Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Pentamethyldisiloxane, 95%
CAS: 1438-82-0 Molecular Formula: C5H15OSi2 Molecular Weight (g/mol): 147.344 MDL Number: MFCD00053658 InChI Key: XUKFPAQLGOOCNJ-UHFFFAOYSA-N Synonym: pentamethyldisiloxane,disiloxane, pentamethyl,1,1,1,3,3-pentamethyldisiloxane,dimethyl trimethylsilyloxy silicon,disiloxane, 1,1,1,3,3-pentamethyl,dimethyl trimethylsilyl oxy silyl,dimethylsilyl oxy trimethylsilane PubChem CID: 6327260 IUPAC Name: dimethyl(trimethylsilyloxy)silicon SMILES: C[Si](C)O[Si](C)(C)C
| PubChem CID | 6327260 |
|---|---|
| CAS | 1438-82-0 |
| Molecular Weight (g/mol) | 147.344 |
| MDL Number | MFCD00053658 |
| SMILES | C[Si](C)O[Si](C)(C)C |
| Synonym | pentamethyldisiloxane,disiloxane, pentamethyl,1,1,1,3,3-pentamethyldisiloxane,dimethyl trimethylsilyloxy silicon,disiloxane, 1,1,1,3,3-pentamethyl,dimethyl trimethylsilyl oxy silyl,dimethylsilyl oxy trimethylsilane |
| IUPAC Name | dimethyl(trimethylsilyloxy)silicon |
| InChI Key | XUKFPAQLGOOCNJ-UHFFFAOYSA-N |
| Molecular Formula | C5H15OSi2 |
Silicon(IV) oxide, 99.0% (metals basis)
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Silicon carbide powder, medium, 120 grit
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
| MDL Number | MFCD00008259 |
|---|---|
| Synonym | HMDS |
Arsenic(III) iodide, 99.999% (metals basis)
CAS: 7784-45-4 Molecular Formula: AsI3 Molecular Weight (g/mol): 455.635 MDL Number: MFCD00014170 InChI Key: IKIBSPLDJGAHPX-UHFFFAOYSA-N Synonym: arsenous triiodide,arsenic iii iodide,arsenic iodide,arsenic triiodide,triiodoarsine,arsenous iodide,hsdb 420,arsen iii-jodid PubChem CID: 24575 IUPAC Name: triiodoarsane SMILES: [As](I)(I)I
| PubChem CID | 24575 |
|---|---|
| CAS | 7784-45-4 |
| Molecular Weight (g/mol) | 455.635 |
| MDL Number | MFCD00014170 |
| SMILES | [As](I)(I)I |
| Synonym | arsenous triiodide,arsenic iii iodide,arsenic iodide,arsenic triiodide,triiodoarsine,arsenous iodide,hsdb 420,arsen iii-jodid |
| IUPAC Name | triiodoarsane |
| InChI Key | IKIBSPLDJGAHPX-UHFFFAOYSA-N |
| Molecular Formula | AsI3 |
| CAS | 7757-82-6 |
|---|---|
| Health Hazard 3 | GHS P Statement Avoid release to the environment. |
| MDL Number | MFCD00147338 |
| Health Hazard 2 | GHS H Statement Harmful to aquatic life with long lasting effects. |
| Packaging | Plastic bottle |
| Chemical Name or Material | Kjeldahl tablets with selenium (Wieninger) |
| EINECS Number | 231-957-4 |
Phenyltriethoxysilane, 98%
CAS: 780-69-8 Molecular Formula: C12H20O3Si Molecular Weight (g/mol): 240.37 MDL Number: MFCD00009065 InChI Key: JCVQKRGIASEUKR-UHFFFAOYSA-N Synonym: phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 PubChem CID: 13075 IUPAC Name: triethoxy(phenyl)silane SMILES: CCO[Si](OCC)(OCC)C1=CC=CC=C1
| PubChem CID | 13075 |
|---|---|
| CAS | 780-69-8 |
| Molecular Weight (g/mol) | 240.37 |
| MDL Number | MFCD00009065 |
| SMILES | CCO[Si](OCC)(OCC)C1=CC=CC=C1 |
