Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tin, ACS reagent, 30 mesh
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Dimethylphenylsilane, 97%
CAS: 766-77-8 Molecular Formula: C8H11Si Molecular Weight (g/mol): 135.261 MDL Number: MFCD00008257 InChI Key: OIKHZBFJHONJJB-UHFFFAOYSA-N Synonym: dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon PubChem CID: 6327656 IUPAC Name: dimethyl(phenyl)silicon SMILES: C[Si](C)C1=CC=CC=C1
| PubChem CID | 6327656 |
|---|---|
| CAS | 766-77-8 |
| Molecular Weight (g/mol) | 135.261 |
| MDL Number | MFCD00008257 |
| SMILES | C[Si](C)C1=CC=CC=C1 |
| Synonym | dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon |
| IUPAC Name | dimethyl(phenyl)silicon |
| InChI Key | OIKHZBFJHONJJB-UHFFFAOYSA-N |
| Molecular Formula | C8H11Si |
Copper(I) iodide, 98%
CAS: 7681-65-4 Molecular Formula: CuI Molecular Weight (g/mol): 190.45 MDL Number: MFCD00010978 Synonym: cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g
| CAS | 7681-65-4 |
|---|---|
| Molecular Weight (g/mol) | 190.45 |
| MDL Number | MFCD00010978 |
| Synonym | cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g |
| Molecular Formula | CuI |
Aluminum wire, 2.0mm (0.08in) dia, annealed, Puratronic™, 99.9995% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Hydroxylamine hydrochloride, 99+%
CAS: 5470-11-1 Molecular Formula: ClH4NO Molecular Weight (g/mol): 69.49 MDL Number: MFCD00051089 InChI Key: WTDHULULXKLSOZ-UHFFFAOYSA-N Synonym: hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci PubChem CID: 443297 ChEBI: CHEBI:5807 SMILES: Cl.NO
| PubChem CID | 443297 |
|---|---|
| CAS | 5470-11-1 |
| Molecular Weight (g/mol) | 69.49 |
| ChEBI | CHEBI:5807 |
| MDL Number | MFCD00051089 |
| SMILES | Cl.NO |
| Synonym | hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci |
| InChI Key | WTDHULULXKLSOZ-UHFFFAOYSA-N |
| Molecular Formula | ClH4NO |
n-Octyltrichlorosilane, 97%
CAS: 5283-66-9 Molecular Formula: C8H17Cl3Si Molecular Weight (g/mol): 247.659 MDL Number: MFCD00000488 InChI Key: RCHUVCPBWWSUMC-UHFFFAOYSA-N Synonym: trichloro octyl silane,n-octyltrichlorosilane,octyltrichlorosilane,silane, trichlorooctyl,trichloro-n-octylsilane,unii-jv18i1wcu8,jv18i1wcu8,silane, octyltrichloro,octyltrichlorosilane un1801 corrosive PubChem CID: 21354 IUPAC Name: trichloro(octyl)silane SMILES: CCCCCCCC[Si](Cl)(Cl)Cl
| PubChem CID | 21354 |
|---|---|
| CAS | 5283-66-9 |
| Molecular Weight (g/mol) | 247.659 |
| MDL Number | MFCD00000488 |
| SMILES | CCCCCCCC[Si](Cl)(Cl)Cl |
| Synonym | trichloro octyl silane,n-octyltrichlorosilane,octyltrichlorosilane,silane, trichlorooctyl,trichloro-n-octylsilane,unii-jv18i1wcu8,jv18i1wcu8,silane, octyltrichloro,octyltrichlorosilane un1801 corrosive |
| IUPAC Name | trichloro(octyl)silane |
| InChI Key | RCHUVCPBWWSUMC-UHFFFAOYSA-N |
| Molecular Formula | C8H17Cl3Si |
Lithium hydroxide monohydrate, battery grade
CAS: 1310-66-3 Molecular Formula: H3LiO2 Molecular Weight (g/mol): 41.96 MDL Number: MFCD00149772 InChI Key: GLXDVVHUTZTUQK-UHFFFAOYSA-M Synonym: lithium hydroxide monohydrate,lithium hydroxide hydrate,lithium hydroxido,hydroxyde de lithium,unii-g51xlp968g,lithium hydroxide, monohydrate,lithiumhydrate,lioh-hydrate,lioh.hydrate,lioh water PubChem CID: 168937 IUPAC Name: lithium;hydroxide;hydrate SMILES: [Li+].O.[OH-]
| PubChem CID | 168937 |
|---|---|
| CAS | 1310-66-3 |
| Molecular Weight (g/mol) | 41.96 |
| MDL Number | MFCD00149772 |
| SMILES | [Li+].O.[OH-] |
| Synonym | lithium hydroxide monohydrate,lithium hydroxide hydrate,lithium hydroxido,hydroxyde de lithium,unii-g51xlp968g,lithium hydroxide, monohydrate,lithiumhydrate,lioh-hydrate,lioh.hydrate,lioh water |
| IUPAC Name | lithium;hydroxide;hydrate |
| InChI Key | GLXDVVHUTZTUQK-UHFFFAOYSA-M |
| Molecular Formula | H3LiO2 |
Lithium aluminum hydride, pellets, 97%
CAS: 16853-85-3 Molecular Formula: AlH4Li Molecular Weight (g/mol): 37.95 MDL Number: MFCD00011075 InChI Key: OCZDCIYGECBNKL-UHFFFAOYSA-N Synonym: lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride PubChem CID: 21226445 IUPAC Name: lithium(1+) alumanuide SMILES: [Li+].[AlH4-]
| PubChem CID | 21226445 |
|---|---|
| CAS | 16853-85-3 |
| Molecular Weight (g/mol) | 37.95 |
| MDL Number | MFCD00011075 |
| SMILES | [Li+].[AlH4-] |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| IUPAC Name | lithium(1+) alumanuide |
| InChI Key | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Molecular Formula | AlH4Li |
Ammonium hexafluorophosphate, 99.5%
CAS: 16941-11-0 Molecular Formula: F6H4NP Molecular Weight (g/mol): 163.003 MDL Number: MFCD00064642 InChI Key: NIZXKAYXSNUDOU-UHFFFAOYSA-O Synonym: ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride PubChem CID: 9793912 IUPAC Name: azanium;hexafluorophosphate SMILES: [NH4+].F[P-](F)(F)(F)(F)F
| PubChem CID | 9793912 |
|---|---|
| CAS | 16941-11-0 |
| Molecular Weight (g/mol) | 163.003 |
| MDL Number | MFCD00064642 |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
| Synonym | ammonium hexafluorophosphate,ammonium hexafluorophosphate v,ammonium hexafluophosphate,ammoniumhexafluorophosphate 6ci,7ci,unii-ns308031pj,azanium hexafluorophosphate,nh4pf6,ksc492g2j,ammonium hexafluoro-,e5-phosphanuide,ammonium phosphorus hexafluoride |
| IUPAC Name | azanium;hexafluorophosphate |
| InChI Key | NIZXKAYXSNUDOU-UHFFFAOYSA-O |
| Molecular Formula | F6H4NP |
Potassium dichromate, 99.5%, extra pure
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.19 MDL Number: MFCD00011367 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.19 |
| ChEBI | CHEBI:53444 |
| MDL Number | MFCD00011367 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Phosphorus tribromide, 1.0M solution in dichloromethane, AcroSeal™, Thermo Scientific Chemicals
CAS: 7789-60-8 | Molecular Formula: Br3P | Molecular Weight: 270.69 g/mol
| Linear Formula | PBr2 |
|---|---|
| Molecular Weight (g/mol) | 270.69 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Phosphorus tribromide |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Density | 1.4880g/mL |
| PubChem CID | 24614 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00011436 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| Molecular Formula | Br3P |
| EINECS Number | 232-178-2 |
| Formula Weight | 270.69 |
| Specific Gravity | 1.488 |
Ytterbium(III) triflate hydrate, 99.9%, (trace metal basis)
CAS: 252976-51-5 Molecular Formula: C3F9O9S3Yb Molecular Weight (g/mol): 620.23 MDL Number: MFCD06200261 InChI Key: AHZJKOKFZJYCLG-UHFFFAOYSA-K Synonym: ytterbium iii trifluoromethanesulfonate hydrate,ytterbium 3+ hydrate tritriflate,ytterbium iii triflate hydrate,ytterbium triflate hydrate,acmc-1aqes,yb otf 3.h2o,ytterbium triflate monohydrate,ytterbium trifluoromethanesulfonate hydrate,ytterbium trifluoromethanesulfonate, hydrate PubChem CID: 22836430 IUPAC Name: ytterbium(3+) tritrifluoromethanesulfonate SMILES: [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 22836430 |
|---|---|
| CAS | 252976-51-5 |
| Molecular Weight (g/mol) | 620.23 |
| MDL Number | MFCD06200261 |
| SMILES | [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | ytterbium iii trifluoromethanesulfonate hydrate,ytterbium 3+ hydrate tritriflate,ytterbium iii triflate hydrate,ytterbium triflate hydrate,acmc-1aqes,yb otf 3.h2o,ytterbium triflate monohydrate,ytterbium trifluoromethanesulfonate hydrate,ytterbium trifluoromethanesulfonate, hydrate |
| IUPAC Name | ytterbium(3+) tritrifluoromethanesulfonate |
| InChI Key | AHZJKOKFZJYCLG-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9S3Yb |
Iridium(III) chloride, anhydrous, Premion™, 99.99% (metals basis), Ir 63.9% min
CAS: 10025-83-9 Molecular Formula: Cl3Ir Molecular Weight (g/mol): 298.567 MDL Number: MFCD00011063 InChI Key: DANYXEHCMQHDNX-UHFFFAOYSA-K PubChem CID: 25563 IUPAC Name: trichloroiridium SMILES: Cl[Ir](Cl)Cl
| PubChem CID | 25563 |
|---|---|
| CAS | 10025-83-9 |
| Molecular Weight (g/mol) | 298.567 |
| MDL Number | MFCD00011063 |
| SMILES | Cl[Ir](Cl)Cl |
| IUPAC Name | trichloroiridium |
| InChI Key | DANYXEHCMQHDNX-UHFFFAOYSA-K |
| Molecular Formula | Cl3Ir |
Nickel(II) chloride, 98%
CAS: 7718-54-9 MDL Number: MFCD00011142 InChI Key: QMMRZOWCJAIUJA-UHFFFAOYSA-L PubChem CID: 24385 ChEBI: CHEBI:34887
| PubChem CID | 24385 |
|---|---|
| CAS | 7718-54-9 |
| ChEBI | CHEBI:34887 |
| MDL Number | MFCD00011142 |
| InChI Key | QMMRZOWCJAIUJA-UHFFFAOYSA-L |
Potassium iodide, ultra dry, 99.998% (metals basis)
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166.003 MDL Number: MFCD00011405 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M Synonym: potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide PubChem CID: 4875 ChEBI: CHEBI:8346 IUPAC Name: potassium;iodide SMILES: [K+].[I-]
| PubChem CID | 4875 |
|---|---|
| CAS | 7681-11-0 |
| Molecular Weight (g/mol) | 166.003 |
| ChEBI | CHEBI:8346 |
| MDL Number | MFCD00011405 |
| SMILES | [K+].[I-] |
| Synonym | potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide |
| IUPAC Name | potassium;iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |