Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Mercuric Chloride, Crystal, ACS, 99.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| CAS | 7487-94-7 |
|---|---|
| Molecular Weight (g/mol) | 271.49 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Potassium antimonate trihydrate, 94+%
CAS: 12208-13-8 Molecular Formula: KSbO3·3H2O MDL Number: MFCD00150439
| CAS | 12208-13-8 |
|---|---|
| MDL Number | MFCD00150439 |
| Molecular Formula | KSbO3·3H2O |
Mercuric Chloride, Saturated Solution at 0°C, Reagents
Mercuric Chloride, Saturated Solution at 0°C, Reagent, for general laboratory use. Manufactured in ISO 9001 facility.
Mercuric Chloride, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Iron(II) fumarate, 94%
CAS: 141-01-5 Molecular Formula: C4H2FeO4-2 Molecular Weight (g/mol): 169.901 MDL Number: MFCD00058315 InChI Key: OOPLWEDSEDELIX-TYYBGVCCSA-L Synonym: ferrous fumarate,eisenfumarat PubChem CID: 66524104 IUPAC Name: (E)-but-2-enedioate;iron SMILES: C(=CC(=O)[O-])C(=O)[O-].[Fe]
| PubChem CID | 66524104 |
|---|---|
| CAS | 141-01-5 |
| Molecular Weight (g/mol) | 169.901 |
| MDL Number | MFCD00058315 |
| SMILES | C(=CC(=O)[O-])C(=O)[O-].[Fe] |
| Synonym | ferrous fumarate,eisenfumarat |
| IUPAC Name | (E)-but-2-enedioate;iron |
| InChI Key | OOPLWEDSEDELIX-TYYBGVCCSA-L |
| Molecular Formula | C4H2FeO4-2 |
Mercuric Chloride, Saturated, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Mercuric Chloride, ACS Reagent Mercury(II) Chloride, Reagents
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: Mercury(II) Chloride IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| CAS | 7487-94-7 |
|---|---|
| Molecular Weight (g/mol) | 271.49 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | Mercury(II) Chloride |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Thermo Scientific Chemicals Cytidine 5'-triphosphate, disodium salt hydrate, 95%
Dibutyltin dilaurate, 94%
CAS: 77-58-7 Molecular Formula: C32H64O4Sn Molecular Weight (g/mol): 631.57 Synonym: Dodecanoic acid 1, 1';-(dibutylstannylene) ester
| CAS | 77-58-7 |
|---|---|
| Molecular Weight (g/mol) | 631.57 |
| Synonym | Dodecanoic acid 1, 1';-(dibutylstannylene) ester |
| Molecular Formula | C32H64O4Sn |
Mercury(II) chloride, 98+%
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: dichloromercury SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | dichloromercury |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Sodium tetracyanoplatinate(II) hydrate, Premion™, 99.95% (metals basis), Pt 48.4% min, Thermo Scientific Chemicals
CAS: 699012-94-7 Molecular Formula: C4N4Na2Pt Molecular Weight (g/mol): 345.13 MDL Number: MFCD00798527 InChI Key: WOIFBVMIVVRIIE-UHFFFAOYSA-N Synonym: disodium tetracyanoplatinumdiuide hydrate,sodium tetracyanoplatinate ii hydrate, premion PubChem CID: 16217382 IUPAC Name: disodium tetracyanoplatinumbis(ylium) SMILES: [Na+].[Na+].N#C[Pt++](C#N)(C#N)C#N
| PubChem CID | 16217382 |
|---|---|
| CAS | 699012-94-7 |
| Molecular Weight (g/mol) | 345.13 |
| MDL Number | MFCD00798527 |
| SMILES | [Na+].[Na+].N#C[Pt++](C#N)(C#N)C#N |
| Synonym | disodium tetracyanoplatinumdiuide hydrate,sodium tetracyanoplatinate ii hydrate, premion |
| IUPAC Name | disodium tetracyanoplatinumbis(ylium) |
| InChI Key | WOIFBVMIVVRIIE-UHFFFAOYSA-N |
| Molecular Formula | C4N4Na2Pt |
Phosphorus oxybromide, 95%
CAS: 7789-59-5 Molecular Formula: Br3OP Molecular Weight (g/mol): 286.69 InChI Key: UXCDUFKZSUBXGM-UHFFFAOYSA-N Synonym: phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 PubChem CID: 24613 SMILES: O=P(Br)(Br)Br
| PubChem CID | 24613 |
|---|---|
| CAS | 7789-59-5 |
| Molecular Weight (g/mol) | 286.69 |
| SMILES | O=P(Br)(Br)Br |
| Synonym | phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 |
| InChI Key | UXCDUFKZSUBXGM-UHFFFAOYSA-N |
| Molecular Formula | Br3OP |
Mercury(II) chloride, ACS, 99.5% min
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: dichloromercury SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | dichloromercury |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Vinyloxytrimethylsilane, 97%
CAS: 6213-94-1 Molecular Formula: C5H12OSi Molecular Weight (g/mol): 116.235 MDL Number: MFCD00054764 InChI Key: HFTNNOZFRQLFQB-UHFFFAOYSA-N Synonym: trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether PubChem CID: 80344 IUPAC Name: ethenoxy(trimethyl)silane SMILES: C[Si](C)(C)OC=C
| PubChem CID | 80344 |
|---|---|
| CAS | 6213-94-1 |
| Molecular Weight (g/mol) | 116.235 |
| MDL Number | MFCD00054764 |
| SMILES | C[Si](C)(C)OC=C |
| Synonym | trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether |
| IUPAC Name | ethenoxy(trimethyl)silane |
| InChI Key | HFTNNOZFRQLFQB-UHFFFAOYSA-N |
| Molecular Formula | C5H12OSi |
Dimethylethoxysilane, 94%
CAS: 14857-34-2 Molecular Formula: C4H11OSi Molecular Weight (g/mol): 103.216 MDL Number: MFCD00026750 InChI Key: DRUOQOFQRYFQGB-UHFFFAOYSA-N Synonym: ethoxydimethylsilane,dimethylethoxysilane,silane, ethoxydimethyl,dimethyl ethoxysilane,ethoxy dimethyl silicon,dimethylethoxysilane, ammonia-free,ethoxydimethylsilyl,ethoxydimethyl-silan,sgqhhgcihcup@,4-04-00-03991 beilstein handbook reference PubChem CID: 6328550 IUPAC Name: ethoxy(dimethyl)silicon SMILES: CCO[Si](C)C
| PubChem CID | 6328550 |
|---|---|
| CAS | 14857-34-2 |
| Molecular Weight (g/mol) | 103.216 |
| MDL Number | MFCD00026750 |
| SMILES | CCO[Si](C)C |
| Synonym | ethoxydimethylsilane,dimethylethoxysilane,silane, ethoxydimethyl,dimethyl ethoxysilane,ethoxy dimethyl silicon,dimethylethoxysilane, ammonia-free,ethoxydimethylsilyl,ethoxydimethyl-silan,sgqhhgcihcup@,4-04-00-03991 beilstein handbook reference |
| IUPAC Name | ethoxy(dimethyl)silicon |
| InChI Key | DRUOQOFQRYFQGB-UHFFFAOYSA-N |
| Molecular Formula | C4H11OSi |