Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Zirconium slug, 3.175mm (0.125in) dia x 3.175mm (0.125in) length, 99.5% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Zirconium slug, 3.175mm (0.125in) dia x 3.175mm (0.125in) length, 99.9+% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Galena, naturally occurring mineral, approximately 1-2in
CAS: 1314-87-0 Molecular Formula: PbS Molecular Weight (g/mol): 239.30 MDL Number: MFCD00016280 InChI Key: FILXVLQXZYXBSJ-UHFFFAOYSA-N Synonym: lead ii sulfide,lead sulfide,galena,lead monosulfide,plumbous sulfide,lead 2+ sulfide,natural galena,lead sulphide,natural lead sulfide PubChem CID: 14819 IUPAC Name: sulfanylidenelead SMILES: [S--].[Pb++]
| PubChem CID | 14819 |
|---|---|
| CAS | 1314-87-0 |
| Molecular Weight (g/mol) | 239.30 |
| MDL Number | MFCD00016280 |
| SMILES | [S--].[Pb++] |
| Synonym | lead ii sulfide,lead sulfide,galena,lead monosulfide,plumbous sulfide,lead 2+ sulfide,natural galena,lead sulphide,natural lead sulfide |
| IUPAC Name | sulfanylidenelead |
| InChI Key | FILXVLQXZYXBSJ-UHFFFAOYSA-N |
| Molecular Formula | PbS |
Zirconium slug, 6.35mm (0.25 in.) dia. x 6.35mm (0.25 in.) length, 99.95% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Niobium slug, 3.175mm (0.125in) dia x 3.175mm (0.125in) length, 99.95% (metals basis excluding Ta)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Vanadium slug, 3.175mm (0.125in) dia x 6.35mm (0.25in) length, 99.8% (metals basis)
CAS: 7440-62-2 Molecular Formula: V Molecular Weight (g/mol): 50.94 MDL Number: MFCD00011453 InChI Key: LEONUFNNVUYDNQ-UHFFFAOYSA-N Synonym: dust,vanadium, elemental,ion,iii,1+ , ion,vanadium, ion 3+,fume or dust,vanadium, ion v5+,unii-00j9j9xkde,00j9j9xkde PubChem CID: 23990 ChEBI: CHEBI:35170 IUPAC Name: vanadium SMILES: [V]
| PubChem CID | 23990 |
|---|---|
| CAS | 7440-62-2 |
| Molecular Weight (g/mol) | 50.94 |
| ChEBI | CHEBI:35170 |
| MDL Number | MFCD00011453 |
| SMILES | [V] |
| Synonym | dust,vanadium, elemental,ion,iii,1+ , ion,vanadium, ion 3+,fume or dust,vanadium, ion v5+,unii-00j9j9xkde,00j9j9xkde |
| IUPAC Name | vanadium |
| InChI Key | LEONUFNNVUYDNQ-UHFFFAOYSA-N |
| Molecular Formula | V |
Tantalum wire, 1.5mm (0.06in) dia, annealed, 99.95% (metals basis)
CAS: 7440-25-7 Molecular Formula: Ta Molecular Weight (g/mol): 180.95 MDL Number: MFCD00011252 InChI Key: GUVRBAGPIYLISA-UHFFFAOYSA-N Synonym: tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod PubChem CID: 23956 ChEBI: CHEBI:33348 IUPAC Name: tantalum SMILES: [Ta]
| PubChem CID | 23956 |
|---|---|
| CAS | 7440-25-7 |
| Molecular Weight (g/mol) | 180.95 |
| ChEBI | CHEBI:33348 |
| MDL Number | MFCD00011252 |
| SMILES | [Ta] |
| Synonym | tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod |
| IUPAC Name | tantalum |
| InChI Key | GUVRBAGPIYLISA-UHFFFAOYSA-N |
| Molecular Formula | Ta |
Yttrium(III) oxide, REacton™, 99.9999% (REO)
CAS: 1314-36-9 Molecular Formula: O3Y2 Molecular Weight (g/mol): 225.81 MDL Number: MFCD00011473 InChI Key: RUDFQVOCFDJEEF-UHFFFAOYSA-N IUPAC Name: diyttrium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Y+3].[Y+3]
| CAS | 1314-36-9 |
|---|---|
| Molecular Weight (g/mol) | 225.81 |
| MDL Number | MFCD00011473 |
| SMILES | [O--].[O--].[O--].[Y+3].[Y+3] |
| IUPAC Name | diyttrium(3+) trioxidandiide |
| InChI Key | RUDFQVOCFDJEEF-UHFFFAOYSA-N |
| Molecular Formula | O3Y2 |
Palladium(II) chloride, Premion™, 99.999% (metals basis), Pd 59.5% min
