Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Cobalt foil, 1.0mm (0.04in) thick, 99.95% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
Samarium rod, 12.7mm (0.5in) dia, 99.9% (metals basis excluding Ta)
CAS: 7440-19-9 Molecular Formula: Sm Molecular Weight (g/mol): 150.36 MDL Number: MFCD00011233 MFCD00151299 InChI Key: KZUNJOHGWZRPMI-UHFFFAOYSA-N Synonym: samario,unii-42od65l39f,samarium, elemental,atom,powder,ingot,foil, 3n,chips, 3n,ingot, 3n,acmc-1bk0l PubChem CID: 23951 ChEBI: CHEBI:33374 IUPAC Name: samarium SMILES: [Sm]
| PubChem CID | 23951 |
|---|---|
| CAS | 7440-19-9 |
| Molecular Weight (g/mol) | 150.36 |
| ChEBI | CHEBI:33374 |
| MDL Number | MFCD00011233 MFCD00151299 |
| SMILES | [Sm] |
| Synonym | samario,unii-42od65l39f,samarium, elemental,atom,powder,ingot,foil, 3n,chips, 3n,ingot, 3n,acmc-1bk0l |
| IUPAC Name | samarium |
| InChI Key | KZUNJOHGWZRPMI-UHFFFAOYSA-N |
| Molecular Formula | Sm |
Erbium rod, 12.7mm (0.5in) dia, 99.9% (metals basis excluding Ta)
CAS: 7440-52-0 Molecular Formula: Er Molecular Weight (g/mol): 167.26 MDL Number: MFCD00010987 InChI Key: UYAHIZSMUZPPFV-UHFFFAOYSA-N Synonym: unii-77b218d3ye,foil,iii ion,erbio,pieces,powder,chips,ingot,er3,pieces, distilled dendritic PubChem CID: 23980 ChEBI: CHEBI:33379 IUPAC Name: erbium SMILES: [Er]
| PubChem CID | 23980 |
|---|---|
| CAS | 7440-52-0 |
| Molecular Weight (g/mol) | 167.26 |
| ChEBI | CHEBI:33379 |
| MDL Number | MFCD00010987 |
| SMILES | [Er] |
| Synonym | unii-77b218d3ye,foil,iii ion,erbio,pieces,powder,chips,ingot,er3,pieces, distilled dendritic |
| IUPAC Name | erbium |
| InChI Key | UYAHIZSMUZPPFV-UHFFFAOYSA-N |
| Molecular Formula | Er |
Thulium pieces, sublimed dendritic, 99.9% (REO)
CAS: 7440-30-4 Molecular Formula: Tm Molecular Weight (g/mol): 168.93 MDL Number: MFCD00011281 InChI Key: FRNOGLGSGLTDKL-UHFFFAOYSA-N Synonym: tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic PubChem CID: 23961 ChEBI: CHEBI:33380 IUPAC Name: thulium SMILES: [Tm]
| PubChem CID | 23961 |
|---|---|
| CAS | 7440-30-4 |
| Molecular Weight (g/mol) | 168.93 |
| ChEBI | CHEBI:33380 |
| MDL Number | MFCD00011281 |
| SMILES | [Tm] |
| Synonym | tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic |
| IUPAC Name | thulium |
| InChI Key | FRNOGLGSGLTDKL-UHFFFAOYSA-N |
| Molecular Formula | Tm |
Magnesium aluminum oxide, 99% (metals basis)
CAS: 12068-51-8 Molecular Formula: Al2MgO4 Molecular Weight (g/mol): 142.26 MDL Number: MFCD00049475 InChI Key: UAMZXLIURMNTHD-UHFFFAOYSA-N Synonym: alumina magnesia,cernel i,dialuminum magnesium tetraoxide,magnesium aluminate mgal2o4,dialuminum;magnesium;oxygen 2-,magnesium aluminate mg alo2 2,aluminum magnesium oxide,aluminum magnesium oxide mgal2o4,magnesium aluminum oxide mgal2o4,aluminate alo21-, magnesium 2:1
| CAS | 12068-51-8 |
|---|---|
| Molecular Weight (g/mol) | 142.26 |
| MDL Number | MFCD00049475 |