| Synonym | phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 |
| IUPAC Name | triethoxy(phenyl)silane |
| InChI Key | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Molecular Formula | C12H20O3Si |
Boron silicide, 98% (metals basis)
CAS: 12008-29-6 Molecular Formula: B6Si Molecular Weight (g/mol): 92.95 MDL Number: MFCD00180907 InChI Key: ZRBFEDMQRDRUDG-UHFFFAOYSA-N Synonym: silicon hexaboride,1-sila-2,3,4,5,6,7-hexaborapentacyclo 3.2.0.0 1 ,?.0 2 ,?.0 3 ,? heptane,silicon hexaboride sib6 grade PubChem CID: 16212548 IUPAC Name: 1-sila-2,3,4,5,6,7-hexaborapentacyclo[3.2.0.0¹,⁴.0²,⁷.0³,⁶]heptane SMILES: B12B3B4B5B(B14)[Si]235
| PubChem CID | 16212548 |
|---|---|
| CAS | 12008-29-6 |
| Molecular Weight (g/mol) | 92.95 |
| MDL Number | MFCD00180907 |
| SMILES | B12B3B4B5B(B14)[Si]235 |
| Synonym | silicon hexaboride,1-sila-2,3,4,5,6,7-hexaborapentacyclo 3.2.0.0 1 ,?.0 2 ,?.0 3 ,? heptane,silicon hexaboride sib6 grade |
| IUPAC Name | 1-sila-2,3,4,5,6,7-hexaborapentacyclo[3.2.0.0¹,⁴.0²,⁷.0³,⁶]heptane |
| InChI Key | ZRBFEDMQRDRUDG-UHFFFAOYSA-N |
| Molecular Formula | B6Si |
1-Phenyl-3-trimethylsilyl-2-propyn-1-ol, 97%
CAS: 89530-34-7 Molecular Formula: C12H16OSi Molecular Weight (g/mol): 204.344 MDL Number: MFCD05864336 InChI Key: RVTDALNDYLDVMN-UHFFFAOYSA-N Synonym: 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol PubChem CID: 2760416 IUPAC Name: 1-phenyl-3-trimethylsilylprop-2-yn-1-ol SMILES: C[Si](C)(C)C#CC(C1=CC=CC=C1)O
| PubChem CID | 2760416 |
|---|---|
| CAS | 89530-34-7 |
| Molecular Weight (g/mol) | 204.344 |
| MDL Number | MFCD05864336 |
| SMILES | C[Si](C)(C)C#CC(C1=CC=CC=C1)O |
| Synonym | 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol |
| IUPAC Name | 1-phenyl-3-trimethylsilylprop-2-yn-1-ol |
| InChI Key | RVTDALNDYLDVMN-UHFFFAOYSA-N |
| Molecular Formula | C12H16OSi |
Diethoxydiphenylsilane, 98%
CAS: 2553-19-7 Molecular Formula: C16H20O2Si Molecular Weight (g/mol): 272.42 MDL Number: MFCD00015126 InChI Key: ZZNQQQWFKKTOSD-UHFFFAOYSA-N Synonym: diphenyldiethoxysilane,silane, diethoxydiphenyl,diethoxy diphenyl silane,benzene, 1,1'-diethoxysilylene bis,acmc-1cmgu,diethoxy-di phenyl silane,diethoxydiphenylsilane,zznqqqwfkktosd-uhfffaoysa PubChem CID: 75705 IUPAC Name: diethoxy(diphenyl)silane SMILES: CCO[Si](OCC)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 75705 |
|---|---|
| CAS | 2553-19-7 |
| Molecular Weight (g/mol) | 272.42 |
| MDL Number | MFCD00015126 |
| SMILES | CCO[Si](OCC)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyldiethoxysilane,silane, diethoxydiphenyl,diethoxy diphenyl silane,benzene, 1,1'-diethoxysilylene bis,acmc-1cmgu,diethoxy-di phenyl silane,diethoxydiphenylsilane,zznqqqwfkktosd-uhfffaoysa |
| IUPAC Name | diethoxy(diphenyl)silane |
| InChI Key | ZZNQQQWFKKTOSD-UHFFFAOYSA-N |
| Molecular Formula | C16H20O2Si |
Potassium Chloride, 99%, (Crystalline), MP Biomedicals
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Potassium Phosphate Dibasic Trihydrate, 99+%, (Crystalline), MP Biomedicals
