Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Manganese pieces, irregular, 99.9% (metals basis)
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |
Potassium pyrosulfate, pure, Thermo Scientific™
CAS: 7790-62-7 Molecular Formula: K2O7S2 Molecular Weight (g/mol): 254.31 MDL Number: 00011385 InChI Key: KAQHZJVQFBJKCK-UHFFFAOYSA-L IUPAC Name: dipotassium (sulfonatooxy)sulfonate SMILES: [K+].[K+].[O-]S(=O)(=O)OS([O-])(=O)=O
| CAS | 7790-62-7 |
|---|---|
| Molecular Weight (g/mol) | 254.31 |
| MDL Number | 00011385 |
| SMILES | [K+].[K+].[O-]S(=O)(=O)OS([O-])(=O)=O |
| IUPAC Name | dipotassium (sulfonatooxy)sulfonate |
| InChI Key | KAQHZJVQFBJKCK-UHFFFAOYSA-L |
| Molecular Formula | K2O7S2 |
Sodium sulfite, 98.5%, for analysis, anhydrous
CAS: 7757-83-7 Molecular Formula: Na2O3S Molecular Weight (g/mol): 126.04 MDL Number: MFCD00003503 InChI Key: GEHJYWRUCIMESM-UHFFFAOYSA-L Synonym: sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit PubChem CID: 24437 ChEBI: CHEBI:86477 IUPAC Name: disodium;sulfite SMILES: [O-]S(=O)[O-].[Na+].[Na+]
| PubChem CID | 24437 |
|---|---|
| CAS | 7757-83-7 |
| Molecular Weight (g/mol) | 126.04 |
| ChEBI | CHEBI:86477 |
| MDL Number | MFCD00003503 |
| SMILES | [O-]S(=O)[O-].[Na+].[Na+] |
| Synonym | sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit |
| IUPAC Name | disodium;sulfite |
| InChI Key | GEHJYWRUCIMESM-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S |
Chromium(III) sulfate hydrate, Reagent Grade
CAS: 15244-38-9 Molecular Formula: Cr2O12S3 Molecular Weight (g/mol): 392.16 MDL Number: MFCD00016039 InChI Key: GRWVQDDAKZFPFI-UHFFFAOYSA-H IUPAC Name: dichromium(3+) trisulfate SMILES: [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 15244-38-9 |
|---|---|
| Molecular Weight (g/mol) | 392.16 |
| MDL Number | MFCD00016039 |
| SMILES | [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| IUPAC Name | dichromium(3+) trisulfate |
| InChI Key | GRWVQDDAKZFPFI-UHFFFAOYSA-H |
| Molecular Formula | Cr2O12S3 |
Thermo Scientific Chemicals Potassium chloride, for biochemistry
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium;chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium;chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Sodium nitrite, 99.999% (metals basis)
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium;nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium;nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Potassium carbonate, 98%, extra pure, anhydrous
CAS: 584-08-7 Molecular Formula: CK2O3 Molecular Weight (g/mol): 138.21 MDL Number: MFCD00011382 InChI Key: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 IUPAC Name: dipotassium;carbonate SMILES: [K+].[K+].[O-]C([O-])=O
| PubChem CID | 11430 |
|---|---|
| CAS | 584-08-7 |
| Molecular Weight (g/mol) | 138.21 |
| MDL Number | MFCD00011382 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| IUPAC Name | dipotassium;carbonate |
| InChI Key | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Molecular Formula | CK2O3 |
Potassium Acetate, (Crystalline/ACS Reagent Grade), MP Biomedicals
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.142 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.142 |
| ChEBI | CHEBI:32029 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
| Linear Formula | [CH3(CH2)3]4NF |
|---|---|
| Molecular Weight (g/mol) | 261.47 |
| ChEBI | CHEBI:51990 |
| Color | Brown to Green |
| Physical Form | Solution |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Merck Index | 15,9332 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Density | 0.8870g/mL |