| Synonym | alumina magnesia,cernel i,dialuminum magnesium tetraoxide,magnesium aluminate mgal2o4,dialuminum;magnesium;oxygen 2-,magnesium aluminate mg alo2 2,aluminum magnesium oxide,aluminum magnesium oxide mgal2o4,magnesium aluminum oxide mgal2o4,aluminate alo21-, magnesium 2:1 |
| InChI Key | UAMZXLIURMNTHD-UHFFFAOYSA-N |
| Molecular Formula | Al2MgO4 |
Phosphoenolpyruvic acid tricyclohexylammonium salt
CAS: 35556-70-8 Molecular Formula: C21H44N3O6P Molecular Weight (g/mol): 465.57 MDL Number: MFCD00004258 InChI Key: MJKYGUXBFYGLLM-UHFFFAOYSA-N Synonym: phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic PubChem CID: 11754241 IUPAC Name: 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) SMILES: NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O
| PubChem CID | 11754241 |
|---|---|
| CAS | 35556-70-8 |
| Molecular Weight (g/mol) | 465.57 |
| MDL Number | MFCD00004258 |
| SMILES | NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| Synonym | phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic |
| IUPAC Name | 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) |
| InChI Key | MJKYGUXBFYGLLM-UHFFFAOYSA-N |
| Molecular Formula | C21H44N3O6P |
Sodium deuteroxide, 40% w/w solution in D{2}O, 99.5%(Isotopic)
CAS: 14014-06-3 Molecular Formula: HNaO Molecular Weight (g/mol): 41.003 MDL Number: MFCD00037669 InChI Key: HEMHJVSKTPXQMS-DYCDLGHISA-M Synonym: sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci PubChem CID: 23676750 SMILES: [OH-].[Na+]
| PubChem CID | 23676750 |
|---|---|
| CAS | 14014-06-3 |
| Molecular Weight (g/mol) | 41.003 |
| MDL Number | MFCD00037669 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci |
| InChI Key | HEMHJVSKTPXQMS-DYCDLGHISA-M |
| Molecular Formula | HNaO |
| Name Note | 0.127mm (0.005 in.) dia. |
|---|---|
| Form | Wire |
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00148499 |
| Health Hazard 2 | GHS H Statement H372-H351-H317 Causes damage to organs through prolonged or repeated exposure. Suspected of causing cancer. May cause an allergic skin reaction. |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Stainless Steel wire, Type 304 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Avg. Mol. Wt. or Mol. Wt. Range | Fe:Cr:Ni; 70:19:11 wt% |
Calcium granules, redistilled, -16 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-70-2 Molecular Formula: Ca Molecular Weight (g/mol): 40.08 MDL Number: MFCD00010897 MFCD00085314 InChI Key: OYPRJOBELJOOCE-UHFFFAOYSA-N Synonym: unii-sy7q814vup,hsdb 273,sy7q814vup,compounds,elemental,calcium, elemental,kalzium,atom,ingot,chelate PubChem CID: 5460341 ChEBI: CHEBI:29320 IUPAC Name: calcium SMILES: [Ca]
| PubChem CID | 5460341 |
|---|---|
| CAS | 7440-70-2 |
| Molecular Weight (g/mol) | 40.08 |
| ChEBI | CHEBI:29320 |
| MDL Number | MFCD00010897 MFCD00085314 |
| SMILES | [Ca] |
| Synonym | unii-sy7q814vup,hsdb 273,sy7q814vup,compounds,elemental,calcium, elemental,kalzium,atom,ingot,chelate |
| IUPAC Name | calcium |
| InChI Key | OYPRJOBELJOOCE-UHFFFAOYSA-N |
| Molecular Formula | Ca |
Carboxymethyl Cellulose, Sodium Salt, MP Biomedicals™
