Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium diformamide, 98%
CAS: 18197-26-7 Molecular Formula: C2H2NNaO2 Molecular Weight (g/mol): 95.03 MDL Number: MFCD00145302 InChI Key: QJXDSDLNUKLDBP-UHFFFAOYSA-M Synonym: sodium diformylamide,diformylamide sodium salt,diformylimide sodium salt,sodium diformylazanide,sodium diformamide,diformylamino sodium,diformylsodium,acmc-209eii,sodium dimethanoylazanide,ksc538a2h PubChem CID: 10877056 IUPAC Name: sodium;diformylazanide SMILES: C(=O)[N-]C=O.[Na+]
| PubChem CID | 10877056 |
|---|---|
| CAS | 18197-26-7 |
| Molecular Weight (g/mol) | 95.03 |
| MDL Number | MFCD00145302 |
| SMILES | C(=O)[N-]C=O.[Na+] |
| Synonym | sodium diformylamide,diformylamide sodium salt,diformylimide sodium salt,sodium diformylazanide,sodium diformamide,diformylamino sodium,diformylsodium,acmc-209eii,sodium dimethanoylazanide,ksc538a2h |
| IUPAC Name | sodium;diformylazanide |
| InChI Key | QJXDSDLNUKLDBP-UHFFFAOYSA-M |
| Molecular Formula | C2H2NNaO2 |
Gallium(III) nitrate hydrate, 99.9998%, (trace metal basis)
CAS: 69365-72-6 Molecular Formula: GaN3O9 Molecular Weight (g/mol): 255.74 MDL Number: MFCD00149723 InChI Key: CHPZKNULDCNCBW-UHFFFAOYSA-N Synonym: gallium iii nitrate hydrate,nitric acid, gallium salt, hydrate,ga.3no3.h2o,gallium nitrate nanoparticles,gallium-iii-nitrate hydrate,gallium iii nitrate hydrate, puratronic,gallium iii nitrate hydrate, puratronic metals basis,gallium iii nitrate hydrate, crystalline trace metals basis,gallium iii nitrate hydrate, crystals and lumps trace metals basis PubChem CID: 11550823 SMILES: [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 11550823 |
|---|---|
| CAS | 69365-72-6 |
| Molecular Weight (g/mol) | 255.74 |
| MDL Number | MFCD00149723 |
| SMILES | [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | gallium iii nitrate hydrate,nitric acid, gallium salt, hydrate,ga.3no3.h2o,gallium nitrate nanoparticles,gallium-iii-nitrate hydrate,gallium iii nitrate hydrate, puratronic,gallium iii nitrate hydrate, puratronic metals basis,gallium iii nitrate hydrate, crystalline trace metals basis,gallium iii nitrate hydrate, crystals and lumps trace metals basis |
| InChI Key | CHPZKNULDCNCBW-UHFFFAOYSA-N |
| Molecular Formula | GaN3O9 |
Aluminum potassium sulfate dodecahydrate, 99.5%, for analysis
CAS: 7784-24-9 Molecular Formula: AlKO8S2·12H2O Molecular Weight (g/mol): 474.39 MDL Number: MFCD00149143 InChI Key: GNHOJBNSNUXZQA-UHFFFAOYSA-J Synonym: kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate PubChem CID: 62667 ChEBI: CHEBI:86465 IUPAC Name: aluminum;potassium;disulfate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+]
| PubChem CID | 62667 |
|---|---|
| CAS | 7784-24-9 |
| Molecular Weight (g/mol) | 474.39 |
| ChEBI | CHEBI:86465 |
| MDL Number | MFCD00149143 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+] |
| Synonym | kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate |
| IUPAC Name | aluminum;potassium;disulfate;dodecahydrate |
| InChI Key | GNHOJBNSNUXZQA-UHFFFAOYSA-J |
| Molecular Formula | AlKO8S2·12H2O |
Cobalt(II) bromide hydrate
