Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Antimony(V) chloride, ultra dry, 99.999% (metals basis)
CAS: 7647-18-9 Molecular Formula: Cl5Sb Molecular Weight (g/mol): 299.02 MDL Number: MFCD00011213 InChI Key: VMPVEPPRYRXYNP-UHFFFAOYSA-I Synonym: antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german PubChem CID: 24294 IUPAC Name: antimony pentachloride SMILES: Cl[Sb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24294 |
|---|---|
| CAS | 7647-18-9 |
| Molecular Weight (g/mol) | 299.02 |
| MDL Number | MFCD00011213 |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | antimony pentachloride |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Molecular Formula | Cl5Sb |
Titanium(IV) n-butoxide, 99+%
CAS: 5593-70-4 Molecular Formula: C16H40O4Ti Molecular Weight (g/mol): 344.359 MDL Number: MFCD00009433 InChI Key: FPCJKVGGYOAWIZ-UHFFFAOYSA-N Synonym: butyl titanate,butan-1-ol; titanium,titanium n-butoxide,tetrabutyl orthotitanate,tetrabutyl titanate,1-butanol; titanium,tetra butyl orthotitanate,tetrabutyl ortho-titanate PubChem CID: 25203927 IUPAC Name: butan-1-ol;titanium SMILES: CCCCO.CCCCO.CCCCO.CCCCO.[Ti]
| PubChem CID | 25203927 |
|---|---|
| CAS | 5593-70-4 |
| Molecular Weight (g/mol) | 344.359 |
| MDL Number | MFCD00009433 |
| SMILES | CCCCO.CCCCO.CCCCO.CCCCO.[Ti] |
| Synonym | butyl titanate,butan-1-ol; titanium,titanium n-butoxide,tetrabutyl orthotitanate,tetrabutyl titanate,1-butanol; titanium,tetra butyl orthotitanate,tetrabutyl ortho-titanate |
| IUPAC Name | butan-1-ol;titanium |
| InChI Key | FPCJKVGGYOAWIZ-UHFFFAOYSA-N |
| Molecular Formula | C16H40O4Ti |
Copper(I) cyanide
CAS: 544-92-3 Molecular Formula: CCuN Molecular Weight (g/mol): 89.564 MDL Number: MFCD00010975 InChI Key: DOBRDRYODQBAMW-UHFFFAOYSA-N Synonym: copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper PubChem CID: 11009 IUPAC Name: copper(1+);cyanide SMILES: [C-]#N.[Cu+]
| PubChem CID | 11009 |
|---|---|
| CAS | 544-92-3 |
| Molecular Weight (g/mol) | 89.564 |
| MDL Number | MFCD00010975 |
| SMILES | [C-]#N.[Cu+] |
| Synonym | copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper |
| IUPAC Name | copper(1+);cyanide |
| InChI Key | DOBRDRYODQBAMW-UHFFFAOYSA-N |
| Molecular Formula | CCuN |
Tetraphenylboron sodium, ACS reagent
CAS: 143-66-8 Molecular Formula: C24H20BNa Molecular Weight (g/mol): 342.22 MDL Number: MFCD00011494 InChI Key: HFSRCEJMTLMDLI-UHFFFAOYSA-N Synonym: sodium tetraphenylborate,tetraphenylboron sodium,sodium tetraphenylboron,kalignost,sodium tetraphenylborate 1-,kalibor,dotite kalibor,kariporu k,borate 1-, tetraphenyl-, sodium,sodium tetraphenylboride PubChem CID: 2723787 IUPAC Name: sodium tetraphenylboranuide SMILES: [Na+].C1=CC=C(C=C1)[B-](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2723787 |
|---|---|
| CAS | 143-66-8 |
| Molecular Weight (g/mol) | 342.22 |
| MDL Number | MFCD00011494 |