CAS: 9004-32-4 Molecular Formula: (C12 H14 O9 R6)n Molecular Weight (g/mol): 263.20 MDL Number: MFCD00081472 InChI Key: DPXJVFZANSGRMM-UHFFFAOYNA-N Synonym: carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn PubChem CID: 23706213 IUPAC Name: 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium SMILES: [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O
| PubChem CID | 23706213 |
|---|---|
| CAS | 9004-32-4 |
| Molecular Weight (g/mol) | 263.20 |
| MDL Number | MFCD00081472 |
| SMILES | [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| Synonym | carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium |
| InChI Key | DPXJVFZANSGRMM-UHFFFAOYNA-N |
| Molecular Formula | (C12 H14 O9 R6)n |
Holmium(III) oxide, 99.9%, (Total Rare Earth Oxides), -325 mesh
CAS: 12055-62-8 Molecular Formula: Ho2O3 Molecular Weight (g/mol): 377.86 MDL Number: MFCD00011053 InChI Key: OWCYYNSBGXMRQN-UHFFFAOYSA-N IUPAC Name: diholmium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ho+3].[Ho+3]
| CAS | 12055-62-8 |
|---|---|
| Molecular Weight (g/mol) | 377.86 |
| MDL Number | MFCD00011053 |
| SMILES | [O--].[O--].[O--].[Ho+3].[Ho+3] |
| IUPAC Name | diholmium(3+) trioxidandiide |
| InChI Key | OWCYYNSBGXMRQN-UHFFFAOYSA-N |
| Molecular Formula | Ho2O3 |
Nickel powder, 99.996% (metals basis), Thermo Scientific Chemicals, Puratronic™
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Lanthanum(III) chloride, anhydrous, 99.9% (REO)
CAS: 10099-58-8 Molecular Formula: Cl3La Molecular Weight (g/mol): 245.26 MDL Number: MFCD00011068 InChI Key: ICAKDTKJOYSXGC-UHFFFAOYSA-K IUPAC Name: lanthanum(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[La+3]
| CAS | 10099-58-8 |
|---|---|
| Molecular Weight (g/mol) | 245.26 |
| MDL Number | MFCD00011068 |
| SMILES | [Cl-].[Cl-].[Cl-].[La+3] |
| IUPAC Name | lanthanum(3+) trichloride |
| InChI Key | ICAKDTKJOYSXGC-UHFFFAOYSA-K |
| Molecular Formula | Cl3La |
Thermo Scientific Chemicals Dodecyl sulfate, sodium salt, 98%, for biochemistry, suitable for electrophoresis
CAS: 151-21-3 | C12H25NaO4S | 288.38 g/mol
| Linear Formula | CH3(CH2)11OSO3Na |
|---|---|
| Molecular Weight (g/mol) | 288.38 |
| Loss on Drying | 1% max. |
| ChEBI | CHEBI:8984 |
| Color | White |
| Physical Form | Fine Crystalline, Flaky or Granular Powder |
| Chemical Name or Material | Dodecyl sulfate, sodium salt |
| Grade | Biochemical |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Merck Index | 15, 8768 |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| PubChem CID | 3423265 |
| Percent Purity | 98% |
| Fieser | 13,281 |
| CAS | 7647-14-5 |
| Infrared Spectrum | Authentic |
| MDL Number | MFCD00036175 |
| Flash Point | >150°C |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| IUPAC Name | sodium dodecyl sulfate |
| Beilstein | 01, III, 1786 |
| Molecular Formula | C12H25NaO4S |
| Formula Weight | 288.38 |
| Melting Point | 206.0°C |
Gold powder, spherical, APS 0.8-1.5 micron, 99.96+% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |