Organic zwitterions
Chemscene ChemScene | 3-Fluoro-4-nitroaniline | 25G | CS-D1432 | 0.98 | 2369-13-3| MFCD03412239 | 156.12
ChemScene | 3-Fluoro-4-nitroaniline | 25G | CS-D1432 | 0.98 | 2369-13-3| MFCD03412239 | 156.12
eMolecules 6575-07-1 | 2-Chloro-6-nitrobenzonitrile | MFCD00007203 | 25g
Combi-Blocks | 2-Chloro-6-nitrobenzonitrile | 25g | 482934466 | QF-3838 | 95.000 | 6575-07-1 | MFCD00007203 | 182.560 | C7H3ClN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chem-Impex International, Inc. 3-Chloro-4-nitroaniline | MFCD00085922 | 25G
3-Chloro-4-nitroaniline, MFCD00085922, 25G
=O | 25g | 290705653](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502183881.JPG-250.jpg)
eMolecules 610-15-1 | 2-Nitrobenzamide | Combi-Blocks | MFCD00007976 | 166.136 | C7H6N2O3 | 95.000 | NC(=O)c1ccccc1[N+]([O-])=O | 25g | 290705653
2-Nitrobenzamide | Combi-Blocks | 610-15-1 | MFCD00007976 | 166.136 | C7H6N2O3 | 95.000 | NC(=O)c1ccccc1[N+]([O-])=O | 25g | 290705653
=O | 0.25g | 718054034](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502458701.PNG-250.jpg)
eMolecules 2369-12-2 | 5-FLUORO-3-NITROANILINE | AstaTech | MFCD07368628 | 156.116 | C6H5FN2O2 | 95.000 | Nc1cc(F)cc(c1)[N+]([O-])=O | 0.25g | 718054034
5-FLUORO-3-NITROANILINE | AstaTech | 2369-12-2 | MFCD07368628 | 156.116 | C6H5FN2O2 | 95.000 | Nc1cc(F)cc(c1)[N+]([O-])=O | 0.25g | 718054034
=O | 25g | 398000296](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000164104.jpg-250.jpg)
eMolecules 100-01-6 | 4-Nitroaniline | Apollo Scientific US - Building Blocks | MFCD00007858 | 138.126 | C6H6N2O2 | 98.000 | Nc1ccc(cc1)[N+]([O-])=O | 25g | 398000296
4-Nitroaniline | Apollo Scientific US - Building Blocks | 100-01-6 | MFCD00007858 | 138.126 | C6H6N2O2 | 98.000 | Nc1ccc(cc1)[N+]([O-])=O | 25g | 398000296
Selleck Chemical LLC Piperonyl butoxide S4831-25mg
Piperonyl butoxide (PBO Butacide Ethanol butoxide Pyrenone 606 ENT-14250) is a man-made pesticide synergist working with insect killers to increase their effectiveness Piperonyl butoxide is an inhibitor of cytochrome P450 monooxygenases(P450s)
=O | 1g | 303330398](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502185563.JPG-250.jpg)
eMolecules 39835-09-1 | 2-Hydroxy-5-nitrobenzonitrile | Combi-Blocks | MFCD00234258 | 164.120 | C7H4N2O3 | 95.000 | Oc1ccc(cc1C#N)[N+]([O-])=O | 1g | 303330398
2-Hydroxy-5-nitrobenzonitrile | Combi-Blocks | 39835-09-1 | MFCD00234258 | 164.120 | C7H4N2O3 | 95.000 | Oc1ccc(cc1C#N)[N+]([O-])=O | 1g | 303330398