| SMILES | [Na+].C1=CC=C(C=C1)[B-](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | sodium tetraphenylborate,tetraphenylboron sodium,sodium tetraphenylboron,kalignost,sodium tetraphenylborate 1-,kalibor,dotite kalibor,kariporu k,borate 1-, tetraphenyl-, sodium,sodium tetraphenylboride |
| IUPAC Name | sodium tetraphenylboranuide |
| InChI Key | HFSRCEJMTLMDLI-UHFFFAOYSA-N |
| Molecular Formula | C24H20BNa |
Cadmium carbonate, >99% (metals basis), Thermo Scientific Chemicals
CAS: 513-78-0 Molecular Formula: CCdO3 Molecular Weight (g/mol): 172.42 MDL Number: MFCD00010918 InChI Key: GKDXQAKPHKQZSC-UHFFFAOYSA-L Synonym: cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly PubChem CID: 10564 IUPAC Name: cadmium(2+);carbonate SMILES: [Cd++].[O-]C([O-])=O
| PubChem CID | 10564 |
|---|---|
| CAS | 513-78-0 |
| Molecular Weight (g/mol) | 172.42 |
| MDL Number | MFCD00010918 |
| SMILES | [Cd++].[O-]C([O-])=O |
| Synonym | cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly |
| IUPAC Name | cadmium(2+);carbonate |
| InChI Key | GKDXQAKPHKQZSC-UHFFFAOYSA-L |
| Molecular Formula | CCdO3 |
Rhodium(II) trifluoroacetate dimer
CAS: 31126-95-1 Molecular Formula: C8F12O8Rh2 Molecular Weight (g/mol): 657.88 MDL Number: MFCD00209611 InChI Key: SZQVMUPTZFMHQT-UHFFFAOYSA-N Synonym: rhodium ii trifluoroacetate dimer,trifluoroacetic acid rhodium ii salt dimer,dirhodium ii tetra trifluoroacetate,rhodium ii trifluoroacetate dimer, ?rh2 cf3coo 4,bis 2,2,2-trifluoroacetyl oxy rhodio 2,2,2-trifluoroacetate PubChem CID: 10985187 IUPAC Name: rhodium;2,2,2-trifluoroacetic acid SMILES: C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.[Rh].[Rh]
| PubChem CID | 10985187 |
|---|---|
| CAS | 31126-95-1 |
| Molecular Weight (g/mol) | 657.88 |
| MDL Number | MFCD00209611 |
| SMILES | C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O.[Rh].[Rh] |
| Synonym | rhodium ii trifluoroacetate dimer,trifluoroacetic acid rhodium ii salt dimer,dirhodium ii tetra trifluoroacetate,rhodium ii trifluoroacetate dimer, ?rh2 cf3coo 4,bis 2,2,2-trifluoroacetyl oxy rhodio 2,2,2-trifluoroacetate |
| IUPAC Name | rhodium;2,2,2-trifluoroacetic acid |
| InChI Key | SZQVMUPTZFMHQT-UHFFFAOYSA-N |
| Molecular Formula | C8F12O8Rh2 |
Yttrium(III) chloride hexahydrate, 99.9%, (trace metal basis)
CAS: 10025-94-2 Molecular Formula: Cl3Y·6H2O Molecular Weight (g/mol): 303.35 MDL Number: MFCD00149941
| CAS | 10025-94-2 |
|---|---|
| Molecular Weight (g/mol) | 303.35 |
| MDL Number | MFCD00149941 |
| Molecular Formula | Cl3Y·6H2O |
Zinc selenide, Optical Grade, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 1315-09-9 Molecular Formula: SeZn Molecular Weight (g/mol): 144.35 MDL Number: MFCD00011296 InChI Key: GTLQJUQHDTWYJC-UHFFFAOYSA-N Synonym: zinc selenide znse,znse,zinc selenide, spectro,zinc selenide, powder, 10 mum trace metals basis,zinc selenide crystal optic disc, 13mm x 1mm, polished both sides,zinc selenide crystal optic disc, 13mm x 2mm, polished both sides,zinc selenide crystal optic disc, 25mm x 2mm, polished both sides,zinc selenide optical window, 12.7mm 0.5in dia x 1mm 0.04in thick,zinc selenide optical window, 12.7mm 0.5in dia x 2mm 0.08in thick,zinc selenide optical window, 25.4mm 1.0in dia x 1mm 0.04in thick IUPAC Name: zinc(2+) selandiide SMILES: [Zn++].[Se--]
| CAS | 1315-09-9 |
|---|---|
| Molecular Weight (g/mol) | 144.35 |
| MDL Number | MFCD00011296 |
| SMILES | [Zn++].[Se--] |
| Synonym | zinc selenide znse,znse,zinc selenide, spectro,zinc selenide, powder, 10 mum trace metals basis,zinc selenide crystal optic disc, 13mm x 1mm, polished both sides,zinc selenide crystal optic disc, 13mm x 2mm, polished both sides,zinc selenide crystal optic disc, 25mm x 2mm, polished both sides,zinc selenide optical window, 12.7mm 0.5in dia x 1mm 0.04in thick,zinc selenide optical window, 12.7mm 0.5in dia x 2mm 0.08in thick,zinc selenide optical window, 25.4mm 1.0in dia x 1mm 0.04in thick |
| IUPAC Name | zinc(2+) selandiide |
| InChI Key | GTLQJUQHDTWYJC-UHFFFAOYSA-N |
| Molecular Formula | SeZn |
Zinc nitride, 99% (metals basis)
CAS: 1313-49-1 Molecular Formula: N2Zn3 Molecular Weight (g/mol): 224.15 MDL Number: MFCD00061327 InChI Key: AKJVMGQSGCSQBU-UHFFFAOYSA-N Synonym: zinc nitride,zinc nitride zn3n2 PubChem CID: 12130759 SMILES: [Zn++].[N-]=[Zn].[N-]=[Zn]
| PubChem CID | 12130759 |
|---|---|
| CAS | 1313-49-1 |
| Molecular Weight (g/mol) | 224.15 |
| MDL Number | MFCD00061327 |
| SMILES | [Zn++].[N-]=[Zn].[N-]=[Zn] |
| Synonym | zinc nitride,zinc nitride zn3n2 |
| InChI Key | AKJVMGQSGCSQBU-UHFFFAOYSA-N |
| Molecular Formula | N2Zn3 |
Zinc sulfide, 99.99%, (trace metal basis), < 10 microns
CAS: 1314-98-3 Molecular Formula: SZn Molecular Weight (g/mol): 97.44 MDL Number: MFCD00011301 InChI Key: DRDVZXDWVBGGMH-UHFFFAOYSA-N Synonym: zinc sulfide,sachtolith,sphalerite,zinc blende,albalith,cleartran,zinc monosulfide,pigment white 7,zinc sulfide zns,zinc sulphide PubChem CID: 14821 SMILES: [S--].[Zn++]
| PubChem CID | 14821 |
|---|---|
| CAS | 1314-98-3 |
| Molecular Weight (g/mol) | 97.44 |
| MDL Number | MFCD00011301 |
| SMILES | [S--].[Zn++] |
| Synonym | zinc sulfide,sachtolith,sphalerite,zinc blende,albalith,cleartran,zinc monosulfide,pigment white 7,zinc sulfide zns,zinc sulphide |
| InChI Key | DRDVZXDWVBGGMH-UHFFFAOYSA-N |
| Molecular Formula | SZn |
Iron(II) bromide, anhydrous, 98% min
CAS: 7789-46-0 Molecular Formula: Br2Fe Molecular Weight (g/mol): 215.65 MDL Number: MFCD00016081 InChI Key: GYCHYNMREWYSKH-UHFFFAOYSA-L Synonym: iron dibromide,unii-ea3x054rbz,iron ii bromide,ea3x054rbz,iron 2+ dibromide,iron ion 2+ dibromide,iron ii bromide, anhydrous 5g,iron ii bromide, ultra dry metals basis,ferrous bromide, anhydrous PubChem CID: 82240 IUPAC Name: λ²-iron(2+) dibromide SMILES: [Fe++].[Br-].[Br-]
| PubChem CID | 82240 |
|---|---|
| CAS | 7789-46-0 |
| Molecular Weight (g/mol) | 215.65 |
| MDL Number | MFCD00016081 |
