0 |
|---|---|
| Molecular Weight (g/mol) | 441.89 |
| MDL Number | MFCD00011254 |
| SMILES | O=[Ta](=O)O[Ta](=O)=O |
| Synonym | Tantalum pentoxide |
| IUPAC Name | [(dioxotantalio)oxy]dioxotantalum |
| InChI Key | PBCFLUZVCVVTBY-UHFFFAOYSA-N |
| Molecular Formula | O5Ta2 |
Antimony powder, -200 mesh, 99.999% (metals basis)
CAS: 7440-36-0 Molecular Formula: Sb Molecular Weight (g/mol): 121.76 MDL Number: MFCD00011211 MFCD00134030 InChI Key: WATWJIUSRGPENY-UHFFFAOYSA-N Synonym: powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german PubChem CID: 5354495 ChEBI: CHEBI:30304 IUPAC Name: antimony SMILES: [Sb]
| PubChem CID | 5354495 |
|---|---|
| CAS | 7440-36-0 |
| Molecular Weight (g/mol) | 121.76 |
| ChEBI | CHEBI:30304 |
| MDL Number | MFCD00011211 MFCD00134030 |
| SMILES | [Sb] |
| Synonym | powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german |
| IUPAC Name | antimony |
| InChI Key | WATWJIUSRGPENY-UHFFFAOYSA-N |
| Molecular Formula | Sb |
| Form | Rod |
|---|---|
| Chemical Name or Material | Al-23 Solid Rod |
| TSCA | U |
| Recommended Storage | Ambient temperatures |
Aluminum slug, 6.35mm (0.25in) dia x 6.35mm (0.25in) length, 99.99% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Zirconium slug, 3.175mm (0.125in) dia x 6.35mm (0.25in) length, 99.95% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Tungsten powder, -200+325 mesh, 99.95% (metals basis), Thermo Scientific Chemicals
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Zirconium slug, 6.35mm (0.25in) dia x 12.7mm (0.50in) length, 99.95% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Zinc wire, 0.25mm (0.01in) dia, 99.95% (metals basis)
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Silicon(IV) oxide, Amorphous fumed, S.A. 175 to 225m2/g
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Chromium granules, -4+7 mesh, 99.999% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
Potassium Alum, Dodecahydrate, Powder, USP, 99-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7784-24-9 Molecular Formula: AlH24KO20S2 Molecular Weight (g/mol): 474.37 InChI Key: GNHOJBNSNUXZQA-UHFFFAOYSA-J IUPAC Name: aluminum(3+) potassium dodecahydrate disulfate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7784-24-9 |
|---|---|
| Molecular Weight (g/mol) | 474.37 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| IUPAC Name | aluminum(3+) potassium dodecahydrate disulfate |
| InChI Key | GNHOJBNSNUXZQA-UHFFFAOYSA-J |
| Molecular Formula | AlH24KO20S2 |