Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Chromium(III) oxide, 98+%
CAS: 1308-38-9 Molecular Formula: Cr2O3 Molecular Weight (g/mol): 151.99 MDL Number: MFCD00010949 InChI Key: UOUJSJZBMCDAEU-UHFFFAOYSA-N Synonym: chromium iii oxide,chromia,dichromium trioxide,chromium sesquioxide,chrome green,green chromium oxide,chromium 3+ oxide,green cinnabar,chrome ochre,chrome oxide PubChem CID: 517277 ChEBI: CHEBI:48242 SMILES: [O--].[O--].[O--].[Cr+3].[Cr+3]
| PubChem CID | 517277 |
|---|---|
| CAS | 1308-38-9 |
| Molecular Weight (g/mol) | 151.99 |
| ChEBI | CHEBI:48242 |
| MDL Number | MFCD00010949 |
| SMILES | [O--].[O--].[O--].[Cr+3].[Cr+3] |
| Synonym | chromium iii oxide,chromia,dichromium trioxide,chromium sesquioxide,chrome green,green chromium oxide,chromium 3+ oxide,green cinnabar,chrome ochre,chrome oxide |
| InChI Key | UOUJSJZBMCDAEU-UHFFFAOYSA-N |
| Molecular Formula | Cr2O3 |
Lanthanum(III) oxide, 99.99%, (trace metal basis)
CAS: 1312-81-8 Molecular Formula: La2O3 Molecular Weight (g/mol): 325.82 MDL Number: MFCD00011071
| CAS | 1312-81-8 |
|---|---|
| Molecular Weight (g/mol) | 325.82 |
| MDL Number | MFCD00011071 |
| Molecular Formula | La2O3 |
Sodium Nitrite, (USP/FCC), MP Biomedicals
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Nickel(II) chloride hexahydrate, 99.3% (metals basis)
CAS: 7791-20-0 Molecular Formula: Cl2Ni·6H2O MDL Number: MFCD00149809
| CAS | 7791-20-0 |
|---|---|
| MDL Number | MFCD00149809 |
| Molecular Formula | Cl2Ni·6H2O |
Potassium carbonate, ACS, 99.0% min
CAS: 584-08-7 Molecular Formula: CK2O3 Molecular Weight (g/mol): 138.21 MDL Number: MFCD00011382 InChI Key: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 SMILES: [K+].[K+].[O-]C([O-])=O
| PubChem CID | 11430 |
|---|---|
| CAS | 584-08-7 |
| Molecular Weight (g/mol) | 138.21 |
| MDL Number | MFCD00011382 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| InChI Key | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Molecular Formula | CK2O3 |
Calcium oxalate monohydrate, 98%, extra pure
CAS: 5794-28-5 Molecular Formula: C2H2CaO5 Molecular Weight (g/mol): 146.11 MDL Number: MFCD00150039 InChI Key: LQHWSGSWNOHVHO-UHFFFAOYSA-L Synonym: calcium oxalate monohydrate,unii-4pp86kk527,calcium hydrate oxalate,calcium ethanedioate hydrate 1:1:1,acmc-1bmv0,ethanedioic acid, calcium salt 1:1 , monohydrate,calcium oxalate monohydrate 100g,ethanedioic acid,calcium salt, hydrate 1:?:? PubChem CID: 165350 IUPAC Name: calcium;oxalate;hydrate SMILES: O.[Ca++].[O-]C(=O)C([O-])=O
| PubChem CID | 165350 |
|---|---|
| CAS | 5794-28-5 |
| Molecular Weight (g/mol) | 146.11 |
| MDL Number | MFCD00150039 |
| SMILES | O.[Ca++].[O-]C(=O)C([O-])=O |
| Synonym | calcium oxalate monohydrate,unii-4pp86kk527,calcium hydrate oxalate,calcium ethanedioate hydrate 1:1:1,acmc-1bmv0,ethanedioic acid, calcium salt 1:1 , monohydrate,calcium oxalate monohydrate 100g,ethanedioic acid,calcium salt, hydrate 1:?:? |
| IUPAC Name | calcium;oxalate;hydrate |
| InChI Key | LQHWSGSWNOHVHO-UHFFFAOYSA-L |
| Molecular Formula | C2H2CaO5 |
Yttrium(III) acetate tetrahydrate, 99.9% (REO)
CAS: 85949-60-6 Molecular Formula: C6H17O10Y Molecular Weight (g/mol): 338.10 MDL Number: MFCD00013048 InChI Key: AIQRTHPXPDTMBQ-UHFFFAOYSA-K IUPAC Name: yttrium(3+) triacetate tetrahydrate SMILES: O.O.O.O.[Y+3].CC([O-])=O.CC([O-])=O.CC([O-])=O
| CAS | 85949-60-6 |
|---|---|
| Molecular Weight (g/mol) | 338.10 |
| MDL Number | MFCD00013048 |
| SMILES | O.O.O.O.[Y+3].CC([O-])=O.CC([O-])=O.CC([O-])=O |