CAS: 85017-77-2 Molecular Formula: Br2Co Molecular Weight (g/mol): 218.74 MDL Number: MFCD00016017 InChI Key: BZRRQSJJPUGBAA-UHFFFAOYSA-L Synonym: cobalt ii bromide hydrate,acmc-20alea,br2co.h2o,cobaltous bromide hydrate,dibromocobalt-water 1/1,cobalt ii bromide hexahydrate,cobalt bromide cobr2 ,hydrate 9ci PubChem CID: 16212115 SMILES: [Co++].[Br-].[Br-]
| PubChem CID | 16212115 |
|---|---|
| CAS | 85017-77-2 |
| Molecular Weight (g/mol) | 218.74 |
| MDL Number | MFCD00016017 |
| SMILES | [Co++].[Br-].[Br-] |
| Synonym | cobalt ii bromide hydrate,acmc-20alea,br2co.h2o,cobaltous bromide hydrate,dibromocobalt-water 1/1,cobalt ii bromide hexahydrate,cobalt bromide cobr2 ,hydrate 9ci |
| InChI Key | BZRRQSJJPUGBAA-UHFFFAOYSA-L |
| Molecular Formula | Br2Co |
Palladium(II) acetate, trimer, 99.98% (metals basis), Pd 47% min
CAS: 3375-31-3 Molecular Formula: C4H6O4Pd Molecular Weight (g/mol): 224.51 MDL Number: MFCD00012453 InChI Key: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 SMILES: [Pd++].CC([O-])=O.CC([O-])=O
| PubChem CID | 167845 |
|---|---|
| CAS | 3375-31-3 |
| Molecular Weight (g/mol) | 224.51 |
| MDL Number | MFCD00012453 |
| SMILES | [Pd++].CC([O-])=O.CC([O-])=O |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| InChI Key | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Pd |
Phosphorus pentoxide, 98+%, ACS reagent
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N Synonym: Phosphoric anhydride IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| Synonym | Phosphoric anhydride |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
Potassium bisulfate, 98.5%, for analysis
CAS: 7646-93-7 Molecular Formula: HKO4S Molecular Weight (g/mol): 136.16 MDL Number: MFCD00011404 InChI Key: CHKVPAROMQMJNQ-UHFFFAOYSA-M Synonym: potassium bisulfate,potassium hydrogen sulfate,potassium bisulphate,sulfuric acid, monopotassium salt,potassium acid sulfate,sal enixum,potassium hydrogensulphate,monopotassium sulfate,acid potassium sulfate,caswell no. 682c PubChem CID: 516920 IUPAC Name: potassium hydrogen sulfate SMILES: [K+].OS([O-])(=O)=O
| PubChem CID | 516920 |
|---|---|
| CAS | 7646-93-7 |
| Molecular Weight (g/mol) | 136.16 |
| MDL Number | MFCD00011404 |
| SMILES | [K+].OS([O-])(=O)=O |
| Synonym | potassium bisulfate,potassium hydrogen sulfate,potassium bisulphate,sulfuric acid, monopotassium salt,potassium acid sulfate,sal enixum,potassium hydrogensulphate,monopotassium sulfate,acid potassium sulfate,caswell no. 682c |
| IUPAC Name | potassium hydrogen sulfate |
| InChI Key | CHKVPAROMQMJNQ-UHFFFAOYSA-M |
| Molecular Formula | HKO4S |
Barium titanate(IV), 99%
CAS: 12047-27-7 Molecular Formula: BaO3Ti Molecular Weight (g/mol): 233.19 MDL Number: MFCD00003447 InChI Key: WNKMTAQXMLAYHX-UHFFFAOYSA-N IUPAC Name: barium(2+) oxotitaniumbis(olate) SMILES: [Ba++].[O-][Ti]([O-])=O
| CAS | 12047-27-7 |
|---|---|
| Molecular Weight (g/mol) | 233.19 |
| MDL Number | MFCD00003447 |
| SMILES | [Ba++].[O-][Ti]([O-])=O |
| IUPAC Name | barium(2+) oxotitaniumbis(olate) |
| InChI Key | WNKMTAQXMLAYHX-UHFFFAOYSA-N |
| Molecular Formula | BaO3Ti |
Magnesium phosphate, tribasic hydrate, 98+%, pure