| PubChem CID | 2724141 |
| Concentration or Composition (by Analyte or Components) | 0.90 to 1.10M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00011747 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| IUPAC Name | tetrabutylazanium;fluoride |
| Molecular Formula | C16H36FN |
| EINECS Number | 207-057-2 |
| Formula Weight | 261.46 |
| Specific Gravity | 0.887 |
Ammonium iron(II) sulfate hexahydrate, 99+%, for analysis
CAS: 7783-85-9 Molecular Formula: FeH20N2O14S2 Molecular Weight (g/mol): 392.13 MDL Number: MFCD00150530 InChI Key: MQLVWQSVRZVNIP-UHFFFAOYSA-L Synonym: Ferrous ammonium sulfate,Mohr's salt IUPAC Name: λ²-iron(2+) diammonium hexahydrate disulfate SMILES: [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7783-85-9 |
|---|---|
| Molecular Weight (g/mol) | 392.13 |
| MDL Number | MFCD00150530 |
| SMILES | [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | Ferrous ammonium sulfate,Mohr's salt |
| IUPAC Name | λ²-iron(2+) diammonium hexahydrate disulfate |
| InChI Key | MQLVWQSVRZVNIP-UHFFFAOYSA-L |
| Molecular Formula | FeH20N2O14S2 |
Iron(II,III) oxide, 97% (metals basis)
CAS: 1317-61-9 Molecular Formula: Fe3O4 Molecular Weight (g/mol): 231.53 MDL Number: MFCD00011010 InChI Key: WTFXARWRTYJXII-UHFFFAOYSA-N Synonym: Ferrosoferric oxide,Ferric ferrous oxide IUPAC Name: diiron(3+) λ²-iron(2+) tetraoxidandiide SMILES: [O--].[O--].[O--].[O--].[Fe++].[Fe+3].[Fe+3]
| CAS | 1317-61-9 |
|---|---|
| Molecular Weight (g/mol) | 231.53 |
| MDL Number | MFCD00011010 |
| SMILES | [O--].[O--].[O--].[O--].[Fe++].[Fe+3].[Fe+3] |
| Synonym | Ferrosoferric oxide,Ferric ferrous oxide |
| IUPAC Name | diiron(3+) λ²-iron(2+) tetraoxidandiide |
| InChI Key | WTFXARWRTYJXII-UHFFFAOYSA-N |
| Molecular Formula | Fe3O4 |
Iron(III) hydroxide, 99+%
CAS: 20344-49-4 Molecular Formula: FeHO2 Molecular Weight (g/mol): 88.851 MDL Number: MFCD00064782 InChI Key: AEIXRCIKZIZYPM-UHFFFAOYSA-M Synonym: hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide PubChem CID: 91502 IUPAC Name: hydroxy(oxo)iron SMILES: O[Fe]=O
| PubChem CID | 91502 |
|---|---|
| CAS | 20344-49-4 |
| Molecular Weight (g/mol) | 88.851 |
| MDL Number | MFCD00064782 |
| SMILES | O[Fe]=O |
| Synonym | hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide |
| IUPAC Name | hydroxy(oxo)iron |
| InChI Key | AEIXRCIKZIZYPM-UHFFFAOYSA-M |
| Molecular Formula | FeHO2 |
Iron(III) oxide, Puratronic™, 99.995% (metals basis), Thermo Scientific Chemicals
CAS: 1309-37-1 Molecular Formula: Fe2O3 Molecular Weight (g/mol): 159.69 MDL Number: MFCD00011008 InChI Key: JEIPFZHSYJVQDO-UHFFFAOYSA-N IUPAC Name: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| CAS | 1309-37-1 |
|---|---|
| Molecular Weight (g/mol) | 159.69 |
| MDL Number | MFCD00011008 |
| SMILES | [Fe][Fe](=O)(=O)=O |
| IUPAC Name | trioxodiiron |
| InChI Key | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| Molecular Formula | Fe2O3 |
Potassium fluoride, ACS, 99% min, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
3-(Methacryloyloxy)propyltrimethoxysilane, 97%
CAS: 2530-85-0 Molecular Formula: C10H20O5Si Molecular Weight (g/mol): 248.35 MDL Number: MFCD00008593 InChI Key: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC Name: 3-trimethoxysilylpropyl 2-methylprop-2-enoate
| PubChem CID | 17318 |
|---|---|
| CAS | 2530-85-0 |
| Molecular Weight (g/mol) | 248.35 |
| MDL Number | MFCD00008593 |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| IUPAC Name | 3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| InChI Key | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molecular Formula | C10H20O5Si |