Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tetrabutylammonium phosphate monobasic, 0.5M conc. in HPLC grade water, HPLC grade
CAS: 5574-97-0 | C16H38NO4P | 339.46 g/mol
| Boiling Point | 100.0°C |
|---|---|
| Linear Formula | (CH3(CH2)3)4NH2PO4 |
| Molecular Weight (g/mol) | 339.46 |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium phosphate monobasic |
| SMILES | OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI Key | ARRNBPCNZJXHRJ-UHFFFAOYSA-M |
| Density | 1.0100g/mL |
| PubChem CID | 2735142 |
| Concentration or Composition (by Analyte or Components) | 0.48 to 0.52M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: IF ON SKIN: Wash with plenty of soap and water. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00064526 |
| Health Hazard 2 | GHS H Statement: Causes skin irritation. Causes serious eye irritation. |
| Packaging | Glass Bottle |
| Synonym | tetrabutylammonium dihydrogen phosphate,tetrabutylammonium phosphate,tetrabutylammonium dihydrogenphosphate,1-butanaminium, n,n,n-tributyl-, phosphate 1:1,tetra-n-butylammonium phosphate,tetrabutylazanium dihydrogen phosphate,dihydrogen phosphate; tetrabutylazanium,dihydrogen phosphate; tetrabutylammonium,tetrabutyl ammonium dihydrogen phosphate,tetrabutylammonium ion dihydrogenphosphate ion |
| IUPAC Name | dihydrogen phosphate;tetrabutylazanium |
| Molecular Formula | C16H38NO4P |
| EINECS Number | 226-947-1 |
| Formula Weight | 339.45 |
| Specific Gravity | 1.01 |
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate, (EDTA), 99-101%, Ultrapure
CAS: 10378-23-1 Molecular Formula: C10H20N2Na4O10 Molecular Weight (g/mol): 420.233 MDL Number: MFCD00150026 InChI Key: DGWOWDJDIBPYOR-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate PubChem CID: 131843362 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na]
| PubChem CID | 131843362 |
|---|---|
| CAS | 10378-23-1 |
| Molecular Weight (g/mol) | 420.233 |
| MDL Number | MFCD00150026 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na] |
| Synonym | ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate |
| InChI Key | DGWOWDJDIBPYOR-UHFFFAOYSA-N |
| Molecular Formula | C10H20N2Na4O10 |
Cesium chloride, 99+%, for analysis
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |
Ammonium sulfate, 99%, pure
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Potassium perchlorate, 99%
CAS: 7778-74-7 Molecular Formula: ClKO4 Molecular Weight (g/mol): 138.54 MDL Number: MFCD00011362 InChI Key: YLMGFJXSLBMXHK-UHFFFAOYSA-M Synonym: potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp PubChem CID: 516900 SMILES: [K+].[O-][Cl](=O)(=O)=O
| PubChem CID | 516900 |
|---|---|
| CAS | 7778-74-7 |
| Molecular Weight (g/mol) | 138.54 |
| MDL Number | MFCD00011362 |
| SMILES | [K+].[O-][Cl](=O)(=O)=O |
| Synonym | potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp |
| InChI Key | YLMGFJXSLBMXHK-UHFFFAOYSA-M |
| Molecular Formula | ClKO4 |
Potassium chloride, 99.999%, (trace metal basis)
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Tin(II) chloride dihydrate, Reagent Grade
CAS: 10025-69-1 Molecular Formula: SnCl2·2H2O MDL Number: MFCD00149863
| CAS | 10025-69-1 |
|---|---|
| MDL Number | MFCD00149863 |
| Molecular Formula | SnCl2·2H2O |
| CAS | 10476-85-4 |
|---|---|
| MDL Number | MFCD00011249 |
Barium chloride dihydrate, 99+%, ACS reagent
CAS: 10326-27-9 Molecular Formula: BaCl2H4O2 Molecular Weight (g/mol): 244.26 MDL Number: MFCD00149154 InChI Key: PWHCIQQGOQTFAE-UHFFFAOYSA-L Synonym: barium chloride dihydrate,bacl2.2h2o,barium 2+ dihydrate dichloride,barium 2+ dichloride dihydrate,acmc-20alrc,dsstox_cid_131,barium chloride, acs,dsstox_rid_75389,dsstox_gsid_20131,ksc174q7d PubChem CID: 5284346 ChEBI: CHEBI:86153 IUPAC Name: barium(2+) dihydrate dichloride SMILES: O.O.[Cl-].[Cl-].[Ba++]
| PubChem CID | 5284346 |
|---|---|
| CAS | 10326-27-9 |
| Molecular Weight (g/mol) | 244.26 |
| ChEBI | CHEBI:86153 |
| MDL Number | MFCD00149154 |
| SMILES | O.O.[Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride dihydrate,bacl2.2h2o,barium 2+ dihydrate dichloride,barium 2+ dichloride dihydrate,acmc-20alrc,dsstox_cid_131,barium chloride, acs,dsstox_rid_75389,dsstox_gsid_20131,ksc174q7d |
| IUPAC Name | barium(2+) dihydrate dichloride |
| InChI Key | PWHCIQQGOQTFAE-UHFFFAOYSA-L |
| Molecular Formula | BaCl2H4O2 |
Ammonium perchlorate, Reagent Grade, Thermo Scientific Chemicals
CAS: 7790-98-9 Molecular Formula: ClH4NO4 Molecular Weight (g/mol): 117.485 MDL Number: MFCD00011421 InChI Key: HHEFNVCDPLQQTP-UHFFFAOYSA-N PubChem CID: 24639 IUPAC Name: azanium;perchlorate SMILES: [NH4+].[O-]Cl(=O)(=O)=O
| PubChem CID | 24639 |
|---|---|
| CAS | 7790-98-9 |
| Molecular Weight (g/mol) | 117.485 |
| MDL Number | MFCD00011421 |
| SMILES | [NH4+].[O-]Cl(=O)(=O)=O |
| IUPAC Name | azanium;perchlorate |
| InChI Key | HHEFNVCDPLQQTP-UHFFFAOYSA-N |
| Molecular Formula | ClH4NO4 |
LabChem, Inc. Potassium Iodide, Certified, 10.0% (w/v) ±0.4% (w/v), LabChem™
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166.003 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M Synonym: potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide PubChem CID: 4875 ChEBI: CHEBI:8346 IUPAC Name: potassium;iodide SMILES: [K+].[I-]
| PubChem CID | 4875 |
|---|---|
| CAS | 7681-11-0 |
| Molecular Weight (g/mol) | 166.003 |
| ChEBI | CHEBI:8346 |
| SMILES | [K+].[I-] |
| Synonym | potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide |
| IUPAC Name | potassium;iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |
Boron powder, amorphous, -325 mesh, 90%, Mg nominal 5%, Thermo Scientific Chemicals
CAS: 7440-42-8 Molecular Formula: B Molecular Weight (g/mol): 10.81 MDL Number: MFCD00134034 MFCD00151272 InChI Key: ZOXJGFHDIHLPTG-UHFFFAOYSA-N Synonym: boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne PubChem CID: 5462311 ChEBI: CHEBI:27560 IUPAC Name: boron SMILES: [B]
| PubChem CID | 5462311 |
|---|---|
| CAS | 7440-42-8 |
| Molecular Weight (g/mol) | 10.81 |
| ChEBI | CHEBI:27560 |
| MDL Number | MFCD00134034 MFCD00151272 |
| SMILES | [B] |
| Synonym | boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne |
| IUPAC Name | boron |
| InChI Key | ZOXJGFHDIHLPTG-UHFFFAOYSA-N |
| Molecular Formula | B |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Potassium phosphate, tribasic, 97%, pure, anhydrous
CAS: 7778-53-2 Molecular Formula: K3O4P Molecular Weight (g/mol): 212.27 MDL Number: MFCD00036295 InChI Key: LWIHDJKSTIGBAC-UHFFFAOYSA-K Synonym: potassium phosphate,tripotassium phosphate,potassium phosphate tribasic,phosphoric acid, tripotassium salt,potassium orthophosphate,tripotassium orthophosphate,caswell no. 700a,potassium phosphate, tribasic,potassium phosphate k3po4,ccris 7321 PubChem CID: 62657 IUPAC Name: tripotassium;phosphate SMILES: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
| PubChem CID | 62657 |
|---|---|
| CAS | 7778-53-2 |
| Molecular Weight (g/mol) | 212.27 |
| MDL Number | MFCD00036295 |
| SMILES | [O-]P(=O)([O-])[O-].[K+].[K+].[K+] |
| Synonym | potassium phosphate,tripotassium phosphate,potassium phosphate tribasic,phosphoric acid, tripotassium salt,potassium orthophosphate,tripotassium orthophosphate,caswell no. 700a,potassium phosphate, tribasic,potassium phosphate k3po4,ccris 7321 |
| IUPAC Name | tripotassium;phosphate |
| InChI Key | LWIHDJKSTIGBAC-UHFFFAOYSA-K |
| Molecular Formula | K3O4P |
Sodium phosphate, monobasic, 99%, for analysis, anhydrous
CAS: 7558-80-7 Molecular Formula: H2NaO4P Molecular Weight (g/mol): 119.98 MDL Number: MFCD00003527,MFCD00146206 InChI Key: AJPJDKMHJJGVTQ-UHFFFAOYSA-M Synonym: monosodium phosphate,sodium dihydrogen phosphate,sodium dihydrogenorthophosphate,sodium phosphate monobasic,sodium acid phosphate,sodium phosphate, monobasic,monosodium dihydrogen orthophosphate,sodium phosphate monobasic anhydrous,monosodium orthophosphate,monobasic sodium phosphate PubChem CID: 23672064 ChEBI: CHEBI:37585 SMILES: [Na+].OP(O)([O-])=O
| PubChem CID | 23672064 |
|---|---|
| CAS | 7558-80-7 |
| Molecular Weight (g/mol) | 119.98 |
| ChEBI | CHEBI:37585 |
| MDL Number | MFCD00003527,MFCD00146206 |
| SMILES | [Na+].OP(O)([O-])=O |
| Synonym | monosodium phosphate,sodium dihydrogen phosphate,sodium dihydrogenorthophosphate,sodium phosphate monobasic,sodium acid phosphate,sodium phosphate, monobasic,monosodium dihydrogen orthophosphate,sodium phosphate monobasic anhydrous,monosodium orthophosphate,monobasic sodium phosphate |
| InChI Key | AJPJDKMHJJGVTQ-UHFFFAOYSA-M |
| Molecular Formula | H2NaO4P |