CAS: 16788-57-1 Molecular Formula: H7K2O7P Molecular Weight (g/mol): 228.22 MDL Number: MFCD00149926 InChI Key: XQGPKZUNMMFTAL-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate PubChem CID: 16217523 IUPAC Name: dipotassium trihydrate hydrogen phosphate SMILES: O.O.O.[K+].[K+].OP([O-])([O-])=O
| PubChem CID | 16217523 |
|---|---|
| CAS | 16788-57-1 |
| Molecular Weight (g/mol) | 228.22 |
| MDL Number | MFCD00149926 |
| SMILES | O.O.O.[K+].[K+].OP([O-])([O-])=O |
| Synonym | dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate |
| IUPAC Name | dipotassium trihydrate hydrogen phosphate |
| InChI Key | XQGPKZUNMMFTAL-UHFFFAOYSA-L |
| Molecular Formula | H7K2O7P |
Sodium Nitroprusside Dihydrate, (Crystalline),MP Biomedicals
CAS: 13755-38-9 Molecular Formula: C5H4FeN6Na2O3 Molecular Weight (g/mol): 297.95 MDL Number: MFCD00149192 InChI Key: JFPDVRGGFBUORC-UHFFFAOYSA-N Synonym: nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o PubChem CID: 11953895 SMILES: O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+]
| PubChem CID | 11953895 |
|---|---|
| CAS | 13755-38-9 |
| Molecular Weight (g/mol) | 297.95 |
| MDL Number | MFCD00149192 |
| SMILES | O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+] |
| Synonym | nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o |
| InChI Key | JFPDVRGGFBUORC-UHFFFAOYSA-N |
| Molecular Formula | C5H4FeN6Na2O3 |
Lithium fluoride, 97%
CAS: 7789-24-4 Molecular Formula: FLi Molecular Weight (g/mol): 25.94 MDL Number: MFCD00011090 InChI Key: PQXKHYXIUOZZFA-UHFFFAOYSA-M Synonym: lithium fluoride,fluorolithium,lithium monofluoride,trilithium trifluoride,lithium fluoride li3f3,lithium fluorure,ntl 50,lithium fluoride 6lif,lithium fluoride 7lif PubChem CID: 224478 IUPAC Name: lithium;fluoride SMILES: [Li+].[F-]
| PubChem CID | 224478 |
|---|---|
| CAS | 7789-24-4 |
| Molecular Weight (g/mol) | 25.94 |
| MDL Number | MFCD00011090 |
| SMILES | [Li+].[F-] |
| Synonym | lithium fluoride,fluorolithium,lithium monofluoride,trilithium trifluoride,lithium fluoride li3f3,lithium fluorure,ntl 50,lithium fluoride 6lif,lithium fluoride 7lif |
| IUPAC Name | lithium;fluoride |
| InChI Key | PQXKHYXIUOZZFA-UHFFFAOYSA-M |
| Molecular Formula | FLi |
Calcium oxide, 99.95% (metals basis)
CAS: 1305-78-8 Molecular Formula: CaO Molecular Weight (g/mol): 56.08 MDL Number: MFCD00010911 InChI Key: BRPQOXSCLDDYGP-UHFFFAOYSA-N Synonym: calcium oxide,burnt lime,calcia,calxyl,gebrannter kalk,unslaked lime,calcium monoxide,airlock,calx PubChem CID: 14778 ChEBI: CHEBI:31344 SMILES: [O--].[Ca++]
| PubChem CID | 14778 |
|---|---|
| CAS | 1305-78-8 |
| Molecular Weight (g/mol) | 56.08 |
| ChEBI | CHEBI:31344 |
| MDL Number | MFCD00010911 |
| SMILES | [O--].[Ca++] |
| Synonym | calcium oxide,burnt lime,calcia,calxyl,gebrannter kalk,unslaked lime,calcium monoxide,airlock,calx |
| InChI Key | BRPQOXSCLDDYGP-UHFFFAOYSA-N |
| Molecular Formula | CaO |