Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Magnesium fluoride, 99% (metals basis excluding Ca & Na), Ca+Na <1%
CAS: 7783-40-6 Molecular Formula: F2Mg Molecular Weight (g/mol): 62.30 MDL Number: MFCD00011108 InChI Key: ORUIBWPALBXDOA-UHFFFAOYSA-L IUPAC Name: magnesium(2+) difluoride SMILES: [F-].[F-].[Mg++]
| CAS | 7783-40-6 |
|---|---|
| Molecular Weight (g/mol) | 62.30 |
| MDL Number | MFCD00011108 |
| SMILES | [F-].[F-].[Mg++] |
| IUPAC Name | magnesium(2+) difluoride |
| InChI Key | ORUIBWPALBXDOA-UHFFFAOYSA-L |
| Molecular Formula | F2Mg |
| Name Note | Polished on both sides |
|---|---|
| MDL Number | MFCD00011358 |
| Chemical Name or Material | Potassium bromide crystal optic disc |
Zirconium lump, 3-6mm (0.1-0.2in), 99.8% (metals basis excluding Hf), Hf 4% max, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Aluminum ingot, Puratronic™, 99.9995% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminum SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Magnesium oxide substrate, 10x10x0.5mm, polished one side, 111 orientation
CAS: 1309-48-4 Molecular Formula: MgO Molecular Weight (g/mol): 40.30 MDL Number: MFCD00011109 InChI Key: CPLXHLVBOLITMK-UHFFFAOYSA-N Synonym: magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag PubChem CID: 14792 IUPAC Name: oxomagnesium SMILES: O=[Mg]
| PubChem CID | 14792 |
|---|---|
| CAS | 1309-48-4 |
| Molecular Weight (g/mol) | 40.30 |
| MDL Number | MFCD00011109 |
| SMILES | O=[Mg] |
| Synonym | magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag |
| IUPAC Name | oxomagnesium |
| InChI Key | CPLXHLVBOLITMK-UHFFFAOYSA-N |
| Molecular Formula | MgO |
Lithium titanium oxide
CAS: 12031-82-2 Molecular Formula: Li2O3Ti Molecular Weight (g/mol): 109.74 MDL Number: MFCD00016181 InChI Key: AXQWGBXVDWYWDE-UHFFFAOYSA-N Synonym: lithium titanate,lithium titanium oxide,dilithium dioxido oxo titanium,2li.o3ti,dilithium 1+ ion oxotitaniumbis olate,dilithium 1+ oxotitaniumbis olate IUPAC Name: titanium(4+) dilithium(1+) trioxidandiide SMILES: [Li+].[Li+].[O--].[O--].[O--].[Ti+4]
| CAS | 12031-82-2 |
|---|---|
| Molecular Weight (g/mol) | 109.74 |
| MDL Number | MFCD00016181 |
| SMILES | [Li+].[Li+].[O--].[O--].[O--].[Ti+4] |
| Synonym | lithium titanate,lithium titanium oxide,dilithium dioxido oxo titanium,2li.o3ti,dilithium 1+ ion oxotitaniumbis olate,dilithium 1+ oxotitaniumbis olate |
| IUPAC Name | titanium(4+) dilithium(1+) trioxidandiide |
| InChI Key | AXQWGBXVDWYWDE-UHFFFAOYSA-N |
| Molecular Formula | Li2O3Ti |
| Form | Disc |
|---|---|
| Chemical Name or Material | Al-23 Round Disc Without Hole |
Lithium metaborate, anhydrous, tech.