| SMILES | [Fe++].[Br-].[Br-] |
| Synonym | iron dibromide,unii-ea3x054rbz,iron ii bromide,ea3x054rbz,iron 2+ dibromide,iron ion 2+ dibromide,iron ii bromide, anhydrous 5g,iron ii bromide, ultra dry metals basis,ferrous bromide, anhydrous |
| IUPAC Name | λ²-iron(2+) dibromide |
| InChI Key | GYCHYNMREWYSKH-UHFFFAOYSA-L |
| Molecular Formula | Br2Fe |
Bismuth(III) oxychloride, 97%, pure
CAS: 7787-59-9 Molecular Formula: BiClO Molecular Weight (g/mol): 260.43 InChI Key: BWOROQSFKKODDR-UHFFFAOYSA-N Synonym: bismuth oxychloride,mearlite,pearl white,bismuthine, chlorooxo,wismutchloridoxid,bismut-chlorid-oxid,biju,bismuth chloride oxide,basic bismuth chloride,wismut iii-chlorid-oxid PubChem CID: 6328152 IUPAC Name: oxobismuth;hydrochloride SMILES: O=[Bi].Cl
| PubChem CID | 6328152 |
|---|---|
| CAS | 7787-59-9 |
| Molecular Weight (g/mol) | 260.43 |
| SMILES | O=[Bi].Cl |
| Synonym | bismuth oxychloride,mearlite,pearl white,bismuthine, chlorooxo,wismutchloridoxid,bismut-chlorid-oxid,biju,bismuth chloride oxide,basic bismuth chloride,wismut iii-chlorid-oxid |
| IUPAC Name | oxobismuth;hydrochloride |
| InChI Key | BWOROQSFKKODDR-UHFFFAOYSA-N |
| Molecular Formula | BiClO |
Cobalt(II) sulfate heptahydrate, 99+%, extra pure
CAS: 10026-24-1 Molecular Formula: CoH14O11S Molecular Weight (g/mol): 281.09 MDL Number: MFCD00149658 InChI Key: MEYVLGVRTYSQHI-UHFFFAOYSA-L Synonym: cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o PubChem CID: 61444 SMILES: O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O
| PubChem CID | 61444 |
|---|---|
| CAS | 10026-24-1 |
| Molecular Weight (g/mol) | 281.09 |
| MDL Number | MFCD00149658 |
| SMILES | O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O |
| Synonym | cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o |
| InChI Key | MEYVLGVRTYSQHI-UHFFFAOYSA-L |
| Molecular Formula | CoH14O11S |
Calcium hydrogen phosphate, anhydrous, 98% min
CAS: 7757-93-9 Molecular Formula: CaHO4P Molecular Weight (g/mol): 136.06 MDL Number: MFCD00010909 InChI Key: FUFJGUQYACFECW-UHFFFAOYSA-L Synonym: calcium hydrogen phosphate,calcium hydrogenphosphate,calcium phosphate dibasic,calcium phosphate, dibasic,biofos,fujicalin s,dicafos an,dibasic calcium phosphate,monocalcium acid phosphate,phosphoric acid, calcium salt 1:1 PubChem CID: 24441 ChEBI: CHEBI:32596 IUPAC Name: calcium;hydrogen phosphate SMILES: [Ca++].OP([O-])([O-])=O
| PubChem CID | 24441 |
|---|---|
| CAS | 7757-93-9 |
| Molecular Weight (g/mol) | 136.06 |
| ChEBI | CHEBI:32596 |
| MDL Number | MFCD00010909 |
| SMILES | [Ca++].OP([O-])([O-])=O |
| Synonym | calcium hydrogen phosphate,calcium hydrogenphosphate,calcium phosphate dibasic,calcium phosphate, dibasic,biofos,fujicalin s,dicafos an,dibasic calcium phosphate,monocalcium acid phosphate,phosphoric acid, calcium salt 1:1 |
| IUPAC Name | calcium;hydrogen phosphate |
| InChI Key | FUFJGUQYACFECW-UHFFFAOYSA-L |
| Molecular Formula | CaHO4P |