CAS: 53408-95-0 Molecular Formula: Mg3O8P2 Molecular Weight (g/mol): 262.86 MDL Number: MFCD00150251 InChI Key: GVALZJMUIHGIMD-UHFFFAOYSA-H Synonym: magnesium phosphate hydrate,trimagnesium diphosphate hydrate,acmc-20akl7,3mg.2po4.h2o,trimagnesium 2+ hydrate diphosphate PubChem CID: 6096954 SMILES: [Mg++].[Mg++].[Mg++].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O
| PubChem CID | 6096954 |
|---|---|
| CAS | 53408-95-0 |
| Molecular Weight (g/mol) | 262.86 |
| MDL Number | MFCD00150251 |
| SMILES | [Mg++].[Mg++].[Mg++].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O |
| Synonym | magnesium phosphate hydrate,trimagnesium diphosphate hydrate,acmc-20akl7,3mg.2po4.h2o,trimagnesium 2+ hydrate diphosphate |
| InChI Key | GVALZJMUIHGIMD-UHFFFAOYSA-H |
| Molecular Formula | Mg3O8P2 |
Sodium cyanate, 85%, pure
CAS: 917-61-3 Molecular Formula: CNNaO Molecular Weight (g/mol): 65.01 MDL Number: MFCD00011121 InChI Key: ZVCDLGYNFYZZOK-UHFFFAOYSA-M Synonym: sodium cyanate,zassol,cyanic acid, sodium salt,sodiumcyanate,cyansan,weecon,sodium isocyanate,san-cyan,unii-8ufs3jrv8p,naocn PubChem CID: 517096 ChEBI: CHEBI:38906 IUPAC Name: sodium;cyanate SMILES: C(#N)[O-].[Na+]
| PubChem CID | 517096 |
|---|---|
| CAS | 917-61-3 |
| Molecular Weight (g/mol) | 65.01 |
| ChEBI | CHEBI:38906 |
| MDL Number | MFCD00011121 |
| SMILES | C(#N)[O-].[Na+] |
| Synonym | sodium cyanate,zassol,cyanic acid, sodium salt,sodiumcyanate,cyansan,weecon,sodium isocyanate,san-cyan,unii-8ufs3jrv8p,naocn |
| IUPAC Name | sodium;cyanate |
| InChI Key | ZVCDLGYNFYZZOK-UHFFFAOYSA-M |
| Molecular Formula | CNNaO |
Silver(I) fluoride, 99+%
CAS: 7775-41-9 Molecular Formula: AgF Molecular Weight (g/mol): 126.87 MDL Number: MFCD00003410 InChI Key: REYHXKZHIMGNSE-UHFFFAOYSA-M Synonym: silver fluoride,silver 1+ fluoride,silver 1+ ion fluoride,argentous fluoride,ag-f,silverfluoride,silver salt, fluoride,silver fluoride,,silver i fluoride 5g PubChem CID: 165912 ChEBI: CHEBI:30340 IUPAC Name: silver;fluoride SMILES: [F-].[Ag+]
| PubChem CID | 165912 |
|---|---|
| CAS | 7775-41-9 |
| Molecular Weight (g/mol) | 126.87 |
| ChEBI | CHEBI:30340 |
| MDL Number | MFCD00003410 |
| SMILES | [F-].[Ag+] |
| Synonym | silver fluoride,silver 1+ fluoride,silver 1+ ion fluoride,argentous fluoride,ag-f,silverfluoride,silver salt, fluoride,silver fluoride,,silver i fluoride 5g |
| IUPAC Name | silver;fluoride |
| InChI Key | REYHXKZHIMGNSE-UHFFFAOYSA-M |
| Molecular Formula | AgF |
Gallium(III) nitrate hydrate, Puratronic™, 99.999% (metals basis)
CAS: 69365-72-6 Molecular Formula: GaN3O9 Molecular Weight (g/mol): 255.74 MDL Number: MFCD00149723 InChI Key: CHPZKNULDCNCBW-UHFFFAOYSA-N Synonym: gallium iii nitrate hydrate,nitric acid, gallium salt, hydrate,ga.3no3.h2o,gallium nitrate nanoparticles,gallium-iii-nitrate hydrate,gallium iii nitrate hydrate, puratronic,gallium iii nitrate hydrate, puratronic metals basis,gallium iii nitrate hydrate, crystalline trace metals basis,gallium iii nitrate hydrate, crystals and lumps trace metals basis PubChem CID: 11550823 SMILES: [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 11550823 |
|---|---|
| CAS | 69365-72-6 |
| Molecular Weight (g/mol) | 255.74 |
| MDL Number | MFCD00149723 |