CAS: 13453-69-5 Molecular Formula: B4H14Li2O7 Molecular Weight (g/mol): 183.23 MDL Number: MFCD00011089 InChI Key: DPYKRXYVXDYLEY-UHFFFAOYSA-N Synonym: lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs PubChem CID: 123308 SMILES: [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O
| PubChem CID | 123308 |
|---|---|
| CAS | 13453-69-5 |
| Molecular Weight (g/mol) | 183.23 |
| MDL Number | MFCD00011089 |
| SMILES | [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O |
| Synonym | lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs |
| InChI Key | DPYKRXYVXDYLEY-UHFFFAOYSA-N |
| Molecular Formula | B4H14Li2O7 |
Zirconium foil, 0.25mm (0.01in) thick, 99.94% (metals basis excluding Hf), Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Gallium ingot, 99.999% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
Dysprosium pieces, 99.9% (REO)
CAS: 7429-91-6 Molecular Formula: Dy Molecular Weight (g/mol): 162.50 MDL Number: MFCD00010982 InChI Key: KBQHZAAAGSGFKK-UHFFFAOYSA-N Synonym: ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n PubChem CID: 23912 ChEBI: CHEBI:33377 IUPAC Name: dysprosium SMILES: [Dy]
| PubChem CID | 23912 |
|---|---|
| CAS | 7429-91-6 |
| Molecular Weight (g/mol) | 162.50 |
| ChEBI | CHEBI:33377 |
| MDL Number | MFCD00010982 |
| SMILES | [Dy] |
| Synonym | ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n |
| IUPAC Name | dysprosium |
| InChI Key | KBQHZAAAGSGFKK-UHFFFAOYSA-N |
| Molecular Formula | Dy |
Lead foil, 2.0mm (0.08in) thick, Puratronic™, 99.998% (metals basis)
CAS: 7439-92-1 Molecular Formula: Pb Molecular Weight (g/mol): 207.20 MDL Number: MFCD00134050 InChI Key: WABPQHHGFIMREM-UHFFFAOYSA-N Synonym: plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant PubChem CID: 5352425 ChEBI: CHEBI:27889 IUPAC Name: lead SMILES: [Pb]
| PubChem CID | 5352425 |
|---|---|
| CAS | 7439-92-1 |
| Molecular Weight (g/mol) | 207.20 |
| ChEBI | CHEBI:27889 |
| MDL Number | MFCD00134050 |
| SMILES | [Pb] |
| Synonym | plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant |
| IUPAC Name | lead |
| InChI Key | WABPQHHGFIMREM-UHFFFAOYSA-N |
| Molecular Formula | Pb |
Calcium perchlorate hydrate, Reagent Grade, Thermo Scientific Chemicals
CAS: 13477-36-6 Molecular Formula: CaCl2O8 Molecular Weight (g/mol): 238.97 MDL Number: MFCD00015971 InChI Key: ZQAOXERLHGRFIC-UHFFFAOYSA-L Synonym: calcium perchlorate,calcium diperchlorate,perchloric acid,calcium salt, tetrahydrate 8ci,9ci,hydrated,perchloric acid, calcium salt,perchloric acid, calcium salt 2:1,ca.2clo4,calcium 2+ diperchlorate ion,calcium perchlorate hydrate 250g,perchloric acid calcium salt 2:1e PubChem CID: 61629 IUPAC Name: calcium;diperchlorate SMILES: [Ca++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O
| PubChem CID | 61629 |
|---|---|
| CAS | 13477-36-6 |
| Molecular Weight (g/mol) | 238.97 |
| MDL Number | MFCD00015971 |
| SMILES | [Ca++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
| Synonym | calcium perchlorate,calcium diperchlorate,perchloric acid,calcium salt, tetrahydrate 8ci,9ci,hydrated,perchloric acid, calcium salt,perchloric acid, calcium salt 2:1,ca.2clo4,calcium 2+ diperchlorate ion,calcium perchlorate hydrate 250g,perchloric acid calcium salt 2:1e |
| IUPAC Name | calcium;diperchlorate |
| InChI Key | ZQAOXERLHGRFIC-UHFFFAOYSA-L |
| Molecular Formula | CaCl2O8 |
Scandium foil, 0.25mm (0.01in) thick, 99.9% (REO)
CAS: 7440-20-2 Molecular Formula: Sc Molecular Weight (g/mol): 44.96 MDL Number: MFCD00016323 InChI Key: SIXSYDAISGFNSX-UHFFFAOYSA-N Synonym: unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted PubChem CID: 23952 ChEBI: CHEBI:33330 IUPAC Name: scandium SMILES: [Sc]
| PubChem CID | 23952 |
|---|---|
| CAS | 7440-20-2 |
| Molecular Weight (g/mol) | 44.96 |
| ChEBI | CHEBI:33330 |
| MDL Number | MFCD00016323 |
| SMILES | [Sc] |
| Synonym | unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted |
| IUPAC Name | scandium |
| InChI Key | SIXSYDAISGFNSX-UHFFFAOYSA-N |
| Molecular Formula | Sc |