Halohydrins
eMolecules 75-89-8 | 2,2,2-Trifluoroethanol redistilled from glass grade | Oakwood Chemical | MFCD00004672 | 100.040 | C2H3F3O | 99.000 | OCC(F)(F)F | 10g | 594229420
2,2,2-Trifluoroethanol redistilled from glass grade | Oakwood Chemical | 75-89-8 | MFCD00004672 | 100.040 | C2H3F3O | 99.000 | OCC(F)(F)F | 10g | 594229420
eMolecules 827-15-6 | 1,2,3,4,5-pentafluoro-6-iodo-benzene | Pharmablock | MFCD00001032 | 293.962 | C6F5I | 97.000 | Fc1c(F)c(F)c(I)c(F)c1F | 100g | 716544305
1,2,3,4,5-pentafluoro-6-iodo-benzene | Pharmablock | 827-15-6 | MFCD00001032 | 293.962 | C6F5I | 97.000 | Fc1c(F)c(F)c(I)c(F)c1F | 100g | 716544305
Cambridge Isotope Laboratories PCB Syringe Spike (PCB-70/111/138/170) (13C12 99%) 1000 ng/mL in nonane 1 2 mL
PCB Syringe Spike (PCB-70/111/138/170) (13C12 99%) 1000 ng/mL in nonane 1 2 mL
Aobchem 2-(2 4 6-Trifluorophenyl)propan-2-ol | ≥95% | CAS 1521018-79-0 | C9H9F3O | 5g
2-(2 4 6-Trifluorophenyl)propan-2-ol | ≥95% | CAS 1521018-79-0 | C9H9F3O | 5g
Aobchem 1-(2 3 5-Trichlorophenyl)propan-1-one | 95% | CAS 1824052-19-8 | C9H7Cl3O | 250mg
1-(2 3 5-Trichlorophenyl)propan-1-one | 95% | CAS 1824052-19-8 | C9H7Cl3O | 250mg
eMolecules 58943-98-9 | Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 1g | 562428362
Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | 58943-98-9 | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 1g | 562428362
Medchemexpress LLC 6-(tritylthio)hexanoic acid | 80441-55-0 | MFCD11226801 | 95.0% | 390.54 g·mol⁻¹ | C25H26O2S | 500 MG
6-(Tritylthio)hexanoic acid is a protected thiol linker bearing a tritylthio (Tst) group and a terminal carboxylic acid. The Tst group is removable under acidic conditions to reveal a free thiol. This compound is used as a building block in organic synthesis and for peptide modification and bioconjugation workflows.
eMolecules 920-66-1 | 1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL | AstaTech | MFCD00011651 | 168.038 | C3H2F6O | 95.000 | OC(C(F)(F)F)C(F)(F)F | 25g | 791171390
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL | AstaTech | 920-66-1 | MFCD00011651 | 168.038 | C3H2F6O | 95.000 | OC(C(F)(F)F)C(F)(F)F | 25g | 791171390
Aobchem 2-Methyl-2-(pyrazin-2-yl)propanenitrile | ≥95% | CAS 5106-58-1 | C8H9N3 | 1g
2-Methyl-2-(pyrazin-2-yl)propanenitrile | ≥95% | CAS 5106-58-1 | C8H9N3 | 1g