| SMILES | [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | gallium iii nitrate hydrate,nitric acid, gallium salt, hydrate,ga.3no3.h2o,gallium nitrate nanoparticles,gallium-iii-nitrate hydrate,gallium iii nitrate hydrate, puratronic,gallium iii nitrate hydrate, puratronic metals basis,gallium iii nitrate hydrate, crystalline trace metals basis,gallium iii nitrate hydrate, crystals and lumps trace metals basis |
| InChI Key | CHPZKNULDCNCBW-UHFFFAOYSA-N |
| Molecular Formula | GaN3O9 |
Potassium perrhenate, 99% (metals basis), Re 64%
CAS: 10466-65-6 Molecular Formula: KO4Re Molecular Weight (g/mol): 289.30 MDL Number: MFCD00011365 InChI Key: QFKRWIFGDGKWLM-UHFFFAOYSA-N Synonym: potassium perrhenate,potassiumperrhenate,k.o4re,potassium rhenium oxide kreo4,perrhenic acid hreo4 , potassium salt,potassium perrhenate vii,acmc-1bx96,perrhenic acid potassium salt,potassium oxido trioxo rhenium,potassium perrhenate kreo4 PubChem CID: 3661560 IUPAC Name: potassium;oxido(trioxo)rhenium SMILES: [K+].[O-][Re](=O)(=O)=O
| PubChem CID | 3661560 |
|---|---|
| CAS | 10466-65-6 |
| Molecular Weight (g/mol) | 289.30 |
| MDL Number | MFCD00011365 |
| SMILES | [K+].[O-][Re](=O)(=O)=O |
| Synonym | potassium perrhenate,potassiumperrhenate,k.o4re,potassium rhenium oxide kreo4,perrhenic acid hreo4 , potassium salt,potassium perrhenate vii,acmc-1bx96,perrhenic acid potassium salt,potassium oxido trioxo rhenium,potassium perrhenate kreo4 |
| IUPAC Name | potassium;oxido(trioxo)rhenium |
| InChI Key | QFKRWIFGDGKWLM-UHFFFAOYSA-N |
| Molecular Formula | KO4Re |
Tin(II) sulfate, 95.5% min
CAS: 7488-55-3 Molecular Formula: O4SSn Molecular Weight (g/mol): 214.77 MDL Number: MFCD00011246 InChI Key: OBBXFSIWZVFYJR-UHFFFAOYSA-L Synonym: stannous sulfate,tin ii sulfate,tin 2+ sulfate,unii-0mfe10j96e,sulfuric acid, tin 2+ salt 1:1,stannous sulfate, crystal,stannous sulfate, solutions,tin, ion sn2+ sulfate,tin ii sulfate 250g PubChem CID: 62643 IUPAC Name: tin(2+);sulfate SMILES: [Sn++].[O-]S([O-])(=O)=O
| PubChem CID | 62643 |
|---|---|
| CAS | 7488-55-3 |
| Molecular Weight (g/mol) | 214.77 |
| MDL Number | MFCD00011246 |
| SMILES | [Sn++].[O-]S([O-])(=O)=O |
| Synonym | stannous sulfate,tin ii sulfate,tin 2+ sulfate,unii-0mfe10j96e,sulfuric acid, tin 2+ salt 1:1,stannous sulfate, crystal,stannous sulfate, solutions,tin, ion sn2+ sulfate,tin ii sulfate 250g |
| IUPAC Name | tin(2+);sulfate |
| InChI Key | OBBXFSIWZVFYJR-UHFFFAOYSA-L |
| Molecular Formula | O4SSn |
Ammonium dihydrogen phosphate, Puratronic™, 99.995% (metals basis)
CAS: 7722-76-1 Molecular Formula: H6NO4P Molecular Weight (g/mol): 115.03 MDL Number: MFCD00003396 InChI Key: LFVGISIMTYGQHF-UHFFFAOYSA-N Synonym: ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate PubChem CID: 24402 ChEBI: CHEBI:62982 IUPAC Name: azanium;dihydrogen phosphate SMILES: N.OP(O)(O)=O
| PubChem CID | 24402 |
|---|---|
| CAS | 7722-76-1 |
| Molecular Weight (g/mol) | 115.03 |
| ChEBI | CHEBI:62982 |
| MDL Number | MFCD00003396 |
| SMILES | N.OP(O)(O)=O |
| Synonym | ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate |
| IUPAC Name | azanium;dihydrogen phosphate |
| InChI Key | LFVGISIMTYGQHF-UHFFFAOYSA-N |
| Molecular Formula | H6NO4P |