CAS: 7647-10-1 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L Synonym: palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-10-1 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| Synonym | palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Ammonium hexachloroosmate(IV), 99.9% (metals basis), Os 42.5% min
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 IUPAC Name: diazanium;hexachloroosmium(2-) SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| IUPAC Name | diazanium;hexachloroosmium(2-) |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |
| Form | Powder |
|---|---|
| MDL Number | MFCD00148499 |
| Solubility Information | Insoluble in water. |
| Chemical Name or Material | Stainless Steel powder, Type 316 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Mesh Size | −40+80 Mesh |
| Avg. Mol. Wt. or Mol. Wt. Range | Fe:Cr:Ni:Mo; 67.5:17:13:2.5 wt% |
Aluminum Powder, -100+325 mesh, 99.97% (Metals basis), Thermo Scientific Chemicals
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminium SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminium |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Niobium slug, 6.35mm (0.25in) dia x 6.35mm (0.25in) length, 99.95% (metals basis excluding Ta)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Iridium(IV) oxide dihydrate, Premion™, 99.99% (metals basis), Ir 73% min
CAS: 30980-84-8 Molecular Formula: H2IrO3 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00011065 InChI Key: YEPXCFHWKVNVAX-UHFFFAOYSA-N Synonym: iridium iv oxide hydrate,iro2.h2o,dioxoiridium hydrate,dioxoiridium-water 1/1,iridium iv oxide hydrate trace metals basis PubChem CID: 16212540 IUPAC Name: dioxoiridium;hydrate SMILES: O.O=[Ir]=O
| PubChem CID | 16212540 |
|---|---|
| CAS | 30980-84-8 |
| Molecular Weight (g/mol) | 242.23 |
| MDL Number | MFCD00011065 |
| SMILES | O.O=[Ir]=O |
| Synonym | iridium iv oxide hydrate,iro2.h2o,dioxoiridium hydrate,dioxoiridium-water 1/1,iridium iv oxide hydrate trace metals basis |
| IUPAC Name | dioxoiridium;hydrate |
| InChI Key | YEPXCFHWKVNVAX-UHFFFAOYSA-N |
| Molecular Formula | H2IrO3 |
Aluminum dihydrogen phosphate, 50% w/w aqueous solution, Thermo Scientific Chemicals
CAS: 13530-50-2 Molecular Formula: AlH6O12P3 Molecular Weight (g/mol): 317.94 MDL Number: MFCD00014152 InChI Key: RGPUVZXXZFNFBF-UHFFFAOYSA-K Synonym: aluminum dihydrogen phosphate,aluminum phosphate monobasic,prim-aluminum phosphate,aluminum tris dihydrogen phosphate,phosphoric acid, aluminum salt 3:1,aluminum hydrogen phosphate,aluminumdihydrogen phosphate,aluminum phosphate,monobasic,aluminum trisdihydrogenphosphate,aluminum dihydrogen orthophosphate PubChem CID: 9818426 IUPAC Name: aluminum;dihydrogen phosphate SMILES: [Al+3].OP(O)([O-])=O.OP(O)([O-])=O.OP(O)([O-])=O
| PubChem CID | 9818426 |
|---|---|
| CAS | 13530-50-2 |
| Molecular Weight (g/mol) | 317.94 |
| MDL Number | MFCD00014152 |
| SMILES | [Al+3].OP(O)([O-])=O.OP(O)([O-])=O.OP(O)([O-])=O |
| Synonym | aluminum dihydrogen phosphate,aluminum phosphate monobasic,prim-aluminum phosphate,aluminum tris dihydrogen phosphate,phosphoric acid, aluminum salt 3:1,aluminum hydrogen phosphate,aluminumdihydrogen phosphate,aluminum phosphate,monobasic,aluminum trisdihydrogenphosphate,aluminum dihydrogen orthophosphate |
| IUPAC Name | aluminum;dihydrogen phosphate |
| InChI Key | RGPUVZXXZFNFBF-UHFFFAOYSA-K |
| Molecular Formula | AlH6O12P3 |