| IUPAC Name | yttrium(3+) triacetate tetrahydrate |
| InChI Key | AIQRTHPXPDTMBQ-UHFFFAOYSA-K |
| Molecular Formula | C6H17O10Y |
Magnesium oxide, 97+%, for analysis
CAS: 1309-48-4 Molecular Formula: MgO Molecular Weight (g/mol): 40.30 MDL Number: MFCD00011109 InChI Key: CPLXHLVBOLITMK-UHFFFAOYSA-N Synonym: magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag PubChem CID: 14792 IUPAC Name: oxomagnesium SMILES: O=[Mg]
| PubChem CID | 14792 |
|---|---|
| CAS | 1309-48-4 |
| Molecular Weight (g/mol) | 40.30 |
| MDL Number | MFCD00011109 |
| SMILES | O=[Mg] |
| Synonym | magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag |
| IUPAC Name | oxomagnesium |
| InChI Key | CPLXHLVBOLITMK-UHFFFAOYSA-N |
| Molecular Formula | MgO |
Manganese(IV) oxide activated, tech. 90%
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Potassium bromide, Premium FTIR Grade
CAS: 2-3-7758 Molecular Formula: BrK Molecular Weight (g/mol): 119.00 MDL Number: MFCD00011358 InChI Key: IOLCXVTUBQKXJR-UHFFFAOYSA-M Synonym: potassium bromide,bromide salt of potassium,kalii bromidum,bromure de potassium,caswell no. 684,tripotassium tribromide,potassium bromide k3br3,unii-osd78555zm,ccris 6095 PubChem CID: 253877 ChEBI: CHEBI:32030 IUPAC Name: potassium bromide SMILES: [K+].[Br-]
| PubChem CID | 253877 |
|---|---|
| CAS | 2-3-7758 |
| Molecular Weight (g/mol) | 119.00 |
| ChEBI | CHEBI:32030 |
| MDL Number | MFCD00011358 |
| SMILES | [K+].[Br-] |
| Synonym | potassium bromide,bromide salt of potassium,kalii bromidum,bromure de potassium,caswell no. 684,tripotassium tribromide,potassium bromide k3br3,unii-osd78555zm,ccris 6095 |
| IUPAC Name | potassium bromide |
| InChI Key | IOLCXVTUBQKXJR-UHFFFAOYSA-M |
| Molecular Formula | BrK |
Sodium Hypochlorite Pentahydrate, TCI America™
CAS: 10022-70-5 Molecular Formula: ClH10NaO6 Molecular Weight (g/mol): 164.514 MDL Number: MFCD01941504 InChI Key: FHKLOBNGYGFRSF-UHFFFAOYSA-N PubChem CID: 23700086 IUPAC Name: sodium;hypochlorite;pentahydrate SMILES: O.O.O.O.O.[O-]Cl.[Na+]
| PubChem CID | 23700086 |
|---|---|
| CAS | 10022-70-5 |
| Molecular Weight (g/mol) | 164.514 |
| MDL Number | MFCD01941504 |
| SMILES | O.O.O.O.O.[O-]Cl.[Na+] |
| IUPAC Name | sodium;hypochlorite;pentahydrate |
| InChI Key | FHKLOBNGYGFRSF-UHFFFAOYSA-N |
| Molecular Formula | ClH10NaO6 |
Tetraethoxysilane, 99.9%
CAS: 78-10-4 Molecular Formula: C8H20O4Si Molecular Weight (g/mol): 208.329 MDL Number: MFCD00009062 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| PubChem CID | 6517 |
|---|---|
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.329 |
| MDL Number | MFCD00009062 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Molecular Formula | C8H20O4Si |
Sodium sulfide hydrate, tech., Thermo Scientific Chemicals
CAS: 27610-45-3 Molecular Formula: Na2S Molecular Weight (g/mol): 78.04 MDL Number: MFCD00149183 InChI Key: GRVFOGOEDUUMBP-UHFFFAOYSA-N PubChem CID: 45051681 SMILES: [Na+].[Na+].[S--]
| PubChem CID | 45051681 |
|---|---|
| CAS | 27610-45-3 |
| Molecular Weight (g/mol) | 78.04 |
| MDL Number | MFCD00149183 |
| SMILES | [Na+].[Na+].[S--] |
| InChI Key | GRVFOGOEDUUMBP-UHFFFAOYSA-N |
| Molecular Formula | Na2S |
Sodium Carbonate Anhydrous ACS, MilliporeSigma™
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 IUPAC Name: disodium carbonate SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| IUPAC Name | disodium carbonate |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |