Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Boron nitride, low binder, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 10043-11-5 Molecular Formula: BN Molecular Weight (g/mol): 24.82 MDL Number: MFCD00011317 InChI Key: LNLSXDSWJBUPHM-UHFFFAOYSA-N Synonym: boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r PubChem CID: 66227 ChEBI: CHEBI:50883 IUPAC Name: boranylidyneamine SMILES: B=N
| PubChem CID | 66227 |
|---|---|
| CAS | 10043-11-5 |
| Molecular Weight (g/mol) | 24.82 |
| ChEBI | CHEBI:50883 |
| MDL Number | MFCD00011317 |
| SMILES | B=N |
| Synonym | boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r |
| IUPAC Name | boranylidyneamine |
| InChI Key | LNLSXDSWJBUPHM-UHFFFAOYSA-N |
| Molecular Formula | BN |
Praseodymium foil, 0.25mm (0.01 in.) thick, 99.5% (REO), Thermo Scientific Chemicals
CAS: 7440-10-0 Molecular Formula: Pr Molecular Weight (g/mol): 140.91 MDL Number: MFCD00011174 InChI Key: PUDIUYLPXJFUGB-UHFFFAOYSA-N Synonym: unii-nkn7eza750,nkn7eza750,ingot,praseodimio,praseodyme,praseodym,atom,chips,powder,acmc-1bktg PubChem CID: 23942 ChEBI: CHEBI:49828 IUPAC Name: praseodymium SMILES: [Pr]
| PubChem CID | 23942 |
|---|---|
| CAS | 7440-10-0 |
| Molecular Weight (g/mol) | 140.91 |
| ChEBI | CHEBI:49828 |
| MDL Number | MFCD00011174 |
| SMILES | [Pr] |
| Synonym | unii-nkn7eza750,nkn7eza750,ingot,praseodimio,praseodyme,praseodym,atom,chips,powder,acmc-1bktg |
| IUPAC Name | praseodymium |
| InChI Key | PUDIUYLPXJFUGB-UHFFFAOYSA-N |
| Molecular Formula | Pr |
Gold nanoparticles, 100nm, supplied in 0.1 mg/ml sodium citrate with stabilizer, OD1, 572nm absorption
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Adenosine-5'-Triphosphate Disodium Salt Hydrate MP Biomedicals
CAS: 51963-61-2 Molecular Formula: C10H20N5Na2O16P3 Molecular Weight (g/mol): 605.19 MDL Number: MFCD00150754 InChI Key: MWEQTWJABOLLOS-MVHBFMHHNA-L Synonym: adenosine 5'-triphosphate disodium salt trihydrate,adenosine 5'-triphosphate disodium salt,adenosine 5'-triphosphate disodium salt trihydrate, disodium salt PubChem CID: 134129625 IUPAC Name: disodium trihydrate hydrogen [({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl phosphonato)oxy]phosphonate SMILES: O.O.O.[Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1
| PubChem CID | 134129625 |
|---|---|
| CAS | 51963-61-2 |
| Molecular Weight (g/mol) | 605.19 |
| MDL Number | MFCD00150754 |
| SMILES | O.O.O.[Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Synonym | adenosine 5'-triphosphate disodium salt trihydrate,adenosine 5'-triphosphate disodium salt,adenosine 5'-triphosphate disodium salt trihydrate, disodium salt |
| IUPAC Name | disodium trihydrate hydrogen [({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl phosphonato)oxy]phosphonate |
| InChI Key | MWEQTWJABOLLOS-MVHBFMHHNA-L |
| Molecular Formula | C10H20N5Na2O16P3 |
Antimony(V) chloride, ultra dry, 99.999% (metals basis)
CAS: 7647-18-9 Molecular Formula: Cl5Sb Molecular Weight (g/mol): 299.02 MDL Number: MFCD00011213 InChI Key: VMPVEPPRYRXYNP-UHFFFAOYSA-I Synonym: antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german PubChem CID: 24294 IUPAC Name: antimony pentachloride SMILES: Cl[Sb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24294 |
|---|---|
| CAS | 7647-18-9 |
| Molecular Weight (g/mol) | 299.02 |
| MDL Number | MFCD00011213 |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | antimony pentachloride |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Molecular Formula | Cl5Sb |
Cerium(III) bromide, ultra dry, 99.99% (metals basis)
CAS: 14457-87-5 Molecular Formula: Br3Ce Molecular Weight (g/mol): 379.83 MDL Number: MFCD00016004 InChI Key: MOOUSOJAOQPDEH-UHFFFAOYSA-K IUPAC Name: cerium(3+) tribromide SMILES: [Br-].[Br-].[Br-].[Ce+3]
| CAS | 14457-87-5 |
|---|---|
| Molecular Weight (g/mol) | 379.83 |
| MDL Number | MFCD00016004 |
| SMILES | [Br-].[Br-].[Br-].[Ce+3] |
| IUPAC Name | cerium(3+) tribromide |
| InChI Key | MOOUSOJAOQPDEH-UHFFFAOYSA-K |
| Molecular Formula | Br3Ce |
Lithium bromide, anhydrous, 99.995% (metals basis)
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.844 MDL Number: MFCD00011077 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Synonym: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| PubChem CID | 82050 |
|---|---|
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.844 |
| ChEBI | CHEBI:63042 |
| MDL Number | MFCD00011077 |
| SMILES | [Li+].[Br-] |
| Synonym | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
Palladium, Powdered 99+, MilliporeSigma™
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Aluminum Potassium Sulfate, 12-Hydrate, Crystal, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7784-24-9 Molecular Formula: AlH24KO20S2 Molecular Weight (g/mol): 474.372 InChI Key: GNHOJBNSNUXZQA-UHFFFAOYSA-J Synonym: kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate PubChem CID: 62667 ChEBI: CHEBI:86465 IUPAC Name: aluminum;potassium;disulfate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+]
| PubChem CID | 62667 |
|---|---|
| CAS | 7784-24-9 |
| Molecular Weight (g/mol) | 474.372 |
| ChEBI | CHEBI:86465 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+] |
| Synonym | kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate |
| IUPAC Name | aluminum;potassium;disulfate;dodecahydrate |
| InChI Key | GNHOJBNSNUXZQA-UHFFFAOYSA-J |
| Molecular Formula | AlH24KO20S2 |
Silver powder, APS 0.7-1.3 micron, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Niobium silicide, 99.85% (metals basis)
CAS: 12034-80-9 Molecular Formula: NbSi2 Molecular Weight (g/mol): 149.076 MDL Number: MFCD00151537 InChI Key: GXAAOBARRLPQRY-UHFFFAOYSA-N Synonym: niobium silicide,niobium disilicide,bis $l^ 2,columbium silicide, PubChem CID: 6336884 IUPAC Name: bis($l^{2}-silanylidene)niobium SMILES: [Si]=[Nb]=[Si]
| PubChem CID | 6336884 |
|---|---|
| CAS | 12034-80-9 |
| Molecular Weight (g/mol) | 149.076 |
| MDL Number | MFCD00151537 |
| SMILES | [Si]=[Nb]=[Si] |
| Synonym | niobium silicide,niobium disilicide,bis $l^ 2,columbium silicide, |
| IUPAC Name | bis($l^{2}-silanylidene)niobium |
| InChI Key | GXAAOBARRLPQRY-UHFFFAOYSA-N |
| Molecular Formula | NbSi2 |
Monobasic Sodium Phosphate, Dihydrate, USP, EP, bioCERTIFIED™, 1 kg, Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Magnesium chloride, ultra dry, 99.99% (metals basis)
CAS: 7786-30-3 Molecular Formula: Cl2Mg Molecular Weight (g/mol): 95.21 MDL Number: MFCD00011106 InChI Key: TWRXJAOTZQYOKJ-UHFFFAOYSA-L Synonym: magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride PubChem CID: 5360315 ChEBI: CHEBI:6636 SMILES: [Mg++].[Cl-].[Cl-]
| PubChem CID | 5360315 |
|---|---|
| CAS | 7786-30-3 |
| Molecular Weight (g/mol) | 95.21 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mg |
cis-Dichlorodiamineplatinum(II), 99.99%, (trace metal basis)
CAS: 15663-27-1 Molecular Formula: Cl2H6N2Pt Molecular Weight (g/mol): 300.04 MDL Number: MFCD00011623 InChI Key: BSJGASKRWFKGMV-UHFFFAOYSA-L Synonym: cis-DDP IUPAC Name: dichloroplatinumbis(ylium) diamine SMILES: N.N.Cl[Pt++]Cl
| CAS | 15663-27-1 |
|---|---|
| Molecular Weight (g/mol) | 300.04 |
| MDL Number | MFCD00011623 |
| SMILES | N.N.Cl[Pt++]Cl |
| Synonym | cis-DDP |
| IUPAC Name | dichloroplatinumbis(ylium) diamine |
| InChI Key | BSJGASKRWFKGMV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H6N2Pt |
Tin(II) pyrophosphate
CAS: 15578-26-4 Molecular Formula: O7P2Sn2 Molecular Weight (g/mol): 411.361 MDL Number: MFCD00049544 InChI Key: GEZAUFNYMZVOFV-UHFFFAOYSA-J Synonym: stannous pyrophosphate,technescan pyp,ditin pyrophosphate,tin ii pyrophosphate,tin 2+ pyrophosphate,unii-4dnt29ec86,stannous pyrophosphate usan,tin 2+ diphosphate 1:2,pyro stannous phosphate,ditin 2+ pyrophosphate 4- PubChem CID: 66379 IUPAC Name: phosphonato phosphate;tin(2+) SMILES: [O-]P(=O)([O-])OP(=O)([O-])[O-].[Sn+2].[Sn+2]
| PubChem CID | 66379 |
|---|---|
| CAS | 15578-26-4 |
| Molecular Weight (g/mol) | 411.361 |
| MDL Number | MFCD00049544 |
| SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Sn+2].[Sn+2] |
| Synonym | stannous pyrophosphate,technescan pyp,ditin pyrophosphate,tin ii pyrophosphate,tin 2+ pyrophosphate,unii-4dnt29ec86,stannous pyrophosphate usan,tin 2+ diphosphate 1:2,pyro stannous phosphate,ditin 2+ pyrophosphate 4- |
| IUPAC Name | phosphonato phosphate;tin(2+) |
| InChI Key | GEZAUFNYMZVOFV-UHFFFAOYSA-J |
| Molecular Formula | O7P2Sn2 |